rem
stringlengths
1
226k
add
stringlengths
0
227k
context
stringlengths
6
326k
meta
stringlengths
143
403
input_ids
listlengths
256
256
attention_mask
listlengths
256
256
labels
listlengths
128
128
workDequeue.push(object);
workDeque.push(object);
final void enumerateGrey(VM_Address object) throws VM_PragmaInline { if (Plan.isRCObject(object) && !RCBaseHeader.isGreen(object)) { if (VM_Interface.VerifyAssertions) VM_Interface._assert(RCBaseHeader.isLiveRC(object)); RCBaseHeader.decRC(object, false); workDequeue.push(object); } }
5245 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5245/a2d31fa1bc95145b8e2016e9bdeeb119aa707383/TrialDeletion.java/clean/rvm/src/vm/memoryManagers/JMTk/utility/TrialDeletion.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 918, 4241, 43, 266, 93, 12, 7397, 67, 1887, 733, 13, 565, 1216, 8251, 67, 2050, 9454, 10870, 288, 565, 309, 261, 5365, 18, 291, 11529, 921, 12, 1612, 13, 597, 401, 11529, 2171, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 918, 4241, 43, 266, 93, 12, 7397, 67, 1887, 733, 13, 565, 1216, 8251, 67, 2050, 9454, 10870, 288, 565, 309, 261, 5365, 18, 291, 11529, 921, 12, 1612, 13, 597, 401, 11529, 2171, 1...
if( address < AbstractRom.EB_ROM_SIZE_REGULAR - 1 && address >= 0 ) { textBlock = new Text( address, true ); } else { JOptionPane.showMessageDialog( null, "pointer out of bounds", "error", JOptionPane.ERROR_MESSAGE ); return false; }
JOptionPane.showMessageDialog(null, "pointer out of bounds", "error", JOptionPane.ERROR_MESSAGE); return false;
protected boolean updateTextPointer() { switch( sceneNumber ) { case 0: try { int address = Integer.parseInt(textPointer1Field.getText(), 16); if( rom.length() == 0x400200 ) { //this is just making sure that it won't have an error reading the rom //these values in the bounds should never be used for a pointer =p if( address < AbstractRom.EB_ROM_SIZE_EXPANDED - 1 && address >= 0 ) { textBlock = new Text( address, true ); } else { JOptionPane.showMessageDialog( null, "pointer out of bounds", "error", JOptionPane.ERROR_MESSAGE ); return false; } } else { if( address < AbstractRom.EB_ROM_SIZE_REGULAR - 1 && address >= 0 ) { textBlock = new Text( address, true ); } else { JOptionPane.showMessageDialog( null, "pointer out of bounds", "error", JOptionPane.ERROR_MESSAGE ); return false; } } } catch( NumberFormatException e ) { return false; } break; case 1: try { int address = Integer.parseInt(textPointer2Field.getText(), 16); if( rom.length() == 0x400200 ) { //this is just making sure that it won't have an error reading the rom //these values in the bounds should never be used for a pointer =p if( address < AbstractRom.EB_ROM_SIZE_EXPANDED - 1 && address >= 0 ) { textBlock = new Text( address, true ); } else { JOptionPane.showMessageDialog( null, "pointer out of bounds", "error", JOptionPane.ERROR_MESSAGE ); return false; } } else { if( address < AbstractRom.EB_ROM_SIZE_REGULAR - 1 && address >= 0 ) { textBlock = new Text( address, true ); } else { JOptionPane.showMessageDialog( null, "pointer out of bounds", "error", JOptionPane.ERROR_MESSAGE ); return false; } } } catch( NumberFormatException e ) { return false; } break; case 2: try { int address = Integer.parseInt(textPointer3Field.getText(), 16); if( rom.length() == 0x400200 ) { //this is just making sure that it won't have an error reading the rom //these values in the bounds should never be used for a pointer =p if( address < AbstractRom.EB_ROM_SIZE_EXPANDED - 1 && address >= 0 ) { textBlock = new Text( address, true ); } else { JOptionPane.showMessageDialog( null, "pointer out of bounds", "error", JOptionPane.ERROR_MESSAGE ); return false; } } else { if( address < AbstractRom.EB_ROM_SIZE_REGULAR - 1 && address >= 0 ) { textBlock = new Text( address, true ); } else { JOptionPane.showMessageDialog( null, "pointer out of bounds", "error", JOptionPane.ERROR_MESSAGE ); return false; } } } catch( NumberFormatException e ) { return false; } break; } return true; }
3699 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3699/e3746491678a9f0bdee74ba64d785d53772c8516/FlyoverEditor.java/clean/src/net/starmen/pkhack/eb/FlyoverEditor.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 2398, 4750, 1250, 1089, 1528, 4926, 1435, 5411, 288, 7734, 1620, 12, 9065, 1854, 262, 7734, 288, 10792, 648, 374, 30, 13491, 775, 13491, 288, 18701, 509, 1758, 273, 2144, 18, 2670, 1702, 12, 9...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 2398, 4750, 1250, 1089, 1528, 4926, 1435, 5411, 288, 7734, 1620, 12, 9065, 1854, 262, 7734, 288, 10792, 648, 374, 30, 13491, 775, 13491, 288, 18701, 509, 1758, 273, 2144, 18, 2670, 1702, 12, 9...
} else
} else
private VMRunnerConfiguration createVMRunner( ILaunchConfiguration configuration ) throws CoreException { String classpath[] = LauncherUtils.constructClasspath( configuration ); if ( classpath == null ) { String message = DebugUtil .getResourceString( "WorkbenchLauncherConfigurationDelegate.noStartup" ); throw new CoreException( LauncherUtils.createErrorStatus( message ) ); } String programArgs[] = getProgramArguments( configuration ); if ( programArgs == null ) { return null; } else { String envp[] = DebugPlugin.getDefault( ).getLaunchManager( ) .getEnvironment( configuration ); VMRunnerConfiguration runnerConfig = new VMRunnerConfiguration( "org.eclipse.core.launcher.Main", classpath ); runnerConfig.setVMArguments( getVMArguments( configuration ) ); runnerConfig.setProgramArguments( programArgs ); runnerConfig.setEnvironment( envp ); return runnerConfig; } }
15160 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/15160/8b9756089bd39ac79cb8f82862d9ee44f9de43e2/ReportLaunchConfigurationDelegate.java/clean/UI/org.eclipse.birt.report.debug.ui/src/org/eclipse/birt/report/debug/ui/launcher/ReportLaunchConfigurationDelegate.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 8251, 9709, 1750, 752, 7397, 9709, 12, 1082, 202, 2627, 4760, 1750, 1664, 262, 1216, 30015, 202, 95, 202, 202, 780, 10006, 8526, 273, 14643, 264, 1989, 18, 10062, 17461, 12, 16...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 8251, 9709, 1750, 752, 7397, 9709, 12, 1082, 202, 2627, 4760, 1750, 1664, 262, 1216, 30015, 202, 95, 202, 202, 780, 10006, 8526, 273, 14643, 264, 1989, 18, 10062, 17461, 12, 16...
Map options = COMPLETION_PROJECT.getOptions(true); Object timeout = options.get(JavaCore.CODEASSIST_DEPRECATION_CHECK);
Hashtable options = JavaCore.getOptions(); Object optionValue = options.get(JavaCore.CODEASSIST_DEPRECATION_CHECK); options.put(JavaCore.CODEASSIST_DEPRECATION_CHECK, JavaCore.ENABLED); JavaCore.setOptions(options);
public void testDeprecationCheck4() throws JavaModelException { Map options = COMPLETION_PROJECT.getOptions(true); Object timeout = options.get(JavaCore.CODEASSIST_DEPRECATION_CHECK); try { options.put(JavaCore.CODEASSIST_DEPRECATION_CHECK, JavaCore.ENABLED); COMPLETION_PROJECT.setOptions(options); this.workingCopies = new ICompilationUnit[2]; this.workingCopies[0] = getWorkingCopy( "/Completion/src/deprecation/Test.java", "package deprecation;"+ "public class Test {\n"+ " void foo() {"+ " ZZZType1.fo\n"+ " }"+ "}"); this.workingCopies[1] = getWorkingCopy( "/Completion/src/deprecation/ZZZType1.java", "package deprecation;"+ "public class ZZZType1 {\n"+ " public static void foo1(){}\n"+ " /** @deprecated */\n"+ " public static void foo2(){}\n"+ "}"); CompletionTestsRequestor2 requestor = new CompletionTestsRequestor2(true); String str = this.workingCopies[0].getSource(); String completeBehind = "ZZZType1.fo"; int cursorLocation = str.lastIndexOf(completeBehind) + completeBehind.length(); this.workingCopies[0].codeComplete(cursorLocation, requestor, this.wcOwner); assertResults( "foo1[METHOD_REF]{foo1(), Ldeprecation.ZZZType1;, ()V, foo1, null, " + (R_DEFAULT + R_INTERESTING + R_CASE + R_NON_INHERITED + R_NON_RESTRICTED) + "}", requestor.getResults()); } finally { options.put(JavaCore.CODEASSIST_DEPRECATION_CHECK, timeout); COMPLETION_PROJECT.setOptions(options); }}
10698 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/10698/dcc29d9125ab9c75db7cf3e3d58d8d50a20cc0a2/CompletionTests.java/buggy/org.eclipse.jdt.core.tests.model/src/org/eclipse/jdt/core/tests/model/CompletionTests.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 918, 1842, 758, 13643, 1564, 24, 1435, 1216, 5110, 1488, 503, 288, 202, 863, 702, 273, 13846, 30985, 67, 17147, 18, 588, 1320, 12, 3767, 1769, 202, 921, 2021, 273, 702, 18, 588, 12, 58...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 918, 1842, 758, 13643, 1564, 24, 1435, 1216, 5110, 1488, 503, 288, 202, 863, 702, 273, 13846, 30985, 67, 17147, 18, 588, 1320, 12, 3767, 1769, 202, 921, 2021, 273, 702, 18, 588, 12, 58...
try { position++; bCodeStream[classFileOffset++] = (byte) (value >> 8); } catch (IndexOutOfBoundsException e) { resizeByteArray((byte) (value >> 8));
if (classFileOffset + 1 >= bCodeStream.length) { resizeByteArray();
public final void writeSignedShort(int value) { try { position++; bCodeStream[classFileOffset++] = (byte) (value >> 8); } catch (IndexOutOfBoundsException e) { resizeByteArray((byte) (value >> 8)); } try { position++; bCodeStream[classFileOffset++] = (byte) value; } catch (IndexOutOfBoundsException e) { resizeByteArray((byte) value); }}
10698 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/10698/3a562aaf09f9f323b583086b80b4683378886606/CodeStream.java/buggy/org.eclipse.jdt.core/compiler/org/eclipse/jdt/internal/compiler/codegen/CodeStream.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 727, 918, 1045, 12294, 4897, 12, 474, 460, 13, 288, 202, 698, 288, 202, 202, 3276, 9904, 31, 202, 202, 70, 1085, 1228, 63, 1106, 812, 2335, 9904, 65, 273, 261, 7229, 13, 261, 1132, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 727, 918, 1045, 12294, 4897, 12, 474, 460, 13, 288, 202, 698, 288, 202, 202, 3276, 9904, 31, 202, 202, 70, 1085, 1228, 63, 1106, 812, 2335, 9904, 65, 273, 261, 7229, 13, 261, 1132, 1...
super("EOOrQualifier");
super("EOOrQualifier");
public EOOrQualifier() { super("EOOrQualifier"); }
50596 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50596/d39ae6aad0341c8bf84f634fb6d078b5ba63e8f8/EOOrQualifier.java/clean/wolips/plugins/org.objectstyle.wolips.eomodeler/java/org/objectstyle/wolips/eomodeler/model/EOOrQualifier.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 512, 51, 1162, 16185, 1435, 288, 565, 2240, 2932, 41, 51, 1162, 16185, 8863, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 512, 51, 1162, 16185, 1435, 288, 565, 2240, 2932, 41, 51, 1162, 16185, 8863, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -...
c.setLayoutData(new GridData(GridData.FILL_VERTICAL)); c.setLayout(new GridLayout(1, true));
c.setLayoutData(new GridData(GridData.FILL_BOTH)); { GridLayout gridLayout = new GridLayout(1, true); gridLayout.marginHeight = 0; gridLayout.marginWidth = 0; c.setLayout(gridLayout); }
public Control createControl(Composite parent) { Composite mainComposite = new Composite(parent, SWT.NONE); mainComposite.setLayout(new GridLayout(2, false)); Composite c = new Composite(mainComposite, SWT.NONE); c.setLayoutData(new GridData(GridData.FILL_VERTICAL)); c.setLayout(new GridLayout(1, true)); Label label = new Label(c, SWT.NONE); label.setText(ActivityMessages.getString("ActivityEnabler.activities")); //$NON-NLS-1$ label.setLayoutData(new GridData(GridData.FILL_HORIZONTAL)); label.setFont(parent.getFont()); dualViewer = new CheckboxTreeViewer(c); dualViewer.setSorter(new ViewerSorter()); dualViewer.setAutoExpandLevel(AbstractTreeViewer.ALL_LEVELS); dualViewer.setLabelProvider(new ActivityCategoryLabelProvider()); dualViewer.setContentProvider(provider); dualViewer.setInput(activitySupport.getActivityManager()); dualViewer.getControl().setLayoutData(new GridData(GridData.FILL_BOTH)); dualViewer.getControl().setFont(parent.getFont()); c = new Composite(mainComposite, SWT.NONE); c.setLayoutData(new GridData(GridData.FILL_BOTH)); c.setLayout(new GridLayout(1, true)); label = new Label(c, SWT.NONE); label.setText(ActivityMessages.getString("ActivityEnabler.description")); //$NON-NLS-1$ label.setLayoutData(new GridData(GridData.FILL_HORIZONTAL)); label.setFont(parent.getFont()); descriptionText = new Text(c, SWT.READ_ONLY | SWT.WRAP | SWT.BORDER); descriptionText.setFont(parent.getFont()); descriptionText.setLayoutData(new GridData(GridData.FILL_BOTH | GridData.VERTICAL_ALIGN_BEGINNING)); setInitialStates(); dualViewer.addCheckStateListener(checkListener); dualViewer.addSelectionChangedListener(selectionListener); dualViewer.setSelection(new StructuredSelection()); return mainComposite; }
57470 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57470/49e1dd14e375070471e6aef5b27812fe3d9487af/ActivityEnabler.java/buggy/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/activities/ws/ActivityEnabler.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 8888, 752, 3367, 12, 9400, 982, 13, 288, 202, 202, 9400, 2774, 9400, 273, 394, 14728, 12, 2938, 16, 348, 8588, 18, 9826, 1769, 202, 202, 5254, 9400, 18, 542, 3744, 12, 2704, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 8888, 752, 3367, 12, 9400, 982, 13, 288, 202, 202, 9400, 2774, 9400, 273, 394, 14728, 12, 2938, 16, 348, 8588, 18, 9826, 1769, 202, 202, 5254, 9400, 18, 542, 3744, 12, 2704, ...
if (scheduler.isDecorationReady(element)
if (scheduler.isDecorationReady(element, context)
public boolean prepareDecoration(Object element, String originalText) { // Check if there is a decoration ready or if there is no lightweight decorators to be applied if (scheduler.isDecorationReady(element) || !getLightweightManager().hasEnabledDefinitions()) { return true; } // Force an update if there is a text already boolean force = true; //If not then do not force as the undecorated value is fine if(originalText == null || originalText.length() == 0) force = false; // Queue the decoration. scheduler.queueForDecoration(element, getResourceAdapter(element), force, originalText); //If all that is there is deferred ones then defer decoration. //For the sake of effeciency we do not test for enablement at this //point and just abandon deferment if there are any to run right //away return getFullDefinitions().length > 0; }
56152 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56152/9f91fdc102dc0bda0f133ae3012af277ee55d3ef/DecoratorManager.java/buggy/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/decorators/DecoratorManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1250, 2911, 7859, 367, 12, 921, 930, 16, 514, 2282, 1528, 13, 288, 3639, 368, 2073, 309, 1915, 353, 279, 29217, 5695, 578, 309, 1915, 353, 1158, 9052, 4865, 19423, 358, 506, 6754, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1250, 2911, 7859, 367, 12, 921, 930, 16, 514, 2282, 1528, 13, 288, 3639, 368, 2073, 309, 1915, 353, 279, 29217, 5695, 578, 309, 1915, 353, 1158, 9052, 4865, 19423, 358, 506, 6754, ...
assert c._value == null;
assert c._ref == null;
Cur weakCur ( Object o ) { assert o != null && !(o instanceof Ref); Cur c = getCur(); assert c._tempFrame == -1; assert c._value == null; c._value = new Ref( c, o ); return c; }
3520 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3520/9177395cdfc2b61a4e490116d9c3d4103a2b7323/Locale.java/clean/v2/src/newstore2/org/apache/xmlbeans/impl/newstore2/Locale.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 7251, 16046, 2408, 261, 1033, 320, 262, 565, 288, 3639, 1815, 320, 480, 446, 597, 401, 12, 83, 1276, 3941, 1769, 7734, 7251, 276, 273, 14135, 5621, 3639, 1815, 276, 6315, 5814, 3219, 422,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 7251, 16046, 2408, 261, 1033, 320, 262, 565, 288, 3639, 1815, 320, 480, 446, 597, 401, 12, 83, 1276, 3941, 1769, 7734, 7251, 276, 273, 14135, 5621, 3639, 1815, 276, 6315, 5814, 3219, 422,...
rl.add(MPackageImpl.class); rl.add(MClassifierImpl.class);
rl.add(Model.getMetaTypes().getPackage()); rl.add(Model.getMetaTypes().getClassifier());
protected List getValidNamespaceClasses() { List rl = new ArrayList(); rl.add(MPackageImpl.class); rl.add(MClassifierImpl.class); return rl; }
7166 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7166/eb54e179504c3224b12324085944bd3488191d0b/TestActionUseCaseDiagram.java/buggy/tests/org/argouml/uml/ui/TestActionUseCaseDiagram.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 987, 22574, 3402, 4818, 1435, 288, 3639, 987, 11618, 273, 394, 2407, 5621, 3639, 11618, 18, 1289, 12, 49, 2261, 2828, 18, 1106, 1769, 3639, 11618, 18, 1289, 12, 49, 13860, 2828, 18,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 987, 22574, 3402, 4818, 1435, 288, 3639, 987, 11618, 273, 394, 2407, 5621, 3639, 11618, 18, 1289, 12, 49, 2261, 2828, 18, 1106, 1769, 3639, 11618, 18, 1289, 12, 49, 13860, 2828, 18,...
selection = new TreePath[] { path };
selection = new TreePath[] { path };
public void setSelectionPath(TreePath path) { selection = new TreePath[] { path }; }
50763 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50763/354ad8e724c65b6b6984f632455ce4b17f1fb1d0/DefaultTreeSelectionModel.java/clean/core/src/classpath/javax/javax/swing/tree/DefaultTreeSelectionModel.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 444, 6233, 743, 12, 2471, 743, 589, 13, 225, 288, 202, 202, 10705, 273, 394, 4902, 743, 8526, 288, 1082, 202, 803, 289, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 444, 6233, 743, 12, 2471, 743, 589, 13, 225, 288, 202, 202, 10705, 273, 394, 4902, 743, 8526, 288, 1082, 202, 803, 289, 31, 225, 289, 2, -100, -100, -100, -100, -100, -100, ...
pst = new ParserSymbolTable( language );
pst = new ParserSymbolTable( language, mode );
public CompleteParseASTFactory( ParserLanguage language ) { super(); pst = new ParserSymbolTable( language ); }
54911 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54911/57d668240ad64ebccdcae6a8af0025301b0110be/CompleteParseASTFactory.java/clean/core/org.eclipse.cdt.core/parser/org/eclipse/cdt/internal/core/parser/ast/complete/CompleteParseASTFactory.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 14575, 3201, 9053, 1733, 12, 6783, 3779, 2653, 262, 565, 288, 3639, 2240, 5621, 540, 202, 202, 84, 334, 273, 394, 6783, 5335, 1388, 12, 2653, 16, 1965, 11272, 565, 289, 2, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 14575, 3201, 9053, 1733, 12, 6783, 3779, 2653, 262, 565, 288, 3639, 2240, 5621, 540, 202, 202, 84, 334, 273, 394, 6783, 5335, 1388, 12, 2653, 16, 1965, 11272, 565, 289, 2, -100, -...
