Joblib
Classifier_Weight / README.md
yinuozhang's picture
update name
850dfb5
---
license: cc-by-nc-nd-4.0
---
This repo contains important large files for [PeptiVerse](https://huggingface.co/spaces/ChatterjeeLab/PeptiVerse), an interactive app for peptide property prediction.
- `embeddings` folder contains processed huggingface datasets with peptideCLM embeddings. The `.csv` is the pre-processed data.
- `metrics` folder contains the model performance on the validation data
- `models` host all trained model weights
- `training_data` host all **raw data** to train the classifiers
- `functions` contains files to utilize the trained weights and classifiers
- `train` contains the script to train classifiers on the pre-processed embeddings, either through xgboost or MLPs.
- `scoring_function.py` contains a class that aggregates all trained classifiers for diverse downstream sampling applications
# PeptiVerse 🧬🌌
A collection of machine learning predictors for non-canonical and canonical peptide property prediction for SMILES representation. 🧬 PeptiVerse 🌌 enables evaluation of key biophysical and therapeutic properties of peptides for property-optimized generation.
## Predictors 🧫
PeptiVerse includes the following property predictors:
| Predictor | Measurement | Interpretation | Training Data Source | Dataset Size | Model Type |
|-----------|-------------|-----------------| --------------------|--------------|------------|
| **Non-Hemolysis** | Probability of non-hemolytic behavior | 0-1 scale, higher = less hemolytic | PeptideBERT, PepLand | 6,077 peptides | XGBoost + PeptideCLM embeddings |
| **Solubility** | Probability of aqueous solubility | 0-1 scale, higher = more soluble | PeptideBERT, PepLand | 18,454 peptides | XGBoost + PeptideCLM embeddings |
| **Non-Fouling** | Probability of non-fouling properties | 0-1 scale, higher = lower probability of binding to off-targets | PeptideBERT, PepLand | 17,186 peptides | XGBoost + PeptideCLM embeddings |
| **Permeability** | Cell membrane permeability (PAMPA lipophilicity score log P scale, range -10 to 0) | ≥ −6.0 indicate strong permeability and values < 6.0 indicate weak permeability | ChEMBL (22,040), CycPeptMPDB (7451) | 34,853 peptides | XGBoost + PeptideCLM embeddings + molecular descriptors |
| **Binding Affinity** | Peptide-protein binding strength (-log Kd/Ki/IC50 scale) | Weak binding (< 6.0), medium binding (6.0 − 7.5), and high binding (≥ 7.5) | PepLand | 1806 peptide-protein pairs | Cross-attention transformer (ESM2 + PeptideCLM) |
## Model Performance 🌟
#### Binary Classification Predictors
| Predictor | Val AUC | Val F1 |
|-----------|----------------|----------|
| **Non-Hemolysis** | 0.7902 | 0.8260 |
| **Solubility** | 0.6016 | 0.5767 |
| **Nonfouling** | 0.9327 | 0.8774 |
#### Regression Predictors
| Predictor | Train Correlation (Spearman) | Val Correlation (Spearman) |
|-----------|------------------------------|----------------------------|
| **Permeability** | 0.958 | 0.710 |
| **Binding Affinity** | 0.805 | 0.611 |
## Setup 🌟
1. Clone the repository:
```bash
git clone https://github.com/sophtang/PeptiVerse.git
cd PeptiVerse
```
2. Install environment:
```bash
conda env create -f environment.yml
conda activate peptiverse
```
3. Change the `base_path` in each file to ensure that all model weights and tokenizers are loaded correctly.
## Usage 🌟
#### 1. Hemolysis Prediction
Predicts the probability that a peptide is **not hemolytic**. Higher scores indicate safer peptides.