private void addAppearance(char item, HashMap colors, String textureFile, String clone){ if (clone != null){ this.appearances.put(item, this.appearances.get(clone.toCharArray()[0])); return; } Appearance appearance = new Appearance(); if (colors != null){ Material mat = new Material(); Iterator it = colors.keySet().iterator(); while (it.hasNext()) { String colorType = (String)it.next(); String colorName = (String)colors.get(colorType); if (colorType.equals("ambient")) //$NON-NLS-1$ mat.setAmbientColor(new Color3f(Color.decode(colorName))); if (colorType.equals("diffuse")) //$NON-NLS-1$ mat.setDiffuseColor(new Color3f(Color.decode(colorName))); if (colorType.equals("specular")) //$NON-NLS-1$ mat.setSpecularColor(new Color3f(Color.decode(colorName))); if (colorType.equals("emmissive")) //$NON-NLS-1$ mat.setEmissiveColor(new Color3f(Color.decode(colorName))); } appearance.setMaterial(mat); } if (textureFile != null){ TexCoordGeneration tcg = new TexCoordGeneration( TexCoordGeneration.OBJECT_LINEAR, TexCoordGeneration.TEXTURE_COORDINATE_3, new Vector4f(1.0f, 1.0f, 0.0f, 0.0f), new Vector4f(0.0f, 1.0f, 1.0f, 0.0f), new Vector4f(1.0f, 0.0f, 1.0f, 0.0f)); appearance.setTexCoordGeneration(tcg); try { TextureLoader loader = new TextureLoader(ClassLoader.getSystemResource(textureFile), null); Texture2D texture = (Texture2D) loader.getTexture(); texture.setBoundaryModeS(Texture.WRAP); texture.setBoundaryModeT(Texture.WRAP); // Mache die textur lesbar texture.setCapability(Texture.ALLOW_IMAGE_READ); ImageComponent[] imgs = texture.getImages(); for (int i=0; i< imgs.length; i++) imgs[i].setCapability(ImageComponent.ALLOW_IMAGE_READ); appearance.setTexture(texture); appearance.setCapability(Appearance.ALLOW_TEXTURE_READ); } catch (Exception ex) { ErrorHandler.error("Probleme beim Laden der Textur: "+textureFile+" :"+ex); //$NON-NLS-1$//$NON-NLS-2$ } } this.appearances.put(item,appearance); }
49082 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49082/f67f2ce500c0650f1156cddabad1912a044f5e91/ParcoursLoader.java/clean/ctSim/model/ParcoursLoader.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 527, 1294, 27668, 12, 3001, 761, 16, 4317, 5740, 16, 514, 11428, 812, 16, 514, 3236, 15329, 202, 202, 430, 261, 14056, 480, 446, 15329, 1082, 202, 2211, 18, 438, 17964, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 527, 1294, 27668, 12, 3001, 761, 16, 4317, 5740, 16, 514, 11428, 812, 16, 514, 3236, 15329, 202, 202, 430, 261, 14056, 480, 446, 15329, 1082, 202, 2211, 18, 438, 17964, ...
try { context.dictionaries.pop();
Object data[]; data = context.popOperands(1); if (! (data[0] instanceof HashMap)) { throw new PainterException("begin: wrong arguments");
public void execute(PAContext context) throws PainterException { try { context.dictionaries.pop(); } catch (EmptyStackException e) { throw new PainterException("Dictionary stack is empty"); } }
3506 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3506/e841a8d80b54d639e4e53a6a4fbdd96bb4c9ec7e/PAContext.java/clean/itext/src/com/lowagie/text/pdf/codec/postscript/PAContext.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4202, 1071, 918, 1836, 12, 4066, 1042, 819, 13, 1216, 453, 11606, 503, 288, 3639, 775, 288, 1850, 819, 18, 72, 14336, 18, 5120, 5621, 3639, 289, 3639, 1044, 261, 1921, 2624, 503, 425, 13, 28...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4202, 1071, 918, 1836, 12, 4066, 1042, 819, 13, 1216, 453, 11606, 503, 288, 3639, 775, 288, 1850, 819, 18, 72, 14336, 18, 5120, 5621, 3639, 289, 3639, 1044, 261, 1921, 2624, 503, 425, 13, 28...
proto.re = (RECompiled)compileRE(cx, scope, "", null, false);
proto.re = (RECompiled)compileRE("", null, false);
public static void init(Context cx, Scriptable scope, boolean sealed) { NativeRegExp proto = new NativeRegExp(); proto.re = (RECompiled)compileRE(cx, scope, "", null, false); proto.prototypeFlag = true; proto.setMaxId(MAX_PROTOTYPE_ID); proto.setParentScope(scope); proto.setPrototype(getObjectPrototype(scope)); NativeRegExpCtor ctor = new NativeRegExpCtor(); ScriptRuntime.setFunctionProtoAndParent(scope, ctor); ctor.setImmunePrototypeProperty(proto); if (sealed) { proto.sealObject(); ctor.sealObject(); } defineProperty(scope, "RegExp", ctor, ScriptableObject.DONTENUM); }
12904 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12904/10f7bc1e8d7b13b30c167a7687ada1d9a0c79b5e/NativeRegExp.java/buggy/js/rhino/src/org/mozilla/javascript/regexp/NativeRegExp.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 1208, 12, 1042, 9494, 16, 22780, 2146, 16, 1250, 695, 18931, 13, 565, 288, 3639, 16717, 13673, 3760, 273, 394, 16717, 13673, 5621, 3639, 3760, 18, 266, 273, 261, 862, 2073...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 1208, 12, 1042, 9494, 16, 22780, 2146, 16, 1250, 695, 18931, 13, 565, 288, 3639, 16717, 13673, 3760, 273, 394, 16717, 13673, 5621, 3639, 3760, 18, 266, 273, 261, 862, 2073...
System.out.println();
System.out.println();
public static void main(String[] args) { /* * Default values: */ String url = "svn://localhost/rep/MyRepos";//"http://72.9.228.230:8080/svn/jsvn/branches/0.9.0/doc"; String copyURL = "svn://localhost/rep/MyReposCopy"; String myWorkspacePath = "/MyWorkingCopy"; SVNRevision revision = SVNRevision.HEAD;//HEAD (the latest) revision String name = "userName"; String password = "userPassword"; String newDir = "/newDir"; String newFile = newDir + "/" + "newFile.txt"; byte[] fileText = "This is a new file added to the working copy" .getBytes(); /* * Initializes the library (it must be done before ever using the * library itself) */ setupLibrary(); if (args != null) { /* * Obtains a repository location URL */ url = (args.length >= 1) ? args[0] : url; /* * Obtains a URL where a copy of the previuos url will be created */ copyURL = (args.length >= 2) ? args[1] : copyURL; /* * Obtains a path for a workspace */ myWorkspacePath = (args.length >= 3) ? args[2] : myWorkspacePath; /* * Obtains a revision */ revision = (args.length >= 4) ? SVNRevision.create(Long .parseLong(args[3])) : revision; /* * Obtains an account name (will be used to authenticate the user to * the server) */ name = (args.length >= 5) ? args[4] : name; /* * Obtains a password */ password = (args.length >= 6) ? args[5] : password; } File wcDir = new File(myWorkspacePath); if (wcDir.exists()) { System.err.println("the destination directory '" + wcDir.getAbsolutePath() + "' already exists!"); System.exit(1); } wcDir.mkdirs(); /* * Creates a usre's credentials provider. */ ISVNCredentialsProvider scp = new SVNSimpleCredentialsProvider(name, password); long checkoutRevision = -1; try { checkoutRevision = checkout(scp, url, revision, wcDir, true); } catch (SVNException svne) { /* * Perhaps a malformed URL is the cause of this exception. */ System.err .println("error while checking out a working copy for the location '" + url + "': " + svne.getMessage()); System.exit(1); } System.out.println("Checked out revision " + checkoutRevision); /* * show info for the working copy */ try { showInfo(scp, wcDir, SVNRevision.WORKING, true); } catch (SVNException svne) { System.err .println("error while getting info for the working copy at'" + wcDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } /* * creating a new directory */ File aNewDir = new File(wcDir, newDir); if (!aNewDir.mkdirs()) { System.err.println("failed to create a new directory '" + aNewDir.getAbsolutePath() + "'."); System.exit(1); } /* * creating a new file in "/MyWorkspace/newDir/" */ File aNewFile = new File(aNewDir, PathUtil.tail(newFile)); try { if (!aNewFile.createNewFile()) { System.err.println("failed to create a new file '" + aNewFile.getAbsolutePath() + "'."); System.exit(1); } } catch (IOException ioe) { aNewFile.delete(); System.err.println("error while creating a new file '" + aNewFile.getAbsolutePath() + "': " + ioe.getMessage()); System.exit(1); } FileOutputStream fos = null; try { fos = new FileOutputStream(aNewFile); fos.write(fileText); } catch (FileNotFoundException fnfe) { System.err.println("the file '" + aNewFile.getAbsolutePath() + "' is not found: " + fnfe.getMessage()); System.exit(1); } catch (IOException ioe) { System.err.println("error while writing into the file '" + aNewFile.getAbsolutePath() + "' is not found: " + ioe.getMessage()); System.exit(1); } finally { if (fos != null) { try { fos.close(); } catch (IOException ioe) { // } } } try { addDirectory(scp, aNewDir); } catch (SVNException svne) { System.err.println("error while recursively adding the directory '" + aNewDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } boolean isRecursive = true; boolean isRemote = false; boolean isReportAll = false; boolean isIncludeIgnored = true; boolean isCollectParentExternals = true; System.out.println(); System.out.println("Status for '" + wcDir.getAbsolutePath() + "':"); try { showStatus(scp, wcDir, isRecursive, isRemote, isReportAll, isIncludeIgnored, isCollectParentExternals); } catch (SVNException svne) { System.err.println("error while performing status for '" + wcDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } long updatedRevision = -1; try { updatedRevision = update(scp, wcDir, SVNRevision.HEAD, true); } catch (SVNException svne) { System.err .println("error while recursively updating the working copy '" + wcDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } System.out.println(); System.out.println("Updating '" + wcDir.getAbsolutePath() + "'..."); try { showStatus(scp, wcDir, isRecursive, isRemote, isReportAll, isIncludeIgnored, isCollectParentExternals); } catch (SVNException svne) { System.err.println("error while performing status for '" + wcDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } System.out.println("Updated to revision " + updatedRevision); System.out.println(); System.out.println("Committing '" + wcDir.getAbsolutePath() + "'..."); long committedRevision = -1; try { committedRevision = commit(scp, wcDir, true, "'/newDir' with '/newDir/newFile.txt' were added") .getNewRevision(); } catch (SVNException svne) { System.err .println("error while committing changes to the working copy '" + wcDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } System.out.println("Committed to revision " + committedRevision); try { lock(scp, aNewFile, true, "locking '/newDir'"); } catch (SVNException svne) { System.err.println("error while locking the working copy file '" + aNewFile.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } System.out.println(); System.out .println("Locking (with stealing if the entry is already locked) '" + aNewDir.getAbsolutePath() + "'."); System.out.println(); System.out.println("Status for '" + wcDir.getAbsolutePath() + "':"); try { showStatus(scp, wcDir, isRecursive, isRemote, isReportAll, isIncludeIgnored, isCollectParentExternals); } catch (SVNException svne) { System.err.println("error while performing status for '" + wcDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } System.out.println(); System.out.println("Making a new directory at '" + copyURL + "'..."); try{ committedRevision = makeDirectory(scp, copyURL, "making a new directory at '" + copyURL + "'").getNewRevision(); }catch(SVNException svne){ System.err.println("error while making a new directory at '" + copyURL + "': " + svne.getMessage()); System.exit(1); } System.out.println("Committed to revision " + committedRevision); System.out.println(); System.out.println("Copying '" + url + "' to '" + copyURL + "'..."); try { committedRevision = copy(scp, url, SVNRevision.create(checkoutRevision), copyURL, false, "remotely copying '" + url + "' to '" + copyURL + "'") .getNewRevision(); } catch (SVNException svne) { System.err.println("error while copying '" + url + "' to '" + copyURL + "': " + svne.getMessage()); System.exit(1); } System.out.println("Committed to revision " + committedRevision); System.out.println(); System.out.println("Switching '" + wcDir.getAbsolutePath() + "' to '" + copyURL + "'..."); try { updatedRevision = switchToURL(scp, wcDir, copyURL, SVNRevision.HEAD, true); } catch (SVNException svne) { System.err.println("error while switching '" + wcDir.getAbsolutePath() + "' to '" + copyURL + "': " + svne.getMessage()); System.exit(1); } System.out.println("Updated to revision " + updatedRevision); /* * show info for the working copy */ System.out.println(); try { showInfo(scp, wcDir, SVNRevision.WORKING, false); } catch (SVNException svne) { System.err .println("error while getting info for the working copy at'" + wcDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } System.out.println(); System.out.println("Scheduling '" + wcDir.getAbsolutePath() + "' for deletion ..."); try { delete(scp, aNewDir, true); } catch (SVNException svne) { System.err.println("error while schediling '" + wcDir.getAbsolutePath() + "' for deletion: " + svne.getMessage()); System.exit(1); } System.out.println(); System.out.println("Status for '" + wcDir.getAbsolutePath() + "':"); try { showStatus(scp, wcDir, isRecursive, isRemote, isReportAll, isIncludeIgnored, isCollectParentExternals); } catch (SVNException svne) { System.err.println("error while performing status for '" + wcDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } System.out.println(); System.out.println("Committing '" + wcDir.getAbsolutePath() + "'..."); try { committedRevision = commit( scp, wcDir, false, "deleting '" + aNewDir.getAbsolutePath() + "' from the filesystem as well as from the repository").getNewRevision(); } catch (SVNException svne) { System.err .println("error while committing changes to the working copy '" + wcDir.getAbsolutePath() + "': " + svne.getMessage()); System.exit(1); } System.out.println("Committed to revision " + committedRevision); System.exit(0); }
2776 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2776/eb358d3f5d632fabeacf4c138b00a57f0eb30c7d/WorkingCopy.java/clean/doc/examples/src/org/tmatesoft/svn/examples/wc/WorkingCopy.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 2774, 12, 780, 8526, 833, 13, 288, 3639, 1748, 540, 380, 2989, 924, 30, 540, 1195, 3639, 514, 880, 273, 315, 31505, 2207, 13014, 19, 14462, 19, 12062, 28453, 14432, 759, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 2774, 12, 780, 8526, 833, 13, 288, 3639, 1748, 540, 380, 2989, 924, 30, 540, 1195, 3639, 514, 880, 273, 315, 31505, 2207, 13014, 19, 14462, 19, 12062, 28453, 14432, 759, ...
logger.debug( " meal params is " + params.get(2) + " resource is " + identifier); if (((HashMap) params.get(2)).containsKey(identifier)) { resource_count += ((Double) ((HashMap) params.get(2)).get(identifier)).doubleValue(); logger.debug(identifier+" rate is "+resource_count); } else { logger.debug("No meal rates for "+identifier); } }
if (logger.isDebugEnabled()) { logger.debug(" meal params is " + params.get(2) + " resource is " + identifier); } if (((HashMap) params.get(2)).containsKey(identifier)) { resource_count += ((Double) ((HashMap) params.get(2)).get(identifier)).doubleValue(); if (logger.isDebugEnabled()) { logger.debug(identifier + " rate is " + resource_count); } } else { if (logger.isDebugEnabled()) { logger.debug("No meal rates for " + identifier); } } }
public Rate getRate(Asset asset, List params) { double quantity = 0; // people // CDW if (params.size() < 1) { return null; } // if Object obj = params.get(0); if (obj instanceof Double) { quantity = ((Double) obj).doubleValue(); } else { if (obj != null) { logger.debug ( "Bad param - expected quantity got " + obj); } // if return null; } // if OrgActivity act = null; obj = params.get(1); if (obj instanceof OrgActivity) { act = (OrgActivity) obj; } else { if (obj != null) { logger.debug ( "Bad param - expected OrgActivity got " + obj); } // if return null; } // if KeyRuleParameterEntry[] keys = getActionPolicy(act.getActivityType(), act.getOpTempo()); if ((keys != null) && (keys.length == 0)) { return null; } // if Rate result = null; String identifier = parentPlugin.getAssetUtils().getAssetIdentifier (asset); PackagePG ppg = (PackagePG) asset.searchForPropertyGroup(PackagePG.class); if (ppg == null) { logger.error("No PackagePG on "+identifier); } //String type = null; double resource_count = 0; if (keys != null) { for (int j = 0; j < keys.length; j++) { if ((keys[j].getKey().equalsIgnoreCase("Breakfast") && (keys[j].getValue().equals(identifier))) || (keys[j].getKey().equalsIgnoreCase("Lunch") && (keys[j].getValue().equals(identifier))) || (keys[j].getKey().equalsIgnoreCase("Dinner") && (keys[j].getValue().equals(identifier)))) { resource_count += 1.0; } } } else { // keys from getActionPolicy was null // Optempo does not over rule if (params.size() < 3) { logger.error("Class I ose array in getRate() is missing element "+2+" (meal)"); } else { if (params.get(2) != null) { logger.debug( " meal params is " + params.get(2) + " resource is " + identifier); if (((HashMap) params.get(2)).containsKey(identifier)) { // Meals resource_count += ((Double) ((HashMap) params.get(2)).get(identifier)).doubleValue(); logger.debug(identifier+" rate is "+resource_count); } // if // DEBUG else { logger.debug("No meal rates for "+identifier); } } // if non null params(2) // Enhancements policy if (params.size() >= 4 && params.get(3) != null) { if (((HashMap) params.get(3)).containsKey(identifier)) { // Meals resource_count += ((Double) ((HashMap) params.get(3)).get(identifier)).doubleValue(); logger.debug ( " enhance params is " + ((Double) ((HashMap) params.get(3)).get (identifier)).doubleValue()); } } } // if have at least thru params(3) } // end of case for null keys // Water if (params.size() < 5) { logger.error("Class I ose array in getRate() is missing element "+5+" water"); } else { if (params.get(4) != null) { if (((HashMap) params.get(4)).containsKey(identifier)) { // water public static HashMap cachedDBValues = new HashMap(); resource_count += ((Double) ((HashMap) params.get (4)).get(identifier)).doubleValue(); logger.debug ( " water params is " + ((Double) ((HashMap) params.get(4)).get (identifier)).doubleValue()); } // if } // if } // if if (resource_count > 0) { double total = Math.ceil (resource_count * (1.0 / ppg.getCountPerPack()) * quantity); result = CountRate.newEachesPerDay(total); RationPG rpg = (RationPG) asset.searchForPropertyGroup(RationPG.class); logger.debug ("\n THE rate is " + CountRate.newEachesPerDay (total) + " for asset " + identifier + " the ration type is " + rpg.getRationType()); logger.debug ( " Unit of Issue is " + ppg.getUnitOfIssue() + " count per pack" + ppg.getCountPerPack()); } // if return result; } // getRate
11319 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11319/dd61b8b1c82c66517008f8fbebf783e733dfcc7b/SubsistenceConsumerBG.java/buggy/bbn/src/org/cougaar/logistics/ldm/asset/SubsistenceConsumerBG.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 13025, 4170, 340, 12, 6672, 3310, 16, 987, 859, 13, 288, 565, 1645, 10457, 273, 374, 31, 368, 16951, 565, 368, 21508, 59, 565, 309, 261, 2010, 18, 1467, 1435, 411, 404, 13, 288, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 13025, 4170, 340, 12, 6672, 3310, 16, 987, 859, 13, 288, 565, 1645, 10457, 273, 374, 31, 368, 16951, 565, 368, 21508, 59, 565, 309, 261, 2010, 18, 1467, 1435, 411, 404, 13, 288, ...
Member member = methodsOrCtors[i]; Class[] type = methodOrCtorTypes[i]; String sig = NativeJavaMethod.memberSignature(member, type); if (name.equals(sig)) { return member;
Class[] type = methodsOrCtors[i].argTypes; String sig = liveConnectSignature(type); if (sigStart + sig.length() == name.length() && name.regionMatches(sigStart, sig, 0, sig.length())) { return methodsOrCtors[i];
private Member findExplicitFunction(String name, boolean isStatic) { int sigStart = name.indexOf('('); if (sigStart < 0) { return null; } Hashtable ht = isStatic ? staticMembers : members; Member[] methodsOrCtors = null; Class[][] methodOrCtorTypes = null; boolean isCtor = (isStatic && sigStart == 0); if (isCtor) { // Explicit request for an overloaded constructor methodsOrCtors = ctors; methodOrCtorTypes = ctorTypes; } else { // Explicit request for an overloaded method String trueName = name.substring(0,sigStart); Object obj = ht.get(trueName); if (!isStatic && obj == null) { // Try to get static member from instance (LC3) obj = staticMembers.get(trueName); } if (obj instanceof NativeJavaMethod) { NativeJavaMethod njm = (NativeJavaMethod)obj; methodsOrCtors = njm.methods; methodOrCtorTypes = njm.methodTypes; } } if (methodsOrCtors != null) { for (int i = 0; i < methodsOrCtors.length; i++) { Member member = methodsOrCtors[i]; Class[] type = methodOrCtorTypes[i]; String sig = NativeJavaMethod.memberSignature(member, type); if (name.equals(sig)) { return member; } } } return null; }
47345 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47345/1b620bbe9ad9c387f8202d7df9e1281bbd4ef637/JavaMembers.java/clean/src/org/mozilla/javascript/JavaMembers.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 8596, 1104, 17186, 2083, 12, 780, 508, 16, 1250, 16116, 13, 565, 288, 3639, 509, 3553, 1685, 273, 508, 18, 31806, 2668, 2668, 1769, 3639, 309, 261, 7340, 1685, 411, 374, 13, 288, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 8596, 1104, 17186, 2083, 12, 780, 508, 16, 1250, 16116, 13, 565, 288, 3639, 509, 3553, 1685, 273, 508, 18, 31806, 2668, 2668, 1769, 3639, 309, 261, 7340, 1685, 411, 374, 13, 288, ...
SecurityManager s = System.getSecurityManager(); String p = safeCanonicalPath (); if (p == null) return false; if (s != null) s.checkWrite(p); return access (p, WRITE);
checkWrite(); return access (WRITE);
public boolean canWrite () { SecurityManager s = System.getSecurityManager(); String p = safeCanonicalPath (); // FIXME: it isn't entirely clear what to do if we can't find the // canonical path. if (p == null) return false; if (s != null) s.checkWrite(p); return access (p, WRITE); }
56365 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56365/13487a5ef4e62b2ad9a1836e7826c648d61b26b3/File.java/clean/libjava/java/io/File.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 1250, 848, 3067, 1832, 225, 288, 565, 6036, 1318, 272, 273, 2332, 18, 588, 4368, 1318, 5621, 565, 514, 293, 273, 4183, 15512, 743, 261, 1769, 565, 368, 9852, 30, 518, 5177, 1404, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 1250, 848, 3067, 1832, 225, 288, 565, 6036, 1318, 272, 273, 2332, 18, 588, 4368, 1318, 5621, 565, 514, 293, 273, 4183, 15512, 743, 261, 1769, 565, 368, 9852, 30, 518, 5177, 1404, ...
catch (org.apache.xerces.util.URI.MalformedURIException e){
catch (org.apache.xerces.util.URI.MalformedURIException e) { NodeImpl parentOrOwner = (parentNode() != null) ? parentNode() : ownerNode; String parentBaseURI = (parentOrOwner != null) ? parentOrOwner.getBaseURI() : null; if (parentBaseURI != null) { try { uri = new URI(new URI(parentBaseURI), uri).toString(); } catch (org.apache.xerces.util.URI.MalformedURIException ex){ return null; } return uri; }
public String getBaseURI() { if (needsSyncData()) { synchronizeData(); } //Absolute base URI is computed according to XML Base (http://www.w3.org/TR/xmlbase/#granularity) //1. the base URI specified by an xml:base attribute on the element, if one exists if (attributes != null) { Attr attrNode = (Attr)attributes.getNamedItemNS("http://www.w3.org/XML/1998/namespace", "base"); if (attrNode != null) { String uri = attrNode.getNodeValue(); if (uri.length() != 0 ) {// attribute value is always empty string try { uri = new URI(uri).toString(); } catch (org.apache.xerces.util.URI.MalformedURIException e){ // REVISIT: what should happen in this case? return null; } return uri; } } } //2.the base URI of the element's parent element within the document or external entity, //if one exists String parentElementBaseURI = (this.parentNode() != null) ? this.parentNode().getBaseURI() : null ; //base URI of parent element is not null if(parentElementBaseURI != null){ try { //return valid absolute base URI return new URI(parentElementBaseURI).toString(); } catch (org.apache.xerces.util.URI.MalformedURIException e){ // REVISIT: what should happen in this case? return null; } } //3. the base URI of the document entity or external entity containing the element String baseURI = (this.ownerNode != null) ? this.ownerNode.getBaseURI() : null ; if(baseURI != null){ try { //return valid absolute base URI return new URI(baseURI).toString(); } catch (org.apache.xerces.util.URI.MalformedURIException e){ // REVISIT: what should happen in this case? return null; } } return null; }
46079 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46079/45ec51a61e14e22e6560098070c726fd8fdf1b56/ElementNSImpl.java/clean/src/org/apache/xerces/dom/ElementNSImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 8297, 3098, 1435, 288, 3639, 309, 261, 20600, 4047, 751, 10756, 288, 5411, 16978, 751, 5621, 3639, 289, 3639, 368, 10368, 1026, 3699, 353, 8470, 4888, 358, 3167, 3360, 261, 2505,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 8297, 3098, 1435, 288, 3639, 309, 261, 20600, 4047, 751, 10756, 288, 5411, 16978, 751, 5621, 3639, 289, 3639, 368, 10368, 1026, 3699, 353, 8470, 4888, 358, 3167, 3360, 261, 2505,...
molecule = dbst.fixAromaticBondOrders(molecule);
public void testPyrrole() { String smiles = "c2ccc3n([H])c1ccccc1c3(c2)"; SmilesParser smilesParser = new SmilesParser(); try { IMolecule molecule = smilesParser.parseSmiles(smiles); DeduceBondSystemTool dbst = new DeduceBondSystemTool(); //molecule = dbst.fixAromaticBondOrders(molecule); assertNotNull(molecule); for (int i = 0; i < molecule.getBondCount(); i++) { IBond bond = molecule.getBond(i); assertTrue(bond.getOrder() == CDKConstants.BONDORDER_AROMATIC); } } catch (InvalidSmilesException e) { e.printStackTrace(); } }
45167 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45167/a3e7aa5886c8e2079ec48b5d077972d16b83b13f/DeduceBondSystemToolTest.java/clean/src/org/openscience/cdk/test/smiles/DeduceBondSystemToolTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 13661, 273, 1319, 334, 18, 904, 37, 27468, 9807, 16528, 12, 81, 10545, 1769, 13661, 273, 1319, 334, 18, 904, 37, 27468, 9807, 16528, 12, 81, 10545, 1769, 13661, 273, 1319, 334, 18, 904, 37, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 13661, 273, 1319, 334, 18, 904, 37, 27468, 9807, 16528, 12, 81, 10545, 1769, 13661, 273, 1319, 334, 18, 904, 37, 27468, 9807, 16528, 12, 81, 10545, 1769, 13661, 273, 1319, 334, 18, 904, 37, ...
kickEngagements();
server.nextEngagement();
void doSummon(Legion legion, Legion donor, Creature angel) { Player player = getActivePlayer(); if (angel != null && donor != null && legion.canSummonAngel()) { // Only one angel can be summoned per turn. player.setSummoned(true); // Move the angel or archangel. donor.removeCreature(angel, false, false); legion.addCreature(angel, false); server.allTellRemoveCreature(donor.getMarkerId(), angel.getName(), true); server.allTellAddCreature(legion.getMarkerId(), angel.getName(), true); Log.event("One " + angel.getName() + " is summoned from legion " + donor.getLongMarkerName() + " into legion " + legion.getLongMarkerName()); } // Need to call this regardless to advance past the summon phase. if (battle != null) { battle.finishSummoningAngel(player.hasSummoned()); summoning = false; } else { summoning = false; kickEngagements(); } }
51862 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51862/13fd7e55524ae607efd57c2dd1bbc8ece72c6451/Game.java/clean/Colossus/net/sf/colossus/server/Game.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 741, 3495, 2586, 12, 8329, 285, 4553, 285, 16, 17167, 285, 2727, 280, 16, 5799, 1231, 7603, 292, 13, 565, 288, 3639, 19185, 7291, 273, 11960, 12148, 5621, 3639, 309, 261, 539, 292, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 741, 3495, 2586, 12, 8329, 285, 4553, 285, 16, 17167, 285, 2727, 280, 16, 5799, 1231, 7603, 292, 13, 565, 288, 3639, 19185, 7291, 273, 11960, 12148, 5621, 3639, 309, 261, 539, 292, ...
public synchronized void setAlignments(org.biojava.bio.program.das.dasalignment.Alignment[] aligs){ alignments = aligs; if ( aligs == null){ logger.warning("no alignments given"); notifyAll(); return; } if ( chain == null ){ logger.warning("trying to set alignments before chain has been set"); notifyAll(); return; } logger.info("you can choose between " + aligs.length + " alignments"); String seq_str = chain.getSequence(); Sequence sequence ; try { sequence = ProteinTools.createProteinSequence(seq_str, "prot_1"); } catch (IllegalSymbolException e){ // can not convert sequence! logger.warning(e.getMessage()); notifyAll(); return; } if ( alignments == null) { sequencePanel.setSequence(sequence); //display the whole Sequence sequencePanel.setRange(new RangeLocation(1,sequence.length())); } // template for feature. org.biojava.bio.seq.Feature.Template temp = new org.biojava.bio.seq.Feature.Template(); for ( int i=0 ; i < alignments.length; i++ ){ org.biojava.bio.program.das.dasalignment.Alignment ali = alignments[i]; String PDBcode = AlignmentTools.getPDBCodeFromAlignment(ali); logger.info("alignments for "+ PDBcode); Chain currentChain = null; try { // project the alignment on the sequence... currentChain = struBuild.createChain(ali,seq_str); //System.out.println() } catch ( DASException e){ e.printStackTrace(); continue; } // create features from this chain, List features = getStructureFeatures(currentChain,PDBcode); //logger.log(Level.FINEST, "nr features: " +features.size()); // convert them to display... temp.source = PDBcode; temp.type = "Protein Structure"; FeatureFilter ff = new FeatureFilter.BySource(PDBcode); //logger.log(Level.INFO,"filtering by "+PDBcode); FilteringRenderer filtR = new FilteringRenderer(); // build up label ... String labelstring = PDBcode; Annotation object = AlignmentTools.getObject(PDBcode,ali); List details = new ArrayList(); try { details = (List) object.getProperty("details"); } catch (NoSuchElementException e){ // details are not provided logger.info("alignment does not contain details"); } Iterator iter = details.iterator(); while (iter.hasNext()){ Annotation detail = (Annotation) iter.next(); //logger.info(detail.get("property").toString() + " " + detail.get("detail").toString()); String property = (String) detail.getProperty("property"); String detailstr = (String) detail.getProperty("detail"); if ( property.equals("resolution")){ if ( detailstr != null ) labelstring += " " + detailstr + "" ; } if ( property.equals("experiment_type")){ labelstring += " " + detailstr ; } if ( property.equals("molecule description")){ labelstring += " description: " + detailstr; } } //filtR.setRenderer(bumpR); try { LabelledSequenceRenderer labelsR = new LabelledSequenceRenderer(100,20); labelsR.setFillColor(Color.white); labelsR.addLabelString(labelstring); labelsR.setRenderer(bumpR); //multiLineRenderer.addRenderer(labelsR); //labelsR.addLabelString(PDBcode); filtR.setRenderer(labelsR); filtR.setFilter(ff); //filtR.setRenderer(bumpR); multiLineRenderer.addRenderer(filtR); //StackedFeatureRenderer stackR = new StackedFeatureRenderer(); //stackR.addRenderer(labelR); //stackR.addRenderer(filtR); //multiLineRenderer.addRenderer(stackR); } catch ( Exception e) { logger.warning(e.getMessage()); e.printStackTrace(); continue; } // iterate over all features for (int ai=0; ai< features.size(); ai++) { org.biojava.spice.Feature.Feature feat = (org.biojava.spice.Feature.Feature)features.get(ai); //String source = feat.getSource(); //temp.source=source; //System.out.println(source); // and create Biojav Feature object temp.type=feat.getType(); Annotation anno = new SimpleAnnotation(); try { anno.setProperty("name",feat.getName()); anno.setProperty("description",labelstring); } catch (Exception e){ logger.warning(e.getMessage()); } temp.annotation = anno; List segments = feat.getSegments(); for ( int s =0; s< segments.size();s++){ org.biojava.spice.Feature.Segment segment = (org.biojava.spice.Feature.Segment) segments.get(s); int start = segment.getStart(); int end = segment.getEnd(); Location l = new RangeLocation(start,end); temp.location = l; //org.biojava.bio.seq.Feature f ; try { sequence.createFeature(temp); } catch (Exception e){ logger.warning(e.getMessage()); } } } } // set the Sequence to Render sequencePanel.setSequence(sequence); //display the whole Sequence sequencePanel.setRange(new RangeLocation(1,sequence.length())); //sequencePanel.setSize(sequencePanel.getSize()); //System.out.println("alignments have been set"); notifyAll(); sequencePanel.getParent().repaint(); }
52521 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/52521/4bb4af8362b5c7128a01a600839708bbcc141178/AlignmentChooser.java/clean/src/org/biojava/spice/GUI/alignmentchooser/AlignmentChooser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 1071, 3852, 918, 444, 10044, 1346, 12, 3341, 18, 21010, 6290, 18, 21010, 18, 12890, 18, 28831, 18, 28831, 14409, 18, 11535, 8526, 524, 360, 87, 15329, 225, 28555, 273, 524, 360, 87, 31, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 1071, 3852, 918, 444, 10044, 1346, 12, 3341, 18, 21010, 6290, 18, 21010, 18, 12890, 18, 28831, 18, 28831, 14409, 18, 11535, 8526, 524, 360, 87, 15329, 225, 28555, 273, 524, 360, 87, 31, ...
public static InputStream retrieve(Context context, int id) throws SQLException, IOException { TableRow bitstream = DatabaseManager.find(context, "bitstream", id); // MOD DRL - modified to support SRB GeneralFile file = getFile(bitstream); return (file != null) ? FileFactory.newFileInputStream(file) : null; // MOD end }
47292 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47292/1fa8cb061e30402c53fca9f2a1d975fbe6581803/BitstreamStorageManager.java/clean/dspace/src/org/dspace/storage/bitstore/BitstreamStorageManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 3845, 4348, 17466, 12, 1042, 2472, 16, 474, 350, 13, 15069, 23116, 16, 14106, 95, 30650, 3682, 3256, 33, 4254, 1318, 18, 4720, 12, 2472, 10837, 3682, 3256, 3113, 350, 1769, 759, 6720, 16...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 3845, 4348, 17466, 12, 1042, 2472, 16, 474, 350, 13, 15069, 23116, 16, 14106, 95, 30650, 3682, 3256, 33, 4254, 1318, 18, 4720, 12, 2472, 10837, 3682, 3256, 3113, 350, 1769, 759, 6720, 16...
Thread.currentThread().dumpStack();
Thread.dumpStack();
public JavaClass getJavaClass() { //XXX need to know when to make a new class and when not to //XXX this is an important optimization if (getBytes() == null) { System.out.println("no bytes for: " + getFilename()); Thread.currentThread().dumpStack(); } return Utility.makeJavaClass(filename, getBytes());// if (javaClass == null) javaClass = Utility.makeJavaClass(filename, getBytes());// return javaClass; }
7955 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7955/990faf8f05daeac1a2ce1de47d832905d3eb1c5e/UnwovenClassFile.java/buggy/org.aspectj/modules/weaver/src/org/aspectj/weaver/bcel/UnwovenClassFile.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 29491, 18911, 797, 1435, 288, 202, 202, 759, 15639, 1608, 358, 5055, 1347, 358, 1221, 279, 394, 667, 471, 1347, 486, 358, 202, 202, 759, 15639, 333, 353, 392, 10802, 14850, 202,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 29491, 18911, 797, 1435, 288, 202, 202, 759, 15639, 1608, 358, 5055, 1347, 358, 1221, 279, 394, 667, 471, 1347, 486, 358, 202, 202, 759, 15639, 333, 353, 392, 10802, 14850, 202,...
try { addResourcesAndChildren(result, cont.members()); } catch (CoreException e) { } }
try { addResourcesAndChildren(result, cont.members()); } catch (CoreException e) { } }
private void addResourcesAndChildren(HashSet result, IResource[] resources) { for (int idx = 0; idx < resources.length; idx++) { IResource currentResource = resources[idx]; result.add(currentResource.getFullPath().toString()); if (currentResource instanceof IContainer) { IContainer cont = (IContainer) currentResource; try { addResourcesAndChildren(result, cont.members()); } catch (CoreException e) { // Ignore errors } } } }
56152 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56152/1ceb585b9b16047c6c580984b0c9962c41a22ba6/MarkerFilter.java/buggy/bundles/org.eclipse.ui.ide/src/org/eclipse/ui/views/markers/internal/MarkerFilter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 527, 3805, 1876, 4212, 12, 13482, 563, 16, 467, 1420, 8526, 2703, 13, 288, 3639, 364, 261, 474, 2067, 273, 374, 31, 2067, 411, 2703, 18, 2469, 31, 2067, 27245, 288, 5411, 467...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 527, 3805, 1876, 4212, 12, 13482, 563, 16, 467, 1420, 8526, 2703, 13, 288, 3639, 364, 261, 474, 2067, 273, 374, 31, 2067, 411, 2703, 18, 2469, 31, 2067, 27245, 288, 5411, 467...
for (IDMContext parent : fParents) {
for (IDMContext<?> parent : fParents) {
protected String baseToString() { StringBuffer retVal = new StringBuffer(); for (IDMContext parent : fParents) { retVal.append(parent); } return retVal.toString(); }
54911 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54911/94841c4ee3efc4a608afcf5de2265b440c3cf516/AbstractDMContext.java/buggy/plugins/org.eclipse.dd.dsf/src/org/eclipse/dd/dsf/datamodel/AbstractDMContext.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 514, 1026, 5808, 1435, 288, 3639, 6674, 12197, 273, 394, 6674, 5621, 540, 364, 261, 734, 49, 1042, 12880, 34, 982, 294, 284, 13733, 13, 288, 5411, 12197, 18, 6923, 12, 2938, 1769, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 514, 1026, 5808, 1435, 288, 3639, 6674, 12197, 273, 394, 6674, 5621, 540, 364, 261, 734, 49, 1042, 12880, 34, 982, 294, 284, 13733, 13, 288, 5411, 12197, 18, 6923, 12, 2938, 1769, ...
copyNonNullPermissions( newDetails, source.getPermissions() ); applyUmaskIfNecessary( newDetails ); if (source.getOwner() != null && ! source.getOwner().getId().equals( newDetails.getOwner().getId() )) { if ( currentUserIsAdmin() ) { newDetails.setOwner( source.getOwner() ); } else { throw new SecurityViolation(String.format( "You are not authorized to set the ExperimenterID" + " for %s to %d", obj, source.getOwner().getId() )); } }
if (hasPrivilegedToken(obj)) return obj.getDetails();
public Details transientDetails( IObject obj ) { checkReady("transientDetails"); if ( hasPrivilegedToken( obj ) ) return obj.getDetails(); // EARLY EXIT Details source = obj.getDetails(); Details newDetails = CurrentDetails.createDetails(); if ( source != null ) { copyNonNullPermissions( newDetails, source.getPermissions() ); applyUmaskIfNecessary( newDetails ); // users *aren't* allowed to set the owner of an item. if (source.getOwner() != null && ! source.getOwner().getId().equals( newDetails.getOwner().getId() )) { // but this is root if ( currentUserIsAdmin() ) { newDetails.setOwner( source.getOwner() ); } else { throw new SecurityViolation(String.format( "You are not authorized to set the ExperimenterID" + " for %s to %d", obj, source.getOwner().getId() )); } } // users are only allowed to set to another of their groups if (source.getGroup() != null && source.getGroup().getId() != null) { // users can change to their own group if (memberOfGroups().contains( source.getGroup().getId())) { newDetails.setGroup( source.getGroup() ); } // and admin can change it too else if ( currentUserIsAdmin() ) { newDetails.setGroup( source.getGroup() ); } // oops. boom! else { throw new SecurityViolation(String.format( "You are not authorized to set the ExperimenterGroupID"+ " for %s to %d", obj, source.getGroup().getId() )); } } } return newDetails; }
54698 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54698/9c53370b3f7a88f29e38673527398c205d19f7d6/BasicSecuritySystem.java/buggy/components/server/src/ome/security/BasicSecuritySystem.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 21897, 12315, 3790, 12, 467, 921, 1081, 262, 565, 288, 377, 202, 377, 202, 1893, 8367, 2932, 22670, 3790, 8863, 377, 202, 377, 202, 430, 261, 711, 18845, 1345, 12, 1081, 262, 262, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 21897, 12315, 3790, 12, 467, 921, 1081, 262, 565, 288, 377, 202, 377, 202, 1893, 8367, 2932, 22670, 3790, 8863, 377, 202, 377, 202, 430, 261, 711, 18845, 1345, 12, 1081, 262, 262, ...