```python
import sys
sys.path.append('/path/to/PeptiVerse')
from functions.hemolysis.hemolysis import Hemolysis
# Initialize predictor
hemo = Hemolysis()
# Input peptide in SMILES format
peptides = [
"NCC(=O)N[C@H](CS)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC1=CN=C-N1)C(=O)O"
]
# Get predictions
scores = hemo(peptides)
print(f"Non-hemolytic probability: {scores[0]:.3f}")
```
**Output interpretation:**
- Score close to 1.0 = likely non-hemolytic (safe)
- Score close to 0.0 = likely hemolytic (unsafe)
---
#### 2. Solubility Prediction
Predicts aqueous solubility. Higher scores indicate better solubility.
```python
from functions.solubility.solubility import Solubility
# Initialize predictor
sol = Solubility()
# Input peptide
peptides = [
"NCC(=O)N[C@H](CS)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC1=CN=C-N1)C(=O)O"
]
# Get predictions
scores = sol(peptides)
print(f"Solubility probability: {scores[0]:.3f}")
```
**Output interpretation:**
- Score close to 1.0 = highly soluble
- Score close to 0.0 = poorly soluble
---
#### 3. Nonfouling Prediction
Predicts protein resistance/non-fouling properties.
```python
from functions.nonfouling.nonfouling import Nonfouling
# Initialize predictor
nf = Nonfouling()
# Input peptide
peptides = [
"NCC(=O)N[C@H](CS)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC1=CN=C-N1)C(=O)O"
]
# Get predictions
scores = nf(peptides)
print(f"Nonfouling score: {scores[0]:.3f}")
```
**Output interpretation:**
- Higher scores = better non-fouling properties
---
#### 4. Permeability Prediction
Predicts membrane permeability on a log P scale.
```python
from functions.permeability.permeability import Permeability
# Initialize predictor
perm = Permeability()
# Input peptide
peptides = [
"N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cNc2c1cc(O)cc2)C(=O)O"
]
# Get predictions
scores = perm(peptides)
print(f"Permeability (log P): {scores[0]:.3f}")
```
**Output interpretation:**
- Higher values = more permeable
- Typical range: -10 to 0 (log scale)
---
#### 5. Binding Affinity Prediction
Predicts peptide-protein binding affinity. Requires both peptide and target protein sequence.
```python
from functions.binding.binding import BindingAffinity
# Target protein sequence (amino acid format)
target_protein = "MTKSNGEEPKMGGRMERFQQGVRKRTLLAKKKVQNITKEDVKSYLFRNAFVLL..."
# Initialize predictor with target protein
binding = BindingAffinity(prot_seq=target_protein)
# Input peptide in SMILES format
peptides = [
"CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1c[nH]cn1)C(=O)O"
]
# Get predictions
scores = binding(peptides)
print(f"Binding affinity (-log Kd): {scores[0]:.3f}")
```
**Output interpretation:**
- Higher values = stronger binding
- Scale: -log(Kd/Ki/IC50)
- 7.5+ = tight binding (≤ ~30nM)
- 6.0-7.5 = medium binding (~30nM - 1μM)
- <6.0 = weak binding (> 1μM)
---
## Batch Processing 🌟
All predictors support batch processing for multiple peptides:
```python
from functions.hemolysis.hemolysis import Hemolysis
hemo = Hemolysis()
# Multiple peptides
peptides = [
"NCC(=O)N[C@H](CS)C(=O)O",
"CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)O)C(=O)O",
"N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)O"
]
# Get predictions for all
scores = hemo(peptides)
for i, score in enumerate(scores):
print(f"Peptide {i+1}: {score:.3f}")
```
---
## Unified Scoring with Multiple Predictors 🌟
For convenience, you can use `scoring_functions.py` to evaluate multiple properties at once and get a score vector for each peptide.
### Basic Usage
```python
import sys
sys.path.append('/path/to/PeptiVerse')
from scoring_functions import ScoringFunctions
# Initialize with desired scoring functions
# Available: 'binding_affinity1', 'binding_affinity2', 'permeability',
# 'solubility', 'hemolysis', 'nonfouling'
scoring = ScoringFunctions(
score_func_names=['solubility', 'hemolysis', 'nonfouling', 'permeability'],
prot_seqs=[] # Empty if not using binding affinity
)
# Input peptides in SMILES format
peptides = [
'N2[C@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C2(=O)',
'NCC(=O)N[C@H](CS)C(=O)N[C@@H](CO)C(=O)O'
]
# Get scores (returns numpy array of shape: num_peptides x num_functions)
scores = scoring(input_seqs=peptides)
print(scores)
```
### Adding Binding Affinity
```python
from scoring_functions import ScoringFunctions
# Target protein sequence (amino acid format)
tfr_protein = "MMDQARSAFSNLFGGEPLSYTRFSLARQVDGDNSHVEMKLAVDEEENADNNT..."