Set activityActivityBindings = first_activity .getActivityActivityBindings();
Set activityRequirementBindings = first_activity .getActivityRequirementBindings();
public void testActivity() { IActivity first_activity = activityManager .getActivity((String) activityIds.toArray()[0]); // Check activity activity bindings for parent activity Set activityActivityBindings = first_activity .getActivityActivityBindings(); for (int index = 2; index <= 7; index++) { assertTrue(activityActivityBindings .contains(new ActivityActivityBinding( "org.eclipse.activity" + Integer.toString(index), "org.eclipse.activity1"))); } // Check activity pattern bindings Set activityPatternBindings = first_activity .getActivityPatternBindings(); assertTrue(activityPatternBindings.size() != 0); IActivityPatternBinding activityPatternBinding = (IActivityPatternBinding) activityPatternBindings .toArray()[0]; assertTrue(activityPatternBinding.getActivityId().equals( first_activity.getId())); assertTrue(activityPatternBinding.getPattern().pattern().equals( "org.eclipse.pattern1")); // Check description try { assertTrue(first_activity.getDescription().equals("description")); } catch (NotDefinedException e) { e.printStackTrace(); } // Check activity id assertTrue(first_activity.getId().equals("org.eclipse.activity1")); // Check activity name try { assertTrue(first_activity.getName().equals("Activity 1")); } catch (NotDefinedException e) { e.printStackTrace(); } }
55805 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/55805/61842f9a715897e11fb6af364c40e35b86918e60/StaticTest.java/buggy/tests/org.eclipse.ui.tests/Eclipse UI Tests/org/eclipse/ui/tests/activities/StaticTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 6193, 1435, 288, 202, 202, 45, 6193, 1122, 67, 9653, 273, 5728, 1318, 9506, 202, 18, 588, 6193, 12443, 780, 13, 5728, 2673, 18, 31447, 1435, 63, 20, 19226, 202, 202...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 6193, 1435, 288, 202, 202, 45, 6193, 1122, 67, 9653, 273, 5728, 1318, 9506, 202, 18, 588, 6193, 12443, 780, 13, 5728, 2673, 18, 31447, 1435, 63, 20, 19226, 202, 202...
buf.append("\n");
buf.append("</tr>\n");
private void writeTableHead(String string, String[] strings, StringBuffer buf) { buf.append("<h2>"); buf.append(string); buf.append("</h2>\n"); buf.append("<table border=\"0\">\n"); buf.append("<tr>"); for(int i=0;i<strings.length;i++) { buf.append("<th>"); buf.append(strings[i]); buf.append("</th>"); } buf.append("\n"); }
51738 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51738/2a50af2c7d1c8c3a5ad945e6a509003db2cd8d7f/QueueToadlet.java/buggy/src/freenet/clients/http/QueueToadlet.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 1045, 1388, 1414, 12, 780, 533, 16, 514, 8526, 2064, 16, 6674, 1681, 13, 288, 202, 202, 4385, 18, 6923, 2932, 32, 76, 22, 2984, 1769, 202, 202, 4385, 18, 6923, 12, 108...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 1045, 1388, 1414, 12, 780, 533, 16, 514, 8526, 2064, 16, 6674, 1681, 13, 288, 202, 202, 4385, 18, 6923, 2932, 32, 76, 22, 2984, 1769, 202, 202, 4385, 18, 6923, 12, 108...
out.println("Usage: adduser [username] [password]");
writeLoggedFlushedResponse("Usage: adduser [username] [password]");
private boolean doSETPASSWORD(String argument) { int breakIndex = -1; if ((argument == null) || (argument.equals("")) || ((breakIndex = argument.indexOf(" ")) < 0)) { out.println("Usage: setpassword [username] [password]"); out.flush(); return true; } String username = argument.substring(0,breakIndex); String passwd = argument.substring(breakIndex + 1); if (username.equals("") || passwd.equals("")) { out.println("Usage: adduser [username] [password]"); return true; } User user = users.getUserByName(username); if (user == null) { out.println("No such user " + username); return true; } boolean success = user.setPassword(passwd); if (success) { users.updateUser(user); StringBuffer responseBuffer = new StringBuffer(64) .append("Password for ") .append(username) .append(" reset"); String response = responseBuffer.toString(); out.println(response); getLogger().info(response); } else { out.println("Error resetting password"); getLogger().info("Error resetting password"); } out.flush(); return true; }
47102 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47102/19742b13658fc079fa1f330c8ef176b565fef07c/RemoteManagerHandler.java/buggy/trunk/src/java/org/apache/james/remotemanager/RemoteManagerHandler.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1250, 741, 4043, 13784, 12, 780, 1237, 13, 288, 3639, 509, 898, 1016, 273, 300, 21, 31, 3639, 309, 14015, 3446, 422, 446, 13, 747, 5411, 261, 3446, 18, 14963, 2932, 6, 3719, 747, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1250, 741, 4043, 13784, 12, 780, 1237, 13, 288, 3639, 509, 898, 1016, 273, 300, 21, 31, 3639, 309, 14015, 3446, 422, 446, 13, 747, 5411, 261, 3446, 18, 14963, 2932, 6, 3719, 747, ...
viewBugDetailsItemActionPerformed(evt);
viewConsoleItemActionPerformed(evt);
public void actionPerformed(java.awt.event.ActionEvent evt) { viewBugDetailsItemActionPerformed(evt); }
7352 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7352/bf882463d59c6052e8c186cc8762ec65d3eafc47/FindBugsFrame.java/clean/findbugs/src/java/edu/umd/cs/findbugs/gui/FindBugsFrame.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 2398, 1071, 918, 26100, 12, 6290, 18, 2219, 88, 18, 2575, 18, 1803, 1133, 6324, 13, 288, 7734, 1476, 10215, 1180, 19449, 12, 73, 11734, 1769, 5411, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 2398, 1071, 918, 26100, 12, 6290, 18, 2219, 88, 18, 2575, 18, 1803, 1133, 6324, 13, 288, 7734, 1476, 10215, 1180, 19449, 12, 73, 11734, 1769, 5411, 289, 2, -100, -100, -100, -100, -100, -100, ...
System.out.println("subscriber: got a notify .");
logger.info("subscriber: got a notify count " + this.count++ );
public void processNotify( Request request, ServerTransaction serverTransactionId) { try { System.out.println("subscriber: got a notify ."); if (serverTransactionId == null) { System.out.println("subscriber: null TID."); return; } Dialog dialog = serverTransactionId.getDialog(); System.out.println("Dialog State = " + dialog.getState()); Response response = messageFactory.createResponse (200, request); // serverTransactionId.sendResponse(response); System.out.println("subscriber: Sending OK."); System.out.println("Dialog State = " + dialog.getState()); } catch (Exception ex) { ex.printStackTrace(); System.exit(0); } }
7607 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7607/d3bce65e49e71ee7df15bd72fd338535d4501bc1/Subscriber.java/buggy/trunk/src/examples/subsnotify/Subscriber.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1207, 9168, 12, 202, 202, 691, 590, 16, 202, 202, 2081, 3342, 1438, 27387, 13, 288, 202, 202, 698, 288, 1082, 202, 3163, 18, 659, 18, 8222, 2932, 26410, 30, 225, 2363, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1207, 9168, 12, 202, 202, 691, 590, 16, 202, 202, 2081, 3342, 1438, 27387, 13, 288, 202, 202, 698, 288, 1082, 202, 3163, 18, 659, 18, 8222, 2932, 26410, 30, 225, 2363, ...
((FigEdgeModelElement) _content).computeRoute();
((FigEdgeModelElement) getContent()).computeRoute();
public void mouseReleased(MouseEvent me) { // check pre-conds if (me.isConsumed() || !armed || pointIndex == -1) { armed = false; super.mouseReleased(me); return; } //Set-up: int x = me.getX(), y = me.getY(); // the fig that was under the mouse when it was released FigNodeModelElement newFig = null; //make a nice little target area: Rectangle mousePoint = new Rectangle(x - 5, y - 5, 5, 5); // and find the Fig: Editor editor = Globals.curEditor(); LayerManager lm = editor.getLayerManager(); Layer active = lm.getActiveLayer(); Enumeration figs = active.elementsIn(mousePoint); // last is the top fig. while (figs.hasMoreElements()) { Fig candidateFig = (Fig) figs.nextElement(); if (candidateFig instanceof FigNodeModelElement && candidateFig.isSelectable()) { newFig = (FigNodeModelElement) candidateFig; } } // check intermediate post-condition. if (newFig == null) { armed = false; super.mouseReleased(me); return; } UMLMutableGraphSupport mgm = (UMLMutableGraphSupport) editor.getGraphModel(); FigNodeModelElement oldFig = null; boolean isSource = false; if (pointIndex == 0) { oldFig = sourceFig; isSource = true; } else { oldFig = destFig; } // delegate the re-routing to graphmodels. if (mgm.canChangeConnectedNode(newFig.getOwner(), oldFig.getOwner(), this._content.getOwner())) { mgm.changeConnectedNode(newFig.getOwner(), oldFig.getOwner(), this._content.getOwner(), isSource); } editor.getSelectionManager().deselect(_content); armed = false; ((FigEdgeModelElement) _content).computeRoute(); super.mouseReleased(me); return; }
7166 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7166/55b1a2bf9e5a1ff91e4f97c63ed8d76eb2a68f27/SelectionRerouteEdge.java/clean/src_new/org/argouml/uml/diagram/ui/SelectionRerouteEdge.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 7644, 26363, 12, 9186, 1133, 1791, 13, 288, 3639, 368, 866, 675, 17, 20874, 3639, 309, 261, 3501, 18, 291, 20554, 1435, 747, 401, 297, 2937, 747, 1634, 1016, 422, 300, 21, 13...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 7644, 26363, 12, 9186, 1133, 1791, 13, 288, 3639, 368, 866, 675, 17, 20874, 3639, 309, 261, 3501, 18, 291, 20554, 1435, 747, 401, 297, 2937, 747, 1634, 1016, 422, 300, 21, 13...
throw new TypeError(getRuntime(), "expected " + argument_types().inspect() +
throw getRuntime().newTypeError("expected " + argument_types().inspect() +
public IRubyObject new_instance(IRubyObject[] args) { if (args.length != getArity()) { throw new ArgumentError(getRuntime(), args.length, getArity()); } Object[] constructorArguments = new Object[args.length]; Class[] types = constructor.getParameterTypes(); for (int i = 0; i < args.length; i++) { constructorArguments[i] = JavaUtil.convertArgument(args[i], types[i]); } try { Object result = constructor.newInstance(constructorArguments); return JavaObject.wrap(getRuntime(), result); } catch (IllegalArgumentException iae) { throw new TypeError(getRuntime(), "expected " + argument_types().inspect() + ", got [" + constructorArguments[0].getClass().getName() + ", ...]"); } catch (IllegalAccessException iae) { throw new TypeError(getRuntime(), "illegal access"); } catch (InvocationTargetException ite) { getRuntime().getJavaSupport().handleNativeException(ite.getTargetException()); Asserts.notReached(); return null; } catch (InstantiationException ie) { throw new TypeError(getRuntime(), "can't make instance of " + constructor.getDeclaringClass().getName()); } }
47273 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47273/870e1da9b41bfdbae259e1fc5f18fc8b76686998/JavaConstructor.java/buggy/src/org/jruby/javasupport/JavaConstructor.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 15908, 10340, 921, 394, 67, 1336, 12, 7937, 10340, 921, 8526, 833, 13, 288, 3639, 309, 261, 1968, 18, 2469, 480, 336, 686, 560, 10756, 288, 5411, 604, 394, 9236, 12, 588, 5576, 93...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 15908, 10340, 921, 394, 67, 1336, 12, 7937, 10340, 921, 8526, 833, 13, 288, 3639, 309, 261, 1968, 18, 2469, 480, 336, 686, 560, 10756, 288, 5411, 604, 394, 9236, 12, 588, 5576, 93...
if(isHierarchalMode()){ selectionList = new ArrayList(); Iterator selectionIterator = selection.iterator(); while(selectionIterator.hasNext()){ MarkerNode next = (MarkerNode) selectionIterator.next(); if(next.isConcrete()) selectionList.add(next); }
selectionList = new ArrayList(); Iterator selectionIterator = selection.iterator(); while (selectionIterator.hasNext()) { MarkerNode next = (MarkerNode) selectionIterator.next(); if (next.isConcrete()) selectionList.add(next);
protected String updateSummarySelected(IStructuredSelection selection) { Collection selectionList; if(isHierarchalMode()){ selectionList = new ArrayList(); Iterator selectionIterator = selection.iterator(); while(selectionIterator.hasNext()){ MarkerNode next = (MarkerNode) selectionIterator.next(); if(next.isConcrete()) selectionList.add(next); } } else selectionList = selection.toList(); return getSummary(new MarkerList(selectionList), "problem.statusSummarySelected"); //$NON-NLS-1$ }
56152 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56152/2bc2f7e05493c8f842d6d73cc7cb85357120cefd/ProblemView.java/buggy/bundles/org.eclipse.ui.ide/src/org/eclipse/ui/views/markers/internal/ProblemView.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 514, 1089, 4733, 7416, 12, 45, 30733, 6233, 4421, 13, 288, 202, 202, 2532, 4421, 682, 31, 202, 202, 430, 12, 291, 44, 5148, 287, 2309, 10756, 95, 1082, 202, 10705, 682, 273, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 514, 1089, 4733, 7416, 12, 45, 30733, 6233, 4421, 13, 288, 202, 202, 2532, 4421, 682, 31, 202, 202, 430, 12, 291, 44, 5148, 287, 2309, 10756, 95, 1082, 202, 10705, 682, 273, ...
synchronized( this ) {
IFolder srcFolder; synchronized(this){ srcFolder = getGeneratedSourceFolder();
public void generatedSourceFolderDeleted() { // jdt-core will remove the generated source folder from the java // project's classpath, so we'll just clean out our maps. projectClean( false ); synchronized( this ) { _generatedSourceFolder = null; } }
10698 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/10698/f33fe27819e8270eb24d0e5a64c8fba3d823b0e8/GeneratedFileManager.java/buggy/org.eclipse.jdt.apt.core/src/org/eclipse/jdt/apt/core/internal/generatedfile/GeneratedFileManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 4374, 1830, 3899, 7977, 1435, 202, 95, 202, 202, 759, 525, 7510, 17, 3644, 903, 1206, 326, 4374, 1084, 3009, 628, 326, 2252, 3196, 202, 759, 1984, 1807, 10006, 16, 1427, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 4374, 1830, 3899, 7977, 1435, 202, 95, 202, 202, 759, 525, 7510, 17, 3644, 903, 1206, 326, 4374, 1084, 3009, 628, 326, 2252, 3196, 202, 759, 1984, 1807, 10006, 16, 1427, ...
return RubyBignum.newBignum(getRuby(), value).op_minus(other); } return newFixnum(result); } }
return RubyBignum.newBignum(getRuby(), value).op_minus(other); } return newFixnum(result); } }
public RubyNumeric op_minus(RubyObject num) { RubyNumeric other = numericValue(num); if (other instanceof RubyFloat) { return RubyFloat.newFloat(getRuby(), getDoubleValue()).op_minus(other); } else if (other instanceof RubyBignum) { return RubyBignum.newBignum(getRuby(), value).op_minus(other); } else { long otherValue = other.getLongValue(); long result = value - otherValue; if ((value < 0 && otherValue > 0 && result > 0) || (value > 0 && otherValue < 0 && result < 0)) { return RubyBignum.newBignum(getRuby(), value).op_minus(other); } return newFixnum(result); } }
46454 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46454/1cc89bd397c0f049e6fa3045916fd6d9a3cdada8/RubyFixnum.java/buggy/org/jruby/RubyFixnum.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 19817, 9902, 1061, 67, 19601, 12, 54, 10340, 921, 818, 13, 288, 3639, 19817, 9902, 1308, 273, 6389, 620, 12, 2107, 1769, 3639, 309, 261, 3011, 1276, 19817, 4723, 13, 288, 5411, 327,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 19817, 9902, 1061, 67, 19601, 12, 54, 10340, 921, 818, 13, 288, 3639, 19817, 9902, 1308, 273, 6389, 620, 12, 2107, 1769, 3639, 309, 261, 3011, 1276, 19817, 4723, 13, 288, 5411, 327,...
String description = localizer.localizedTemplateStringForKeyWithObject("CreateTestItemFromReq.templateString", bug); TestItem testItem = user.createTestItemFromRequestWithDescription(bug, (Component)valueForKey("component"), description); EditPageInterface epi=(EditPageInterface)D2W.factory().pageForConfigurationNamed("CreateNewTestItemFromReq",session()); epi.setObject(testItem); epi.setNextPage(context().page());
String description = localizer.localizedTemplateStringForKeyWithObject("CreateTestItemFromReq.templateString", bug); TestItem testItem = user.createTestItemFromRequestWithDescription(bug, (Component)valueForKey("component"), description); epi=(EditPageInterface)D2W.factory().pageForConfigurationNamed("CreateNewTestItemFromReq",session()); epi.setObject(testItem); epi.setNextPage(context().page()); } finally { peer.unlock(); }
public WOComponent createTestItem() { ERXLocalizer localizer = ERXLocalizer.localizerForSession(session()); EOEditingContext peer = new EOEditingContext(bug.editingContext().parentObjectStore()); People user = (People)EOUtilities.localInstanceOfObject(peer,((Session)session()).getUser()); String description = localizer.localizedTemplateStringForKeyWithObject("CreateTestItemFromReq.templateString", bug); TestItem testItem = user.createTestItemFromRequestWithDescription(bug, (Component)valueForKey("component"), description); EditPageInterface epi=(EditPageInterface)D2W.factory().pageForConfigurationNamed("CreateNewTestItemFromReq",session()); epi.setObject(testItem); epi.setNextPage(context().page()); return (WOComponent)epi; }
50512 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50512/a8f1495dff9fbd49d7378b2716c8774c4b27141d/CreateTestItemFromReq.java/buggy/Common/Applications/BugTracker/Sources/er/bugtracker/CreateTestItemFromReq.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 678, 51, 1841, 752, 4709, 1180, 1435, 288, 3639, 4232, 60, 2042, 1824, 1191, 1824, 273, 4232, 60, 2042, 1824, 18, 3729, 1824, 1290, 2157, 12, 3184, 10663, 3639, 512, 51, 28029, 1042...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 678, 51, 1841, 752, 4709, 1180, 1435, 288, 3639, 4232, 60, 2042, 1824, 1191, 1824, 273, 4232, 60, 2042, 1824, 18, 3729, 1824, 1290, 2157, 12, 3184, 10663, 3639, 512, 51, 28029, 1042...
this.borderColor =
this.borderTopColor =
public Status layout(Area area) throws FOPException { if (this.marker == BREAK_AFTER) { return new Status(Status.OK); } if (this.marker == START) { String fontFamily = this.properties.get("font-family").getString(); String fontStyle = this.properties.get("font-style").getString(); String fontWeight = this.properties.get("font-weight").getString(); int fontSize = this.properties.get("font-size").getLength().mvalue(); this.fs = new FontState(area.getFontInfo(), fontFamily, fontStyle, fontWeight, fontSize); this.borderColor = this.properties.get("border-color").getColorType(); this.borderWidth = this.properties.get("border-width").getLength().mvalue(); this.borderStyle = this.properties.get("border-style").getEnum(); this.paddingTop = this.properties.get("padding").getLength().mvalue(); this.paddingLeft = this.paddingTop; this.paddingRight = this.paddingTop; this.paddingBottom = this.paddingTop; if (this.paddingTop == 0) { this.paddingTop = this.properties.get("padding-top").getLength().mvalue(); this.paddingLeft = this.properties.get("padding-left").getLength().mvalue(); this.paddingBottom = this.properties.get("padding-bottom").getLength().mvalue(); this.paddingRight = this.properties.get("padding-right").getLength().mvalue(); } this.spaceBefore = this.properties.get("space-before.optimum").getLength().mvalue(); this.spaceAfter = this.properties.get("space-after.optimum").getLength().mvalue(); this.backgroundColor = this.properties.get("background-color").getColorType(); this.id = this.properties.get("id").getString(); if (area instanceof BlockArea) { area.end(); } //if (this.isInListBody) { //startIndent += bodyIndent + distanceBetweenStarts; //} area.getIDReferences().createID(id); this.marker = 0; } if ((spaceBefore != 0) && (this.marker ==0)) { area.addDisplaySpace(spaceBefore); } if ( marker==0 ) { // configure id area.getIDReferences().configureID(id,area); } this.areaContainer = new AreaContainer(fs, startOffset - area.borderWidthLeft, - area.borderWidthTop, width, area.spaceLeft(), Position.RELATIVE); areaContainer.setPage(area.getPage()); areaContainer.setPadding(paddingTop, paddingLeft, paddingBottom, paddingRight); areaContainer.setBackgroundColor(backgroundColor); areaContainer.setBorderStyle(borderStyle, borderStyle, borderStyle, borderStyle); areaContainer.setBorderWidth(borderWidth, borderWidth, borderWidth, borderWidth); areaContainer.setBorderColor(borderColor, borderColor, borderColor, borderColor); areaContainer.start(); areaContainer.setAbsoluteHeight(area.getAbsoluteHeight()); areaContainer.setIDReferences(area.getIDReferences()); areaContainer.setTableCellXOffset(startOffset); int numChildren = this.children.size(); for (int i = this.marker; i < numChildren; i++) { FObj fo = (FObj) children.elementAt(i); fo.setIsInTableCell(); fo.forceWidth(width); Status status; if ((status = fo.layout(areaContainer)).isIncomplete()) { this.marker = i; if ((i == 0) && (status.getCode() == Status.AREA_FULL_NONE)) { return new Status(Status.AREA_FULL_NONE); } else { return new Status(Status.AREA_FULL_SOME); } } } areaContainer.end(); area.addChild(areaContainer); return new Status(Status.OK); }
5268 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5268/a1ec7f8239d6f243f9dbe06fe85e239cdfac4d63/TableCell.java/buggy/src/org/apache/fop/fo/flow/TableCell.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 2685, 3511, 12, 5484, 5091, 13, 1216, 478, 3665, 503, 288, 202, 430, 261, 2211, 18, 11145, 422, 605, 22176, 67, 18249, 13, 288, 202, 565, 327, 394, 2685, 12, 1482, 18, 3141, 1769,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 2685, 3511, 12, 5484, 5091, 13, 1216, 478, 3665, 503, 288, 202, 430, 261, 2211, 18, 11145, 422, 605, 22176, 67, 18249, 13, 288, 202, 565, 327, 394, 2685, 12, 1482, 18, 3141, 1769,...
XMLElement parent = findXMLElement(xml, parentObjectInstanceID, null);
XMLElement parent = findXMLElementWithId(xml, parentObjectInstanceID, null);
public static boolean deleteModule(IBXMLAble xml, String parentObjectInstanceID, int ICObjectInstanceID) { XMLElement parent = findXMLElement(xml, parentObjectInstanceID, null); if (parent != null) { try { XMLElement module = findModule(xml, ICObjectInstanceID, parent); return deleteModule(parent, module); } catch (Exception e) { e.printStackTrace(); return false; } } return false; }
54061 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54061/1978df88b9607f0c2cf5a2f3b1a3255248b154b3/XMLWriter.java/buggy/src/java/com/idega/builder/business/XMLWriter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 1250, 1430, 3120, 12, 13450, 4201, 5895, 298, 2025, 16, 514, 982, 921, 1442, 734, 16, 509, 26899, 921, 1442, 734, 13, 288, 202, 202, 15223, 982, 273, 1104, 15223, 12, 290...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 1250, 1430, 3120, 12, 13450, 4201, 5895, 298, 2025, 16, 514, 982, 921, 1442, 734, 16, 509, 26899, 921, 1442, 734, 13, 288, 202, 202, 15223, 982, 273, 1104, 15223, 12, 290...
addContextToChild( ctx, (Element)childNode );
public void handleDOMNodeInsertedEvent(MutationEvent evt) { Node childNode = (Node)evt.getTarget(); //check the type of the node inserted before discard the layout //in the case of <title> or <desc> or <metadata>, the layout //is unchanged switch( childNode.getNodeType() ){ case Node.TEXT_NODE: case Node.CDATA_SECTION_NODE: layoutedText = null; break; case Node.ELEMENT_NODE: if (childNode.getNamespaceURI().equals(SVG_NAMESPACE_URI)) { String nodeName = childNode.getLocalName(); if (nodeName.equals(SVG_TSPAN_TAG) || nodeName.equals(SVG_ALT_GLYPH_TAG) || nodeName.equals(SVG_A_TAG) || nodeName.equals(SVG_TEXT_PATH_TAG) || nodeName.equals(SVG_TREF_TAG)) { layoutedText = null; } } break; default: } if (layoutedText == null) { computeLayoutedText(); } }
45946 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45946/67074622e17bf0eead09841961ad66989d032b9b/SVGTextElementBridge.java/buggy/sources/org/apache/batik/bridge/SVGTextElementBridge.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 527, 1042, 774, 1763, 12, 1103, 16, 261, 1046, 13, 3624, 907, 11272, 527, 1042, 774, 1763, 12, 1103, 16, 261, 1046, 13, 3624, 907, 11272, 527, 1042, 774, 1763, 12, 1103, 16, 261, 1046, 13, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 527, 1042, 774, 1763, 12, 1103, 16, 261, 1046, 13, 3624, 907, 11272, 527, 1042, 774, 1763, 12, 1103, 16, 261, 1046, 13, 3624, 907, 11272, 527, 1042, 774, 1763, 12, 1103, 16, 261, 1046, 13, ...
throw new InternalError("Socket.setSoTimeout not implemented");
if (timeout < 0) throw new IllegalArgumentException("Invalid timeout: " + timeout); impl.setOption(SocketOptions.SO_TIMEOUT, new Integer(timeout));
public void setSoTimeout (int timeout) throws SocketException { throw new InternalError("Socket.setSoTimeout not implemented"); }
25337 /local/tlutelli/issta_data/temp/all_java2context/java/2006_temp/2006/25337/9378f999718203e09ed4e030ad6ef70f9d666322/Socket.java/clean/libjava/java/net/Socket.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 444, 10225, 2694, 261, 474, 2021, 13, 1216, 8758, 503, 225, 288, 565, 309, 261, 4538, 411, 374, 13, 604, 394, 2754, 2932, 1941, 2021, 30, 315, 397, 2021, 1769, 225, 9380, 18,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 444, 10225, 2694, 261, 474, 2021, 13, 1216, 8758, 503, 225, 288, 565, 309, 261, 4538, 411, 374, 13, 604, 394, 2754, 2932, 1941, 2021, 30, 315, 397, 2021, 1769, 225, 9380, 18,...
this.itsType = aType;
int itsType = aType;
public void initialize(int aType, String aName) throws Exception { this.itsType = aType; this.itsName = aName; props.put($Name, aName); }
54145 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54145/9619b3a25f43787dc92011111668210e06c00c71/Unix_Shortcut.java/buggy/src/lib/com/izforge/izpack/util/os/Unix_Shortcut.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 4046, 12, 474, 279, 559, 16, 514, 279, 461, 13, 1216, 1185, 565, 288, 3639, 509, 2097, 559, 273, 279, 559, 31, 3639, 333, 18, 1282, 461, 273, 279, 461, 31, 3639, 3458, 18, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 4046, 12, 474, 279, 559, 16, 514, 279, 461, 13, 1216, 1185, 565, 288, 3639, 509, 2097, 559, 273, 279, 559, 31, 3639, 333, 18, 1282, 461, 273, 279, 461, 31, 3639, 3458, 18, ...
String lang = idfr.identify(this.getClass().getResourceAsStream(tokens[0]));
String lang = idfr.identify(this.getClass().getResourceAsStream(tokens[0]), "UTF-8");
public void testIdentify() { try { long total = 0; LanguageIdentifier idfr = LanguageIdentifier.getInstance(); BufferedReader in = new BufferedReader(new InputStreamReader( this.getClass().getResourceAsStream("test-referencial.txt"))); String line = null; while((line = in.readLine()) != null) { String[] tokens = line.split(";"); if (!tokens[0].equals("")) { long start = System.currentTimeMillis(); // Identify the whole file String lang = idfr.identify(this.getClass().getResourceAsStream(tokens[0])); total += System.currentTimeMillis() - start; assertEquals(tokens[1], lang); // Then, each line of the file... BufferedReader testFile = new BufferedReader( new InputStreamReader( this.getClass().getResourceAsStream(tokens[0]), "UTF-8")); String testLine = null; while((testLine = testFile.readLine()) != null) { testLine = testLine.trim(); if (testLine.length() > 256) { lang = idfr.identify(testLine); assertEquals(tokens[1], lang); } } testFile.close(); } } in.close(); System.out.println("Total Time=" + total); } catch(Exception e) { e.printStackTrace(); fail(e.toString()); } }
1316 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1316/f255eccde285704b669383540b15cefd5b6c3181/TestLanguageIdentifier.java/buggy/src/plugin/languageidentifier/src/test/org/apache/nutch/analysis/lang/TestLanguageIdentifier.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 25787, 1435, 288, 3639, 775, 288, 5411, 1525, 2078, 273, 374, 31, 5411, 9889, 3004, 612, 4840, 273, 9889, 3004, 18, 588, 1442, 5621, 5411, 10633, 316, 273, 394, 10633, 12...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 25787, 1435, 288, 3639, 775, 288, 5411, 1525, 2078, 273, 374, 31, 5411, 9889, 3004, 612, 4840, 273, 9889, 3004, 18, 588, 1442, 5621, 5411, 10633, 316, 273, 394, 10633, 12...
return ( parent instanceof ICPPASTBaseSpecifier || parent instanceof ICPPASTElaboratedTypeSpecifier);
if( parent instanceof ICPPASTBaseSpecifier || parent instanceof ICPPASTElaboratedTypeSpecifier ) return true; if( parent instanceof ICPPASTQualifiedName ){ IASTName [] ns = ((ICPPASTQualifiedName)parent).getNames(); return ( astName != ns[ ns.length -1 ] ); } return false;
public boolean typesOnly(){ if( astName == null ) return false; IASTNode parent = astName.getParent(); return ( parent instanceof ICPPASTBaseSpecifier || parent instanceof ICPPASTElaboratedTypeSpecifier); }
6192 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6192/1362e388a1e7d7a2662a25cc5ac954b73d7f341e/CPPSemantics.java/clean/core/org.eclipse.cdt.core/parser/org/eclipse/cdt/internal/core/dom/parser/cpp/CPPSemantics.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3196, 202, 482, 1250, 1953, 3386, 1435, 95, 1082, 202, 430, 12, 3364, 461, 422, 446, 262, 327, 629, 31, 1082, 202, 45, 9053, 907, 982, 273, 3364, 461, 18, 588, 3054, 5621, 1082, 202, 430, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3196, 202, 482, 1250, 1953, 3386, 1435, 95, 1082, 202, 430, 12, 3364, 461, 422, 446, 262, 327, 629, 31, 1082, 202, 45, 9053, 907, 982, 273, 3364, 461, 18, 588, 3054, 5621, 1082, 202, 430, ...
this.delta.removed(element); this.delta.added(element);
this.delta.changed(element, ICElementDelta.F_REORDER);
private void findChangesInPositioning(ICElement element, int depth) throws CModelException { if (depth >= this.maxDepth || this.added.contains(element) || this.removed.contains(element)) return; if (!isPositionedCorrectly(element)) { this.delta.removed(element); this.delta.added(element); } if (element instanceof IParent) { CElementInfo info = null; info = ((CElement)element).getElementInfo(); ICElement[] children = info.getChildren(); if (children != null) { int length = children.length; for(int i = 0; i < length; i++) { this.findChangesInPositioning(children[i], depth + 1); } } }}
54911 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54911/e7bd887fae9fa423cd137190bb838d98c34fdb4e/CElementDeltaBuilder.java/buggy/core/org.eclipse.cdt.core/model/org/eclipse/cdt/internal/core/model/CElementDeltaBuilder.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 918, 1104, 7173, 382, 2555, 310, 12, 2871, 1046, 930, 16, 509, 3598, 13, 1216, 385, 1488, 503, 288, 202, 430, 261, 5979, 1545, 333, 18, 1896, 6148, 747, 333, 18, 9665, 18, 12298, 12, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 918, 1104, 7173, 382, 2555, 310, 12, 2871, 1046, 930, 16, 509, 3598, 13, 1216, 385, 1488, 503, 288, 202, 430, 261, 5979, 1545, 333, 18, 1896, 6148, 747, 333, 18, 9665, 18, 12298, 12, ...
updateMessage(message);
updateMessage(shownMessage);
private void showMessage(String newMessage, Image newImage) { // Any change? if (message.equals(newMessage) && messageImage == newImage) return; message = newMessage; if (message == null) message = "";//$NON-NLS-1$ //If there is an image then add in a space to the message //for layout purposes if(newImage != null) message = " " + message; //$NON-NLS-1$ messageImage = newImage; if (!showingError) { // we are not showing an error updateMessage(message); messageImageLabel.setImage(messageImage); setImageLabelVisible(messageImage != null); messageLabel.setToolTipText(message); layoutForNewMessage(); }}
58148 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/58148/a132e27c8aaaed6d0c813785271eda1aa179ed34/TitleAreaDialog.java/buggy/bundles/org.eclipse.jface/src/org/eclipse/jface/dialogs/TitleAreaDialog.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 918, 2405, 1079, 12, 780, 394, 1079, 16, 3421, 394, 2040, 13, 288, 202, 759, 5502, 2549, 35, 202, 430, 261, 2150, 18, 14963, 12, 2704, 1079, 13, 597, 883, 2040, 422, 394, 2040, 13, 2...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 918, 2405, 1079, 12, 780, 394, 1079, 16, 3421, 394, 2040, 13, 288, 202, 759, 5502, 2549, 35, 202, 430, 261, 2150, 18, 14963, 12, 2704, 1079, 13, 597, 883, 2040, 422, 394, 2040, 13, 2...
fail("This can not fail with this AxisFault " + axisFault) ;
fail("This can not fail with this AxisFault " + axisFault);
public void testModuleConfigAtService() { try { ConfigurationContextFactory builder = new ConfigurationContextFactory(); ar = builder.buildConfigurationContext(repo).getAxisConfiguration(); AxisService service = new AxisService(); service.setName(new QName("testService")); ar.addService(service); InputStream in = new FileInputStream(repo + "/service1.xml"); ServiceBuilder sbuilder = new ServiceBuilder(in,null,service); sbuilder.populateService(sbuilder.buildOM()); ModuleConfiguration moduleConfiguration = service.getModuleConfig(new QName("Servie_module")); assertNotNull(moduleConfiguration); Parameter para = moduleConfiguration.getParameter("Servie_module_para"); assertNotNull(para); AxisOperation op = service.getOperation(new QName("echoString")); assertNotNull(op); moduleConfiguration = op.getModuleConfig(new QName("Op_Module")); assertNotNull(moduleConfiguration); para = moduleConfiguration.getParameter("Op_Module_para"); assertNotNull(para); } catch (DeploymentException e) { fail("This can not fail with this DeploymentException " + e) ; } catch (FileNotFoundException e) { fail("This can not fail with this FileNotFoundException " + e) ; } catch (AxisFault axisFault) { fail("This can not fail with this AxisFault " + axisFault) ; } catch (XMLStreamException e) { fail("This can not fail with this AxisFault " + e) ; } }
49300 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49300/193e1198af0f4e291986396a754a50d3d64ab023/ModuleConfigTest.java/buggy/modules/core/test/org/apache/axis2/engine/ModuleConfigTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1377, 1071, 918, 1842, 3120, 809, 861, 1179, 1435, 288, 3639, 775, 288, 5411, 4659, 29871, 2089, 273, 394, 4659, 29871, 5621, 5411, 419, 273, 2089, 18, 3510, 1750, 1042, 12, 7422, 2934, 588, 6...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1377, 1071, 918, 1842, 3120, 809, 861, 1179, 1435, 288, 3639, 775, 288, 5411, 4659, 29871, 2089, 273, 394, 4659, 29871, 5621, 5411, 419, 273, 2089, 18, 3510, 1750, 1042, 12, 7422, 2934, 588, 6...
firePropertyChange(VIEWPORT_CHANGED_PROPERTY, old, v);
firePropertyChange("viewport", old, v);
public void setViewport(JViewport v) { JViewport old = viewport; removeNonNull(old); if (old != null) old.removeChangeListener(scrollListener); viewport = v; if (v != null) v.addChangeListener(scrollListener); addNonNull(v); revalidate(); repaint(); firePropertyChange(VIEWPORT_CHANGED_PROPERTY, old, v); sync(); }
50763 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50763/53b78dd1e4587254262f4618d2aa7551de8e0cbf/JScrollPane.java/buggy/core/src/classpath/javax/javax/swing/JScrollPane.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 19923, 655, 12, 46, 22743, 331, 13, 225, 288, 565, 804, 22743, 1592, 273, 10482, 31, 565, 1206, 8921, 12, 1673, 1769, 565, 309, 261, 1673, 480, 446, 13, 1377, 1592, 18, 4479,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 19923, 655, 12, 46, 22743, 331, 13, 225, 288, 565, 804, 22743, 1592, 273, 10482, 31, 565, 1206, 8921, 12, 1673, 1769, 565, 309, 261, 1673, 480, 446, 13, 1377, 1592, 18, 4479,...