# Initialize with binding affinity for one protein
scoring = ScoringFunctions(
score_func_names=['binding_affinity1', 'solubility', 'hemolysis', 'permeability'],
prot_seqs=[tfr_protein] # Provide target protein sequence
)
peptides = ['N2[C@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C2(=O)']
scores = scoring(input_seqs=peptides)
# scores[0] will contain: [binding_affinity, solubility, hemolysis, permeability]
print(f"Scores for peptide 1:")
print(f" Binding Affinity: {scores[0][0]:.3f}")
print(f" Solubility: {scores[0][1]:.3f}")
print(f" Hemolysis: {scores[0][2]:.3f}")
print(f" Permeability: {scores[0][3]:.3f}")
```
### Multiple Binding Targets
```python
# For dual binding affinity prediction
protein1 = "MMDQARSAFSNLFGGEPLSYTR..." # First target
protein2 = "MTKSNGEEPKMGGRMERFQQGV..." # Second target
scoring = ScoringFunctions(
score_func_names=['binding_affinity1', 'binding_affinity2', 'solubility', 'hemolysis'],
prot_seqs=[protein1, protein2] # Provide both protein sequences
)
peptides = ['N2[C@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)...']
scores = scoring(input_seqs=peptides)
# scores[0] will contain: [binding_aff1, binding_aff2, solubility, hemolysis]
```
### Output Format
The `ScoringFunctions` class returns a numpy array where:
- **Rows**: Each row corresponds to one input peptide
- **Columns**: Each column corresponds to one scoring function (in the order specified)
```python
# Example with 3 peptides and 4 scoring functions
scores = scoring(input_seqs=peptides)
# Shape: (3, 4)
# scores[0] = [func1_score, func2_score, func3_score, func4_score] for peptide 1
# scores[1] = [func1_score, func2_score, func3_score, func4_score] for peptide 2
# scores[2] = [func1_score, func2_score, func3_score, func4_score] for peptide 3
```
---
## Complete Example 🌟
```python
import sys
sys.path.append('/path/to/PeptiVerse')
from functions.hemolysis.hemolysis import Hemolysis
from functions.solubility.solubility import Solubility
from functions.permeability.permeability import Permeability
# Initialize predictors
hemo = Hemolysis()
sol = Solubility()
perm = Permeability()
# Test peptide
peptide = ["NCC(=O)N[C@H](CS)C(=O)N[C@@H](CO)C(=O)O"]
# Get all predictions
hemo_score = hemo(peptide)[0]
sol_score = sol(peptide)[0]
perm_score = perm(peptide)[0]
print("Peptide Property Predictions:")
print(f" Hemolysis (non-hemolytic prob): {hemo_score:.3f}")
print(f" Solubility: {sol_score:.3f}")
print(f" Permeability: {perm_score:.3f}")
```
---
## Model Architecture 🌟
All predictors use:
- **Embeddings**: PeptideCLM-23M (RoFormer-based peptide language model)
- **Classifier**: XGBoost gradient boosting
- **Input**: SMILES representation of peptides
- **Training**: Models trained on curated datasets with cross-validation
---
## Citation
If you find this repository helpful for your publications, please consider citing our paper:
```
@article{tang2025peptune,
title={Peptune: De novo generation of therapeutic peptides with multi-objective-guided discrete diffusion},
author={Tang, Sophia and Zhang, Yinuo and Chatterjee, Pranam},
journal={42nd International Conference on Machine Learning},
year={2025}
}
```
To use this repository, you agree to abide by the MIT License.