jjmatchedKind = 6; return jjMoveStringLiteralDfa1_1(0x80L);
jjmatchedKind = 7; return jjMoveStringLiteralDfa1_1(0x100L);
private final int jjMoveStringLiteralDfa0_1(){ switch(curChar) { case 35: jjmatchedKind = 11; return jjMoveStringLiteralDfa1_1(0x500L); case 36: jjmatchedKind = 6; return jjMoveStringLiteralDfa1_1(0x80L); case 40: return jjStopAtPos(0, 4); case 91: return jjStopAtPos(0, 1); case 93: return jjStopAtPos(0, 2); case 102: return jjMoveStringLiteralDfa1_1(0x400000L); case 116: return jjMoveStringLiteralDfa1_1(0x200000L); case 123: return jjStopAtPos(0, 55); case 125: return jjStopAtPos(0, 56); default : return jjMoveNfa_1(0, 0); }}
55820 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/55820/b827d0bf89e728dc8324fc63c2ad3662c9d19cd3/ParserTokenManager.java/clean/src/java/org/apache/velocity/runtime/parser/ParserTokenManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 727, 509, 10684, 7607, 28565, 40, 507, 20, 67, 21, 1435, 95, 282, 1620, 12, 1397, 2156, 13, 282, 288, 1377, 648, 13191, 30, 540, 10684, 11073, 5677, 273, 4648, 31, 540, 327, 10684, 760...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 727, 509, 10684, 7607, 28565, 40, 507, 20, 67, 21, 1435, 95, 282, 1620, 12, 1397, 2156, 13, 282, 288, 1377, 648, 13191, 30, 540, 10684, 11073, 5677, 273, 4648, 31, 540, 327, 10684, 760...
myManager.childRemoved(treeEvent);
myManager.beforeChildRemoval(treeEvent);
public void run() { PsiTreeChangeEventImpl treeEvent = new PsiTreeChangeEventImpl(myManager); treeEvent.setParent(parentDir); if (VirtualFile.PROP_NAME.equals(propertyName)) { if (vFile.isDirectory()) { PsiDirectory psiDir = myVFileToPsiDirMap.get(vFile); if (psiDir != null) { if (myFileTypeManager.isFileIgnored(vFile.getName())) { removeFilesAndDirsRecursively(vFile); treeEvent.setChild(psiDir); myManager.childRemoved(treeEvent); } else { treeEvent.setElement(psiDir); treeEvent.setPropertyName(PsiTreeChangeEvent.PROP_DIRECTORY_NAME); treeEvent.setOldValue(event.getOldValue()); treeEvent.setNewValue(event.getNewValue()); myManager.propertyChanged(treeEvent); } } else { PsiDirectory psiDir1 = findDirectory(vFile); if (psiDir1 != null) { treeEvent.setChild(psiDir1); myManager.childAdded(treeEvent); } } } else { PsiFile psiFile = myVFileToPsiFileMap.get(vFile); if (psiFile != null) { PsiFile psiFile1 = createPsiFile(vFile, vFile.getName()); if (psiFile1 == null) { myVFileToPsiFileMap.remove(vFile); treeEvent.setChild(psiFile); myManager.childRemoved(treeEvent); } else if (!psiFile1.getClass().equals(psiFile.getClass())) { myVFileToPsiFileMap.remove(vFile); treeEvent.setOldChild(psiFile); treeEvent.setNewChild(psiFile1); myManager.childReplaced(treeEvent); } else { treeEvent.setElement(psiFile); treeEvent.setPropertyName(PsiTreeChangeEvent.PROP_FILE_NAME); treeEvent.setOldValue(event.getOldValue()); treeEvent.setNewValue(event.getNewValue()); myManager.propertyChanged(treeEvent); } } else { PsiFile psiFile1 = findFile(vFile); if (psiFile1 != null) { treeEvent.setChild(psiFile1); myManager.childAdded(treeEvent); } } } } else if (VirtualFile.PROP_WRITABLE.equals(propertyName)) { PsiFile psiFile = myVFileToPsiFileMap.get(vFile); if (psiFile == null) return; treeEvent.setElement(psiFile); treeEvent.setPropertyName(PsiTreeChangeEvent.PROP_WRITABLE); treeEvent.setOldValue(event.getOldValue()); treeEvent.setNewValue(event.getNewValue()); myManager.propertyChanged(treeEvent); } }
56598 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56598/671af53ecb4df5a36564759f83fd6c3b1163178f/FileManagerImpl.java/buggy/source/com/intellij/psi/impl/file/impl/FileManagerImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 6647, 1071, 918, 1086, 1435, 288, 5411, 453, 7722, 2471, 20930, 2828, 2151, 1133, 273, 394, 453, 7722, 2471, 20930, 2828, 12, 4811, 1318, 1769, 5411, 2151, 1133, 18, 542, 3054, 12, 2938, 1621, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 6647, 1071, 918, 1086, 1435, 288, 5411, 453, 7722, 2471, 20930, 2828, 2151, 1133, 273, 394, 453, 7722, 2471, 20930, 2828, 12, 4811, 1318, 1769, 5411, 2151, 1133, 18, 542, 3054, 12, 2938, 1621, ...
lastExprEndLine = ts.getLineno();
private Object memberExprTail(TokenStream ts, boolean allowCallSyntax, Object pn) throws IOException, JavaScriptException { lastExprEndLine = ts.getLineno(); int tt; while ((tt = ts.getToken()) > ts.EOF) { if (tt == ts.DOT) { sourceAdd((char)ts.DOT); mustMatchToken(ts, ts.NAME, "msg.no.name.after.dot"); String s = ts.getString(); sourceAddString(ts.NAME, s); pn = nf.createBinary(ts.DOT, pn, nf.createName(ts.getString())); /* pn = nf.createBinary(ts.DOT, pn, memberExpr(ts)) * is the version in Brendan's IR C version. Not in ECMA... * does it reflect the 'new' operator syntax he mentioned? */ lastExprEndLine = ts.getLineno(); } else if (tt == ts.LB) { sourceAdd((char)ts.LB); pn = nf.createBinary(ts.LB, pn, expr(ts, false)); mustMatchToken(ts, ts.RB, "msg.no.bracket.index"); sourceAdd((char)ts.RB); lastExprEndLine = ts.getLineno(); } else if (allowCallSyntax && tt == ts.LP) { /* make a call node */ pn = nf.createUnary(ts.CALL, pn); sourceAdd((char)ts.LP); /* Add the arguments to pn, if any are supplied. */ pn = argumentList(ts, pn); lastExprEndLine = ts.getLineno(); } else { ts.ungetToken(tt); break; } } return pn; }
7555 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7555/56c3f65ac92dbd3ff9f471a1829280e95bd7ddf4/Parser.java/clean/js/rhino/src/org/mozilla/javascript/Parser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1033, 3140, 4742, 12363, 12, 1345, 1228, 3742, 16, 1250, 1699, 1477, 8070, 16, 21394, 1033, 11059, 13, 3639, 1216, 1860, 16, 11905, 503, 565, 288, 9079, 509, 3574, 31, 3639, 1323, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1033, 3140, 4742, 12363, 12, 1345, 1228, 3742, 16, 1250, 1699, 1477, 8070, 16, 21394, 1033, 11059, 13, 3639, 1216, 1860, 16, 11905, 503, 565, 288, 9079, 509, 3574, 31, 3639, 1323, 1...
for (int i = 0; i < alen; i++) { Object arg = args[i]; if (arg instanceof Keyword) { String name = ((Keyword) arg).getName(); Object value = args[++i]; if (name == "name") result.setName(value.toString()); else if (name == "method") result.add((MethodProc) value); else result.setProperty(name, value); } else result.add((MethodProc) arg); }
result.setProperties(args);
public static GenericProc make (Object[] args) { int alen = args.length; int mlen = 0; GenericProc result = new GenericProc(); for (int i = 0; i < alen; i++) { Object arg = args[i]; if (arg instanceof Keyword) { String name = ((Keyword) arg).getName(); Object value = args[++i]; if (name == "name") result.setName(value.toString()); else if (name == "method") result.add((MethodProc) value); else result.setProperty(name, value); } else result.add((MethodProc) arg); } return result; }
41089 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/41089/72164a2a548fae6c2ed1d59db7f2b7115f81cf27/GenericProc.java/buggy/gnu/expr/GenericProc.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 7928, 15417, 1221, 261, 921, 8526, 833, 13, 225, 288, 565, 509, 524, 275, 273, 833, 18, 2469, 31, 565, 509, 312, 1897, 273, 374, 31, 565, 7928, 15417, 563, 273, 394, 7928, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 7928, 15417, 1221, 261, 921, 8526, 833, 13, 225, 288, 565, 509, 524, 275, 273, 833, 18, 2469, 31, 565, 509, 312, 1897, 273, 374, 31, 565, 7928, 15417, 563, 273, 394, 7928, ...
StringBuffer sb = new StringBuffer(header());
StringBuffer sb = new StringBuffer();
public void render(Writer writer, Report report) throws IOException { if (report.isEmpty()) { return; } StringBuffer sb = new StringBuffer(header()); String filename = null; String lineSep = PMD.EOL; boolean colorize = false; for (Iterator iter = report.iterator(); iter.hasNext();) { sb.setLength(0); IRuleViolation rv = (IRuleViolation) iter.next(); if (!rv.getFilename().equals(filename)) { // New File if (filename != null) { sb.append("</table></br>"); colorize = false; } filename = rv.getFilename(); sb.append("<table border=\"0\" width=\"80%\">"); sb.append("<tr id=TableHeader><td colspan=\"2\"><font class=title>&nbsp;").append(filename).append("</font></tr>"); sb.append(lineSep); } if (colorize) { sb.append("<tr id=RowColor1>"); } else { sb.append("<tr id=RowColor2>"); } colorize = !colorize; sb.append("<td width=\"50\" align=\"right\"><font class=body>" + rv.getBeginLine() + "&nbsp;&nbsp;&nbsp;</font></td>"); sb.append("<td><font class=body>" + rv.getDescription() + "</font></td>"); sb.append("</tr>"); sb.append(lineSep); writer.write(sb.toString()); } if (filename != null) { writer.write("</table>"); } writer.write("<br>"); // output the problems Iterator iter = report.errors(); if (iter.hasNext()) { sb.setLength(0); sb.append("<table border=\"0\" width=\"80%\">"); sb.append("<tr id=TableHeader><td><font class=title>&nbsp;Problems found</font></td></tr>"); colorize = false; while (iter.hasNext()) { if (colorize) { sb.append("<tr id=RowColor1>"); } else { sb.append("<tr id=RowColor2>"); } colorize = !colorize; sb.append("<td><font class=body>").append(iter.next()).append("\"</font></td></tr>"); } sb.append("</table>"); writer.write(sb.toString()); } writer.write(footer()); }
45569 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45569/b5aa7f3422be7390071cff9e84c66afa7287a81b/VBHTMLRenderer.java/clean/pmd/src/net/sourceforge/pmd/renderers/VBHTMLRenderer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1743, 12, 2289, 2633, 16, 8706, 2605, 13, 1216, 1860, 288, 3639, 309, 261, 6006, 18, 291, 1921, 10756, 288, 5411, 327, 31, 3639, 289, 3639, 6674, 2393, 273, 394, 6674, 5621, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1743, 12, 2289, 2633, 16, 8706, 2605, 13, 1216, 1860, 288, 3639, 309, 261, 6006, 18, 291, 1921, 10756, 288, 5411, 327, 31, 3639, 289, 3639, 6674, 2393, 273, 394, 6674, 5621, ...
int node = _parent[_index]; if (node > NULL) { int prev = -1; node = _offsetOrChild[node]; while (node != _index) { node = _nextSibling[prev = node]; } if (prev != -1) { return makeNode(prev); } } return null; }
int node = _parent[_index]; if (node > NULL) { int prev = -1; node = _offsetOrChild[node]; while (node != _index) { node = _nextSibling[prev = node]; } if (prev != -1) { return makeNode(prev); } } return null; }
public Node getPreviousSibling() { int node = _parent[_index]; if (node > NULL) { int prev = -1; node = _offsetOrChild[node]; while (node != _index) { node = _nextSibling[prev = node]; } if (prev != -1) { return makeNode(prev); } } return null; }
2723 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2723/264066e4e3d606d5167a1f5680c45669efd7e5c9/DOMImpl.java/clean/src/org/apache/xalan/xsltc/dom/DOMImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 2029, 17225, 10291, 1435, 288, 202, 565, 509, 756, 273, 389, 2938, 63, 67, 1615, 15533, 202, 565, 309, 261, 2159, 405, 3206, 13, 288, 202, 202, 474, 2807, 273, 300, 21, 31, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 2029, 17225, 10291, 1435, 288, 202, 565, 509, 756, 273, 389, 2938, 63, 67, 1615, 15533, 202, 565, 309, 261, 2159, 405, 3206, 13, 288, 202, 202, 474, 2807, 273, 300, 21, 31, ...
lfs.delete(new File(file));
lfs.delete(file);
public void run(JobConf job, final TaskUmbilicalProtocol umbilical) throws IOException { Class keyClass = job.getOutputKeyClass(); Class valueClass = job.getOutputValueClass(); Reducer reducer = (Reducer)job.newInstance(job.getReducerClass()); reducer.configure(job); FileSystem lfs = FileSystem.getNamed("local", job); copyPhase.complete(); // copy is already complete // open a file to collect map output String file = job.getLocalFile(getTaskId(), "all.1").toString(); SequenceFile.Writer writer = new SequenceFile.Writer(lfs, file, keyClass, valueClass); try { // append all input files into a single input file for (int i = 0; i < mapTaskIds.length; i++) { appendPhase.addPhase(); // one per file } DataOutputBuffer buffer = new DataOutputBuffer(); for (int i = 0; i < mapTaskIds.length; i++) { File partFile = this.mapOutputFile.getInputFile(mapTaskIds[i], getTaskId()); float progPerByte = 1.0f / lfs.getLength(partFile); Progress phase = appendPhase.phase(); phase.setStatus(partFile.toString()); SequenceFile.Reader in = new SequenceFile.Reader(lfs, partFile.toString(), job); try { int keyLen; while((keyLen = in.next(buffer)) > 0) { writer.append(buffer.getData(), 0, buffer.getLength(), keyLen); phase.set(in.getPosition()*progPerByte); reportProgress(umbilical); buffer.reset(); } } finally { in.close(); } phase.complete(); } } finally { writer.close(); } appendPhase.complete(); // append is complete // spawn a thread to give sort progress heartbeats Thread sortProgress = new Thread() { public void run() { while (!sortComplete) { try { reportProgress(umbilical); Thread.sleep(PROGRESS_INTERVAL); } catch (InterruptedException e) { continue; } catch (Throwable e) { return; } } } }; sortProgress.setName("Sort progress reporter for task "+getTaskId()); String sortedFile = job.getLocalFile(getTaskId(), "all.2").toString(); WritableComparator comparator = job.getOutputKeyComparator(); try { sortProgress.start(); // sort the input file SequenceFile.Sorter sorter = new SequenceFile.Sorter(lfs, comparator, valueClass, job); sorter.sort(file, sortedFile); // sort lfs.delete(new File(file)); // remove unsorted } finally { sortComplete = true; } sortPhase.complete(); // sort is complete // make output collector String name = getOutputName(getPartition()); final RecordWriter out = job.getOutputFormat().getRecordWriter(FileSystem.get(job), job, name); OutputCollector collector = new OutputCollector() { public void collect(WritableComparable key, Writable value) throws IOException { out.write(key, value); reportProgress(umbilical); } }; // apply reduce function SequenceFile.Reader in = new SequenceFile.Reader(lfs, sortedFile, job); Reporter reporter = getReporter(umbilical, getProgress()); long length = lfs.getLength(new File(sortedFile)); try { ValuesIterator values = new ValuesIterator(in, length, comparator, umbilical); while (values.more()) { reducer.reduce(values.getKey(), values, collector, reporter); values.nextKey(); } } finally { reducer.close(); in.close(); lfs.delete(new File(sortedFile)); // remove sorted out.close(reporter); } done(umbilical); }
50331 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50331/ee01fef4b4fb82c7492a4a747793839a4d14cd39/ReduceTask.java/clean/src/java/org/apache/hadoop/mapred/ReduceTask.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1086, 12, 2278, 3976, 1719, 16, 727, 3837, 57, 1627, 330, 1706, 5752, 225, 3592, 330, 1706, 13, 565, 1216, 1860, 288, 565, 1659, 498, 797, 273, 1719, 18, 588, 1447, 653, 797,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1086, 12, 2278, 3976, 1719, 16, 727, 3837, 57, 1627, 330, 1706, 5752, 225, 3592, 330, 1706, 13, 565, 1216, 1860, 288, 565, 1659, 498, 797, 273, 1719, 18, 588, 1447, 653, 797,...
}
}
public ImageInspector(ViewerCtrl control, ImageCanvas canvas, double magFactor) { super(control.getReferenceFrame(), "Image inspector"); init(control, canvas, magFactor); setJMenuBar(menuBar); buildGUI(); pack(); }
13273 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/13273/a2f4cd0a125d188c1e246cd85608e59a51e3d85c/ImageInspector.java/clean/SRC/org/openmicroscopy/shoola/agents/viewer/transform/ImageInspector.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 3421, 19443, 12, 18415, 12418, 3325, 16, 3421, 12971, 5953, 16, 1645, 4447, 6837, 13, 202, 95, 202, 202, 9565, 12, 7098, 18, 588, 2404, 3219, 9334, 315, 2040, 22700, 8863, 202, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 3421, 19443, 12, 18415, 12418, 3325, 16, 3421, 12971, 5953, 16, 1645, 4447, 6837, 13, 202, 95, 202, 202, 9565, 12, 7098, 18, 588, 2404, 3219, 9334, 315, 2040, 22700, 8863, 202, ...
Node node = doc.newDomNode();
Node node ;
public static void main(String[] args) throws Exception { final int iterations = Constants.CURSOR_ITERATIONS; String flavor; if(args.length == 0) flavor = "deep-attributes"; else flavor = args[0]; DomWalkV1 test = new DomWalkV1(); PerfUtil util = new PerfUtil(); long cputime; int hash = 0; // get the xml cursor char[] chars = util.createXmlData(flavor, Constants.XML_SIZE); XmlObject doc = XmlObject.Factory.parse(new CharArrayReader(chars)); Node node = doc.newDomNode(); // warm up the vm cputime = System.currentTimeMillis(); for(int i=0; i<iterations; i++){ hash += test.run(node); } cputime = System.currentTimeMillis() - cputime; // run it again for the real measurement cputime = System.currentTimeMillis(); for(int i=0; i<iterations; i++){ hash += test.run(node); } cputime = System.currentTimeMillis() - cputime; // print the results // Class.getSimpleName() is only provided in jdk1.5, so have to trim package name off test name for logging to support 1.4 System.out.print(Constants.DELIM+test.getClass().getName().substring(test.getClass().getName().lastIndexOf('.')+1)+" flavor="+flavor+" "); System.out.print("hash "+hash+" "); System.out.print("time "+cputime+"\n"); }
3520 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3520/6773734a98aa2b100f86f21a2cad93e48da3ede1/DomWalkV1.java/clean/test/perf/src/org/apache/xmlbeans/test/performance/v1/DomWalkV1.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 918, 2774, 12, 780, 8526, 833, 13, 1216, 1185, 225, 288, 565, 727, 509, 11316, 273, 5245, 18, 7509, 55, 916, 67, 11844, 15297, 31, 565, 514, 19496, 31, 565, 309, 12, 1968, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 918, 2774, 12, 780, 8526, 833, 13, 1216, 1185, 225, 288, 565, 727, 509, 11316, 273, 5245, 18, 7509, 55, 916, 67, 11844, 15297, 31, 565, 514, 19496, 31, 565, 309, 12, 1968, ...
String capacity = Integer.toString(cacheMapping.getCapacity());
String capacity = Long.toString(cacheMapping.getCapacity());
public JDOClassDescriptor(final ClassDescriptor clsDesc, final KeyGeneratorDescriptor keyGenDesc) throws MappingException { super((ClassDescriptorImpl) clsDesc); _tableName = getMapping().getMapTo().getTable(); if (_tableName == null) { throw new IllegalArgumentException("Argument 'tableName' is null"); } if (getIdentity() == null) { throw new MappingException("mapping.noIdentity", getJavaClass().getName()); } if (!(getIdentity() instanceof JDOFieldDescriptor)) { throw new IllegalArgumentException("Identity field must be of type JDOFieldDescriptor"); } if ((getExtends() != null) && !(getExtends() instanceof JDOClassDescriptor)) { throw new IllegalArgumentException( "Extended class does not have a JDO descriptor" ); } _idnames = new String[_identities.length]; for (int i = 0; i < _idnames.length; i++) { String[] sqlNames = ((JDOFieldDescriptor) _identities[i]).getSQLName(); if (sqlNames == null) { throw new MappingException("mapping.noSqlName", _identities[i].getFieldName(), getJavaClass().getName()); } _idnames[i] = sqlNames[0]; } _keyGenDesc = keyGenDesc; CacheTypeMapping cacheMapping = getMapping().getCacheTypeMapping(); if (cacheMapping != null) { String capacity = Integer.toString(cacheMapping.getCapacity()); _cacheParams.put(CountLimited.PARAM_CAPACITY, capacity); _cacheParams.put(TimeLimited.PARAM_TTL, capacity); Param[] params = cacheMapping.getParam(); for (int i = 0; i < params.length; i++) { _cacheParams.put(params[i].getName(), params[i].getValue()); } String debug = new Boolean(cacheMapping.getDebug()).toString(); _cacheParams.put(Cache.PARAM_DEBUG, debug); String type = cacheMapping.getType(); if ((TimeStampable.class.isAssignableFrom(getJavaClass())) && (type != null) && (type.equalsIgnoreCase("none"))) { throw new MappingException(Messages.format("persist.wrongCacheTypeSpecified", getMapping().getName())); } _cacheParams.put(Cache.PARAM_TYPE, type); } _cacheParams.put(Cache.PARAM_NAME, getMapping().getName()); }
57307 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57307/853698b460f86a6dc823501ae7b44f1edabd05ec/JDOClassDescriptor.java/clean/src/main/java/org/exolab/castor/jdo/engine/JDOClassDescriptor.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 804, 3191, 797, 3187, 12, 6385, 26641, 2028, 4217, 16, 5411, 727, 1929, 3908, 3187, 498, 7642, 4217, 13, 565, 1216, 30896, 288, 3639, 2240, 12443, 797, 3187, 2828, 13, 2028, 4217, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 804, 3191, 797, 3187, 12, 6385, 26641, 2028, 4217, 16, 5411, 727, 1929, 3908, 3187, 498, 7642, 4217, 13, 565, 1216, 30896, 288, 3639, 2240, 12443, 797, 3187, 2828, 13, 2028, 4217, 1...
localMessageField.getText(), messageLogArea.getText(), String.valueOf(displayAreaSize.width), String.valueOf(displayAreaSize.height)
this.localMessageField.getText(), this.messageLogArea.getText(), this.userInfoText
public String[] getValues() { Dimension displayAreaSize = imageComponent.getPreferedSize(); return new String[] { localMessageField.getText(), messageLogArea.getText(), String.valueOf(displayAreaSize.width), // need them for the constructor, which makes String.valueOf(displayAreaSize.height) }; // no need to store the users, as the dispatcher informs of them again! }
14315 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/14315/feb205e44ad808bcfe2f33002933567d2fddf0c3/UserGUI.java/clean/src/org/objectweb/proactive/examples/c3d/gui/UserGUI.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 8526, 13500, 1435, 288, 3639, 13037, 2562, 5484, 1225, 273, 1316, 1841, 18, 588, 1386, 586, 329, 1225, 5621, 3639, 327, 394, 514, 8526, 288, 5411, 1191, 1079, 974, 18, 588, 152...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 8526, 13500, 1435, 288, 3639, 13037, 2562, 5484, 1225, 273, 1316, 1841, 18, 588, 1386, 586, 329, 1225, 5621, 3639, 327, 394, 514, 8526, 288, 5411, 1191, 1079, 974, 18, 588, 152...
return "Instantiating a #ref with default run() method #loc";
return "Instantiating a #ref with default 'run()' method #loc";
public String buildErrorString(PsiElement location){ return "Instantiating a #ref with default run() method #loc"; }
12814 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12814/dba8b183fc1b08e7ad664812bfc0c64d1e4abd3c/ThreadWithDefaultRunMethodInspection.java/clean/plugins/InspectionGadgets/src/com/siyeh/ig/threading/ThreadWithDefaultRunMethodInspection.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 1361, 668, 780, 12, 52, 7722, 1046, 2117, 15329, 3639, 327, 315, 10675, 22906, 279, 468, 1734, 598, 805, 296, 2681, 11866, 707, 468, 1829, 14432, 565, 289, 2, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 1361, 668, 780, 12, 52, 7722, 1046, 2117, 15329, 3639, 327, 315, 10675, 22906, 279, 468, 1734, 598, 805, 296, 2681, 11866, 707, 468, 1829, 14432, 565, 289, 2, -100, -100, -100,...
public void selectAll() {
public void selectAll() {
public void selectAll() { for (int i = 0; i < data.length; i++) { data[i][0] = true; } }
57211 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57211/9a663cd266bbea72385cf911a70461dcbc3b3b3d/OverviewTableModel.java/buggy/trunk/src/net/sf/plantlore/client/OverviewTableModel.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 27787, 1435, 377, 288, 3639, 364, 261, 474, 277, 273, 374, 31, 277, 411, 501, 18, 2469, 31, 277, 27245, 288, 5411, 501, 63, 77, 6362, 20, 65, 273, 638, 31, 3639, 289, 565, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 27787, 1435, 377, 288, 3639, 364, 261, 474, 277, 273, 374, 31, 277, 411, 501, 18, 2469, 31, 277, 27245, 288, 5411, 501, 63, 77, 6362, 20, 65, 273, 638, 31, 3639, 289, 565, ...
.getPropertyValue(Properties.ID_JUMPLINKS_STATUS));
.getStructuralFeatureValue(NotationPackage.eINSTANCE.getRoutingStyle_JumpLinkStatus()));
public void refresh() { super.refresh(); try { executeAsReadAction(new Runnable() { public void run() { // Update display from model ConnectionEditPart obj = (ConnectionEditPart) getSingleInput(); if (!avoidObstaclesButton.isDisposed()) { Boolean val = (Boolean) obj .getPropertyValue(Properties.ID_AVOIDOBSTRUCTIONS); avoidObstaclesButton.setSelection(val.booleanValue()); } if (!closestDistanceButton.isDisposed()) { Boolean val = (Boolean) obj .getPropertyValue(Properties.ID_CLOSESTDISTANCE); closestDistanceButton.setSelection(val.booleanValue()); } if (!reverseJumpLinksButton.isDisposed()) { Boolean val = (Boolean) obj .getPropertyValue(Properties.ID_JUMPLINKS_REVERSE); reverseJumpLinksButton.setSelection(val.booleanValue()); } Button button = (Button) buttons.get(obj .getPropertyValue(Properties.ID_JUMPLINKS_STATUS)); if (button != null) button.setSelection(true); button = (Button) buttons.get(obj .getPropertyValue(Properties.ID_JUMPLINKS_TYPE)); if (button != null) button.setSelection(true); button = (Button) buttons.get(obj .getPropertyValue(Properties.ID_ROUTING)); if (button != null) button.setSelection(true); button = (Button) buttons.get(obj .getPropertyValue(Properties.ID_SMOOTHNESS)); if (button != null) button.setSelection(true); } }); } catch (Exception e) { e.printStackTrace(); } }
1758 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1758/a2c4f90ee5a24e30394a33d50744cac16e2ca06b/ConnectorAppearancePropertySection.java/clean/org.eclipse.gmf.runtime/plugins/org.eclipse.gmf.runtime.diagram.ui.properties/src/org/eclipse/gmf/runtime/diagram/ui/properties/sections/appearance/ConnectorAppearancePropertySection.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 4460, 1435, 288, 202, 202, 9565, 18, 9144, 5621, 202, 202, 698, 288, 1082, 202, 8837, 1463, 1994, 1803, 12, 2704, 10254, 1435, 288, 9506, 202, 482, 918, 1086, 1435, 288, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 4460, 1435, 288, 202, 202, 9565, 18, 9144, 5621, 202, 202, 698, 288, 1082, 202, 8837, 1463, 1994, 1803, 12, 2704, 10254, 1435, 288, 9506, 202, 482, 918, 1086, 1435, 288, ...
Vector vNewBaseSampleData = new Vector( ); for ( int i = 0; i < bsdList.size( ); i++ ) { BaseSampleData bsd = (BaseSampleData) bsdList.get( i ); bsd.setDataSetRepresentation( getConvertedBaseSampleDataRepresentation( bsd.getDataSetRepresentation( ) ) ); vNewBaseSampleData.add( bsd ); }
Vector vNewBaseSampleData = getConvertedBaseSampleDataRepresentation( bsdList, xAxisType );
private SampleData getConvertedSampleData( SampleData currentSampleData ) { // Convert base sample data EList bsdList = currentSampleData.getBaseSampleData( ); Vector vNewBaseSampleData = new Vector( ); for ( int i = 0; i < bsdList.size( ); i++ ) { BaseSampleData bsd = (BaseSampleData) bsdList.get( i ); bsd.setDataSetRepresentation( getConvertedBaseSampleDataRepresentation( bsd.getDataSetRepresentation( ) ) ); vNewBaseSampleData.add( bsd ); } currentSampleData.getBaseSampleData( ).clear( ); currentSampleData.getBaseSampleData( ).addAll( vNewBaseSampleData ); // Convert orthogonal sample data EList osdList = currentSampleData.getOrthogonalSampleData( ); Vector vNewOrthogonalSampleData = new Vector( ); for ( int i = 0; i < osdList.size( ); i++ ) { OrthogonalSampleData osd = (OrthogonalSampleData) osdList.get( i ); osd.setDataSetRepresentation( getConvertedOrthogonalSampleDataRepresentation( osd.getDataSetRepresentation( ) ) ); vNewOrthogonalSampleData.add( osd ); } currentSampleData.getOrthogonalSampleData( ).clear( ); currentSampleData.getOrthogonalSampleData( ) .addAll( vNewOrthogonalSampleData ); return currentSampleData; }
46013 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46013/51342f37efb819d66eb6bfa56ebaba4fb7f4fa8b/BarChart.java/buggy/chart/org.eclipse.birt.chart.ui.extension/src/org/eclipse/birt/chart/ui/swt/type/BarChart.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 11474, 751, 336, 22063, 8504, 751, 12, 11474, 751, 783, 8504, 751, 262, 202, 95, 202, 202, 759, 4037, 1026, 3296, 501, 202, 202, 41, 682, 324, 6427, 682, 273, 783, 8504, 751,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 11474, 751, 336, 22063, 8504, 751, 12, 11474, 751, 783, 8504, 751, 262, 202, 95, 202, 202, 759, 4037, 1026, 3296, 501, 202, 202, 41, 682, 324, 6427, 682, 273, 783, 8504, 751,...
String password, String encoding) throws IOException, KeyManagementException, LoginException, NoSuchAlgorithmException, BugzillaException {
String password, String encoding) throws IOException, BugzillaException, GeneralSecurityException {
public RepositoryConfiguration getConfiguration(String repositoryUrl, Proxy proxySettings, String userName, String password, String encoding) throws IOException, KeyManagementException, LoginException, NoSuchAlgorithmException, BugzillaException { String configUrlStr = repositoryUrl + CONFIG_RDF_URL; configUrlStr = BugzillaServerFacade.addCredentials(configUrlStr, userName, password); URL url = new URL(configUrlStr); SaxConfigurationContentHandler contentHandler = new SaxConfigurationContentHandler(); collectResults(url, proxySettings, encoding, contentHandler, true); RepositoryConfiguration config = contentHandler.getConfiguration(); if (config != null) { config.setRepositoryUrl(repositoryUrl); } return config; }
51151 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51151/925c56cd29a486a51cfd56ee2c309ee45ca25183/RepositoryConfigurationFactory.java/clean/org.eclipse.mylyn.bugzilla.core/src/org/eclipse/mylyn/internal/bugzilla/core/RepositoryConfigurationFactory.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 6281, 1750, 10316, 12, 780, 3352, 1489, 16, 7659, 2889, 2628, 16, 514, 12065, 16, 1082, 202, 780, 2201, 16, 514, 2688, 13, 1216, 1860, 16, 1929, 10998, 503, 16, 11744, 503, 16...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 6281, 1750, 10316, 12, 780, 3352, 1489, 16, 7659, 2889, 2628, 16, 514, 12065, 16, 1082, 202, 780, 2201, 16, 514, 2688, 13, 1216, 1860, 16, 1929, 10998, 503, 16, 11744, 503, 16...
{ }
{ }
private void setDoubleField (Object obj, Class klass, String field_name, double val) throws IOException { try { Field f = getField (klass, field_name); f.setDouble (obj, val); } catch (IllegalArgumentException _) { throw new InvalidClassException("incompatible field type for " + klass.getName() + "." + field_name); } catch (Exception _) { } }
45713 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45713/f2f8e75a9bc6cfc17557565a29487f70a109d3e0/ObjectInputStream.java/clean/libraries/javalib/java/io/ObjectInputStream.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 918, 444, 5265, 974, 261, 921, 1081, 16, 1659, 7352, 16, 514, 652, 67, 529, 16, 9506, 4202, 1645, 1244, 13, 1216, 1860, 225, 288, 565, 775, 1377, 288, 202, 974, 284, 273, 5031, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 918, 444, 5265, 974, 261, 921, 1081, 16, 1659, 7352, 16, 514, 652, 67, 529, 16, 9506, 4202, 1645, 1244, 13, 1216, 1860, 225, 288, 565, 775, 1377, 288, 202, 974, 284, 273, 5031, ...
subMenu = new JMenu("More"); fudge = 1;
subMenu = new JMenu("More..."); parentMenu.add(subMenu);
public static void breakLongMenu(final Window frame, final JMenu input) { final Dimension size = frame.getSize(); final int windowHeight = size.height; final int totalRows = input.getItemCount(); final int preferredHeight = input.getItem(0).getPreferredSize().height; final int FUDGE = 3; // XXX find a better way to compute this... final int rowsPerSubMenu = (windowHeight/ preferredHeight) - FUDGE; if (totalRows < rowsPerSubMenu) { return; } JMenu parentMenu = input; JMenu subMenu = new JMenu("More"); int fudge = 0; while (input.getItemCount() > rowsPerSubMenu + fudge) { final JMenuItem item = input.getItem(rowsPerSubMenu); subMenu.add(item); int n = subMenu.getItemCount(); if (n >= rowsPerSubMenu) { parentMenu.add(subMenu); // Note that this removes it from the original menu! parentMenu = subMenu; subMenu = new JMenu("More"); fudge = 1; } } if (subMenu.getItemCount() > 0) { parentMenu.add(subMenu); } /** TODO: Resizing the main window does not change the height of the menu. * This is left as an exercise for the reader: * frame.addComponentListener(new ComponentAdapter() { * @Override * public void componentResized(ComponentEvent e) { * JMenu oldMenu = fileMenu; * // Loop over oldMenu, if JMenu, replace with its elements, recursively...! * ASUtils.breakLongMenu(fileMenu); * } * }); */ }
53257 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/53257/e5c8134f54d582c05bc87406d48fcf27abe37a9f/ASUtils.java/clean/src/ca/sqlpower/architect/swingui/ASUtils.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 918, 898, 3708, 4599, 12, 6385, 6076, 2623, 16, 727, 804, 4599, 810, 13, 288, 202, 202, 6385, 13037, 963, 273, 2623, 18, 588, 1225, 5621, 202, 202, 6385, 509, 2742, 2686,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 918, 898, 3708, 4599, 12, 6385, 6076, 2623, 16, 727, 804, 4599, 810, 13, 288, 202, 202, 6385, 13037, 963, 273, 2623, 18, 588, 1225, 5621, 202, 202, 6385, 509, 2742, 2686,...
decorator = findDecorator(website, (String) ctx.get("decorator"));
decorator = findDecorator(weblog);
public void render(Map model, Writer out) throws Exception { // lookup the specified resource Template tmpl = RollerVelocity.getTemplate(this.resourceId, "UTF-8"); // convert model to Velocity Context Context ctx = new VelocityContext(model); // if there is a decorator template then apply it WebsiteData website = null; // TODO: this is poor form, we should not need to access the pojo from the wrapper WebsiteDataWrapper websiteWrapper = (WebsiteDataWrapper) model.get("website"); if(websiteWrapper != null) { website = websiteWrapper.getPojo(); } if (website != null) { Template decorator = null; try { // look for decorator decorator = findDecorator(website, (String) ctx.get("decorator")); } catch(Exception e) { // error finding decorator log.warn("Could not find a decorator to apply"); } if(decorator != null) { // render current template StringWriter sw = new StringWriter(); tmpl.merge(ctx, sw); // put rendered template into context ctx.put("decorator_body", sw.toString()); tmpl = decorator; } } // render output to servlet response tmpl.merge(ctx, out); }
46431 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46431/f03b218a70c52455d25956f78ff4341f3ddd3891/VelocityWeblogPageRenderer.java/buggy/src/org/apache/roller/ui/rendering/velocity/VelocityWeblogPageRenderer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1743, 12, 863, 938, 16, 5497, 596, 13, 1216, 1185, 288, 7734, 368, 3689, 326, 1269, 1058, 3639, 5035, 10720, 273, 11714, 749, 27522, 18, 588, 2283, 12, 2211, 18, 3146, 548, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1743, 12, 863, 938, 16, 5497, 596, 13, 1216, 1185, 288, 7734, 368, 3689, 326, 1269, 1058, 3639, 5035, 10720, 273, 11714, 749, 27522, 18, 588, 2283, 12, 2211, 18, 3146, 548, 1...
maxrows = max;
connection.maxrows = max;
public void setMaxRows(int max) throws SQLException { maxrows = max; }
45497 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45497/ba977c086c01726affcc96219a79584a11ccc78e/Statement.java/clean/src/interfaces/jdbc/postgresql/Statement.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 10851, 4300, 12, 474, 943, 13, 1216, 6483, 202, 95, 202, 202, 1896, 3870, 273, 943, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 10851, 4300, 12, 474, 943, 13, 1216, 6483, 202, 95, 202, 202, 1896, 3870, 273, 943, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100...
{ return point3D.y; }
{ return point3D.y; }
public double getY3D() { return point3D.y; }
45167 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45167/a0fe2ba9ebb5b30198ad5632dce2a72cb9cfd6d0/Atom.java/clean/org/openscience/cdk/Atom.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1645, 10448, 23, 40, 1435, 202, 95, 202, 202, 2463, 1634, 23, 40, 18, 93, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1645, 10448, 23, 40, 1435, 202, 95, 202, 202, 2463, 1634, 23, 40, 18, 93, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, ...
logger.logApiId();
SessionModelEventDispatcher(final Workspace workspace, final InternalModelFactory modelFactory, final XMPPSession xmppSession) { super(); this.logger = new Log4JWrapper(); this.modelFactory = modelFactory; logger.logApiId(); xmppSession.clearListeners(); xmppSession.addListener(new ArtifactListener() { public void handleDraftCreated(final UUID uniqueId, final JabberId createdBy, final Calendar createdOn) { getArtifactModel().handleDraftCreated(uniqueId, createdBy, createdOn); } public void handleDraftDeleted(final UUID uniqueId, final JabberId deletedBy, final Calendar deletedOn) { getArtifactModel().handleDraftDeleted(uniqueId, deletedBy, deletedOn); } public void handleReceived(final UUID uniqueId, final Long versionId, final JabberId receivedBy, final Calendar receivedOn) { logger.logApiId(); getArtifactModel().handleReceived(uniqueId, versionId, receivedBy, receivedOn); } public void teamMemberAdded(final UUID uniqueId, final JabberId jabberId) { getArtifactModel().handleTeamMemberAdded(uniqueId, jabberId); } public void teamMemberRemoved(final UUID artifactUniqueId, final JabberId jabberId) { getArtifactModel().handleTeamMemberRemoved(artifactUniqueId, jabberId); } }); xmppSession.addListener(new ContainerListener() { public void handleArtifactPublished(final JabberId publishedBy, final Calendar publishedOn, final UUID containerUniqueId, final Long containerVersionId, final String containerName, final Integer containerArtifactCount, final Integer containerArtifactIndex, final UUID artifactUniqueId, final Long artifactVersionId, final String artifactName, final ArtifactType artifactType, final String artifactChecksum, final String artifactStreamId) { getContainerModel().handleArtifactPublished(containerUniqueId, containerVersionId, containerName, artifactUniqueId, artifactVersionId, artifactName, artifactType, artifactChecksum, artifactStreamId, publishedBy, publishedOn); } public void handlePublished(final UUID uniqueId, final Long versionId, final String name, final Integer artifactCount, final JabberId publishedBy, final List<JabberId> publishedTo, final Calendar publishedOn) { getContainerModel().handlePublished(uniqueId, versionId, name, artifactCount, publishedBy, publishedTo, publishedOn); } }); xmppSession.addListener(new ContactListener() { public void handleContactDeleted(final JabberId deletedBy, final Calendar deletedOn) { getContactModel().handleContactDeleted(deletedBy, deletedOn); } public void handleContactUpdated(final JabberId contactId, final Calendar updatedOn) { getContactModel().handleContactUpdated(contactId, updatedOn); } public void handleInvitationAccepted(final JabberId acceptedBy, final Calendar acceptedOn) { getContactModel().handleInvitationAccepted(acceptedBy, acceptedOn); } public void handleInvitationDeclined(final EMail invitedAs, final JabberId declinedBy, final Calendar declinedOn) { getContactModel().handleInvitationDeclined(invitedAs, declinedBy, declinedOn); } public void handleInvitationDeleted(final EMail invitedAs, final JabberId deletedBy, final Calendar deletedOn) { getContactModel().handleInvitationDeleted(invitedAs, deletedBy, deletedOn); } public void handleInvitationExtended(final EMail invitedAs, final JabberId invitedBy, final Calendar invitedOn) { getContactModel().handleInvitationExtended(invitedAs, invitedBy, invitedOn); } }); xmppSession.addListener(new SessionListener() { public void sessionEstablished() { getSessionModel().handleSessionEstablished(); } public void sessionTerminated() { getSessionModel().handleSessionTerminated(); } public void sessionTerminated(final Exception x) { getSessionModel().handleSessionTerminated(x); } }); }
53635 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/53635/1a5afbe8b391e23722a7393d16e27c5629a66e52/SessionModelEventDispatcher.java/buggy/local/model/src/main/java/com/thinkparity/ophelia/model/session/SessionModelEventDispatcher.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3877, 1488, 1133, 6681, 12, 6385, 14396, 6003, 16, 5411, 727, 3186, 1488, 1733, 938, 1733, 16, 5411, 727, 23216, 2157, 619, 24109, 2157, 13, 288, 3639, 2240, 5621, 3639, 333, 18, 4901, 27...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3877, 1488, 1133, 6681, 12, 6385, 14396, 6003, 16, 5411, 727, 3186, 1488, 1733, 938, 1733, 16, 5411, 727, 23216, 2157, 619, 24109, 2157, 13, 288, 3639, 2240, 5621, 3639, 333, 18, 4901, 27...
public static FloatedBlockBox generateFloated( LayoutContext c, FloatedBlockContent content, int avail,
public static FloatLayoutResult generateFloated( final LayoutContext c, FloatedBlockContent content, int avail,
public static FloatedBlockBox generateFloated( LayoutContext c, FloatedBlockContent content, int avail, LineBox curr_line, List pendingFloats) { Rectangle oe = c.getExtents(); c.setExtents(new Rectangle(oe)); MarkerData markerData = c.getCurrentMarkerData(); c.setCurrentMarkerData(null); FloatedBlockBox block = new FloatedBlockBox(); block.setContainingBlock(curr_line.getParent()); block.setContainingLayer(curr_line.getContainingLayer()); block.y = curr_line.y + content.getMarginFromPrevious(); block.element = content.getElement(); Boxing.layout(c, block, content); c.getBlockFormattingContext().floatBox(c, (FloatedBlockBox) block); if (! block.getStyle().isFloated()) { throw new XRRuntimeException("Invalid call to generateFloatedBlock(); where float: none "); } c.setCurrentMarkerData(markerData); c.setExtents(oe); if (pendingFloats.size() > 0 || block.getWidth() > avail) { if (pendingFloats.size() > 0) { block.y = 0; } pendingFloats.add(block); c.getBlockFormattingContext().getFloatManager().removeFloat(block); c.getLayer().removeFloat(block); // FIXME Not yet, will also detach children. // Should be laying out again though anyway. /* block.detach(); */ block.setPending(true); } return block; }
8125 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8125/365d5c0efcf4a646ee68af110b7ac1ac42b7efa4/LayoutUtil.java/clean/src/java/org/xhtmlrenderer/layout/LayoutUtil.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 478, 383, 690, 1768, 3514, 2103, 42, 383, 690, 12, 5411, 9995, 1042, 276, 16, 478, 383, 690, 1768, 1350, 913, 16, 509, 15783, 16, 2398, 5377, 3514, 4306, 67, 1369, 16, 987, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 478, 383, 690, 1768, 3514, 2103, 42, 383, 690, 12, 5411, 9995, 1042, 276, 16, 478, 383, 690, 1768, 1350, 913, 16, 509, 15783, 16, 2398, 5377, 3514, 4306, 67, 1369, 16, 987, ...
public void testScopeUpdate( )
public void testScopeUpdate()
public void testScopeUpdate( ) throws InvalidVersionSpecificationException, ArtifactResolutionException { /* farthest = compile */ checkScopeUpdate( Artifact.SCOPE_COMPILE, Artifact.SCOPE_COMPILE, Artifact.SCOPE_COMPILE ); checkScopeUpdate( Artifact.SCOPE_COMPILE, Artifact.SCOPE_PROVIDED, Artifact.SCOPE_COMPILE ); checkScopeUpdate( Artifact.SCOPE_COMPILE, Artifact.SCOPE_RUNTIME, Artifact.SCOPE_COMPILE ); checkScopeUpdate( Artifact.SCOPE_COMPILE, Artifact.SCOPE_SYSTEM, Artifact.SCOPE_COMPILE ); checkScopeUpdate( Artifact.SCOPE_COMPILE, Artifact.SCOPE_TEST, Artifact.SCOPE_COMPILE ); /* farthest = provided */ checkScopeUpdate( Artifact.SCOPE_PROVIDED, Artifact.SCOPE_COMPILE, Artifact.SCOPE_COMPILE ); checkScopeUpdate( Artifact.SCOPE_PROVIDED, Artifact.SCOPE_PROVIDED, Artifact.SCOPE_PROVIDED ); checkScopeUpdate( Artifact.SCOPE_PROVIDED, Artifact.SCOPE_RUNTIME, Artifact.SCOPE_RUNTIME ); checkScopeUpdate( Artifact.SCOPE_PROVIDED, Artifact.SCOPE_SYSTEM, Artifact.SCOPE_SYSTEM ); checkScopeUpdate( Artifact.SCOPE_PROVIDED, Artifact.SCOPE_TEST, Artifact.SCOPE_TEST ); /* farthest = runtime */ checkScopeUpdate( Artifact.SCOPE_RUNTIME, Artifact.SCOPE_COMPILE, Artifact.SCOPE_COMPILE ); checkScopeUpdate( Artifact.SCOPE_RUNTIME, Artifact.SCOPE_PROVIDED, Artifact.SCOPE_RUNTIME ); checkScopeUpdate( Artifact.SCOPE_RUNTIME, Artifact.SCOPE_RUNTIME, Artifact.SCOPE_RUNTIME ); checkScopeUpdate( Artifact.SCOPE_RUNTIME, Artifact.SCOPE_SYSTEM, Artifact.SCOPE_SYSTEM ); checkScopeUpdate( Artifact.SCOPE_RUNTIME, Artifact.SCOPE_TEST, Artifact.SCOPE_RUNTIME ); /* farthest = system */ checkScopeUpdate( Artifact.SCOPE_SYSTEM, Artifact.SCOPE_COMPILE, Artifact.SCOPE_COMPILE ); checkScopeUpdate( Artifact.SCOPE_SYSTEM, Artifact.SCOPE_PROVIDED, Artifact.SCOPE_PROVIDED ); checkScopeUpdate( Artifact.SCOPE_SYSTEM, Artifact.SCOPE_RUNTIME, Artifact.SCOPE_RUNTIME ); checkScopeUpdate( Artifact.SCOPE_SYSTEM, Artifact.SCOPE_SYSTEM, Artifact.SCOPE_SYSTEM ); checkScopeUpdate( Artifact.SCOPE_SYSTEM, Artifact.SCOPE_TEST, Artifact.SCOPE_TEST ); /* farthest = test */ checkScopeUpdate( Artifact.SCOPE_TEST, Artifact.SCOPE_COMPILE, Artifact.SCOPE_COMPILE ); checkScopeUpdate( Artifact.SCOPE_TEST, Artifact.SCOPE_PROVIDED, Artifact.SCOPE_PROVIDED ); checkScopeUpdate( Artifact.SCOPE_TEST, Artifact.SCOPE_RUNTIME, Artifact.SCOPE_RUNTIME ); checkScopeUpdate( Artifact.SCOPE_TEST, Artifact.SCOPE_SYSTEM, Artifact.SCOPE_SYSTEM ); checkScopeUpdate( Artifact.SCOPE_TEST, Artifact.SCOPE_TEST, Artifact.SCOPE_TEST ); }
47050 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47050/e8f75bf411923107c88629fad6af6c989a2704f5/DefaultArtifactCollectorTest.java/clean/maven-artifact/src/test/java/org/apache/maven/artifact/resolver/DefaultArtifactCollectorTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 3876, 1891, 1435, 3639, 1216, 1962, 1444, 8615, 503, 16, 14022, 11098, 503, 565, 288, 3639, 1748, 10247, 29201, 273, 4074, 1195, 3639, 866, 3876, 1891, 12, 14022, 18, 19444...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 3876, 1891, 1435, 3639, 1216, 1962, 1444, 8615, 503, 16, 14022, 11098, 503, 565, 288, 3639, 1748, 10247, 29201, 273, 4074, 1195, 3639, 866, 3876, 1891, 12, 14022, 18, 19444...
sql += " AND p.proname LIKE '"+escapeQuotes(procedureNamePattern.toLowerCase())+"' ";
sql += " AND p.proname LIKE '"+escapeQuotes(procedureNamePattern)+"' ";
public java.sql.ResultSet getProcedures(String catalog, String schemaPattern, String procedureNamePattern) throws SQLException { String sql; if (connection.haveMinimumServerVersion("7.3")) { sql = "SELECT NULL AS PROCEDURE_CAT, n.nspname AS PROCEDURE_SCHEM, p.proname AS PROCEDURE_NAME, NULL, NULL, NULL, d.description AS REMARKS, "+java.sql.DatabaseMetaData.procedureReturnsResult+" AS PROCEDURE_TYPE "+ " FROM pg_catalog.pg_namespace n, pg_catalog.pg_proc p "+ " LEFT JOIN pg_catalog.pg_description d ON (p.oid=d.objoid) "+ " LEFT JOIN pg_catalog.pg_class c ON (d.classoid=c.oid AND c.relname='pg_proc') "+ " LEFT JOIN pg_catalog.pg_namespace pn ON (c.relnamespace=pn.oid AND pn.nspname='pg_catalog') "+ " WHERE p.pronamespace=n.oid "; if (schemaPattern != null && !"".equals(schemaPattern)) { sql += " AND n.nspname LIKE '"+escapeQuotes(schemaPattern.toLowerCase())+"' "; } if (procedureNamePattern != null) { sql += " AND p.proname LIKE '"+escapeQuotes(procedureNamePattern.toLowerCase())+"' "; } sql += " ORDER BY PROCEDURE_SCHEM, PROCEDURE_NAME "; } else if (connection.haveMinimumServerVersion("7.1")) { sql = "SELECT NULL AS PROCEDURE_CAT, NULL AS PROCEDURE_SCHEM, p.proname AS PROCEDURE_NAME, NULL, NULL, NULL, d.description AS REMARKS, "+java.sql.DatabaseMetaData.procedureReturnsResult+" AS PROCEDURE_TYPE "+ " FROM pg_proc p "+ " LEFT JOIN pg_description d ON (p.oid=d.objoid) "+ " LEFT JOIN pg_class c ON (d.classoid=c.oid AND c.relname='pg_proc') "; if (procedureNamePattern != null) { sql += " WHERE p.proname LIKE '"+escapeQuotes(procedureNamePattern.toLowerCase())+"' "; } sql += " ORDER BY PROCEDURE_NAME "; } else { sql = "SELECT NULL AS PROCEDURE_CAT, NULL AS PROCEDURE_SCHEM, p.proname AS PROCEDURE_NAME, NULL, NULL, NULL, NULL AS REMARKS, "+java.sql.DatabaseMetaData.procedureReturnsResult+" AS PROCEDURE_TYPE "+ " FROM pg_proc p "; if (procedureNamePattern != null) { sql += " WHERE p.proname LIKE '"+escapeQuotes(procedureNamePattern.toLowerCase())+"' "; } sql += " ORDER BY PROCEDURE_NAME "; } return connection.createStatement().executeQuery(sql); }
49868 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49868/718820fdcbe37650edf9773102d952e1d9fc6432/AbstractJdbc1DatabaseMetaData.java/clean/org/postgresql/jdbc1/AbstractJdbc1DatabaseMetaData.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 2252, 18, 4669, 18, 13198, 3570, 23382, 12, 780, 6222, 16, 514, 1963, 3234, 16, 514, 12131, 461, 3234, 13, 1216, 6483, 202, 95, 202, 202, 780, 1847, 31, 202, 202, 430, 261, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 2252, 18, 4669, 18, 13198, 3570, 23382, 12, 780, 6222, 16, 514, 1963, 3234, 16, 514, 12131, 461, 3234, 13, 1216, 6483, 202, 95, 202, 202, 780, 1847, 31, 202, 202, 430, 261, ...
public static Display getDisplay(MIDlet m) { Display result; if (MIDletBridge.getMIDletAccess(m).getDisplayAccess() == null) { result = new Display(); MIDletBridge.getMIDletAccess(m).setDisplayAccess(result.accessor); } else { result = MIDletBridge.getMIDletAccess(m).getDisplayAccess().getDisplay(); } tickerPaint.setCurrentDisplay(result); return result; }
3541 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3541/4c797c68ce6f61a9d37ac7dc3622e936f213b564/Display.java/clean/microemulator/src/javax/microedition/lcdui/Display.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 9311, 13854, 12, 49, 734, 1810, 312, 13, 202, 95, 202, 202, 4236, 563, 31, 377, 202, 202, 430, 261, 49, 734, 1810, 13691, 18, 588, 49, 734, 1810, 1862, 12, 81, 2934, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 9311, 13854, 12, 49, 734, 1810, 312, 13, 202, 95, 202, 202, 4236, 563, 31, 377, 202, 202, 430, 261, 49, 734, 1810, 13691, 18, 588, 49, 734, 1810, 1862, 12, 81, 2934, ...
else media_table.put (sd.getMedia (),sd);
public void addStyleSheet (StylesheetDescription sd) { // see if the title is already in the hashtable Hashtable media_table= (Hashtable) title_table.get (sd.getTitle ()); if (media_table==null) { media_table=new Hashtable (); media_table.put (sd.getMedia (), sd); title_table.put (sd.getTitle (), media_table); } else media_table.put (sd.getMedia (),sd); }
24959 /local/tlutelli/issta_data/temp/all_java2context/java/2006_temp/2006/24959/7afa788066f31cf90db79de016f817aa843a0339/StylesheetSet.java/buggy/source/org/jasig/portal/StylesheetSet.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 23990, 8229, 261, 24656, 3291, 8349, 13, 225, 288, 565, 368, 2621, 309, 326, 2077, 353, 1818, 316, 326, 711, 14544, 565, 18559, 3539, 67, 2121, 33, 261, 5582, 14544, 13, 2077, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 23990, 8229, 261, 24656, 3291, 8349, 13, 225, 288, 565, 368, 2621, 309, 326, 2077, 353, 1818, 316, 326, 711, 14544, 565, 18559, 3539, 67, 2121, 33, 261, 5582, 14544, 13, 2077, ...
ret.user1 = readLongReverse(in); ret.user2 = readLongReverse(in); ret.user3 = readShort(in); ret.user4 = readShort(in);
ret.user1 = Util.readLongReverse(in); ret.user2 = Util.readLongReverse(in); ret.user3 = Util.readShort(in); ret.user4 = Util.readShort(in);
private BlkStr readBLKSTR(InputStream in) throws IOException { MappyMapReader.BlkStr ret = new MappyMapReader.BlkStr(); long widthMod = (twidth*theight*2*256); ret.bg = readLongReverse(in)/widthMod; ret.fg0 = readLongReverse(in)/widthMod; ret.fg1 = readLongReverse(in)/widthMod; ret.fg2 = readLongReverse(in)/widthMod; ret.user1 = readLongReverse(in); ret.user2 = readLongReverse(in); ret.user3 = readShort(in); ret.user4 = readShort(in); ret.user5 = in.read(); ret.user6 = in.read(); ret.user7 = in.read(); ret.bits = in.read(); return ret; }
6621 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6621/2a2629efa6f1c21cdbc32f00ce9bbe8c91090b74/MappyMapReader.java/clean/tiled/plugins/mappy/MappyMapReader.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 8069, 79, 1585, 855, 14618, 47, 3902, 12, 4348, 316, 13, 1216, 1860, 288, 202, 202, 863, 2074, 863, 2514, 18, 4802, 79, 1585, 325, 273, 394, 1635, 2074, 863, 2514, 18, 4802, 79, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 8069, 79, 1585, 855, 14618, 47, 3902, 12, 4348, 316, 13, 1216, 1860, 288, 202, 202, 863, 2074, 863, 2514, 18, 4802, 79, 1585, 325, 273, 394, 1635, 2074, 863, 2514, 18, 4802, 79, ...
assertTrue( rs.getString( "FK_NAME" ).equals( "people" ) );
assertTrue( rs.getString( "FK_NAME" ).equals( "people_pkey" ) );
public void testForeignKeys() { try { Connection con1 = JDBC2Tests.openDB(); JDBC2Tests.createTable( con1, "people", "id int4 primary key, name text" ); JDBC2Tests.createTable( con1, "policy", "id int4 primary key, name text" ); JDBC2Tests.createTable( con1, "users", "id int4 primary key, people_id int4, policy_id int4,"+ "CONSTRAINT people FOREIGN KEY (people_id) references people(id),"+ "constraint policy FOREIGN KEY (policy_id) references policy(id)" ); DatabaseMetaData dbmd = con.getMetaData(); assertNotNull(dbmd); ResultSet rs = dbmd.getImportedKeys(null, "", "users" ); int j = 0; for (; rs.next(); j++ ) { String pkTableName = rs.getString( "PKTABLE_NAME" ); assertTrue ( pkTableName.equals("people") || pkTableName.equals("policy") ); String pkColumnName = rs.getString( "PKCOLUMN_NAME" ); assertTrue( pkColumnName.equals("id") ); String fkTableName = rs.getString( "FKTABLE_NAME" ); assertTrue( fkTableName.equals( "users" ) ); String fkColumnName = rs.getString( "FKCOLUMN_NAME" ); assertTrue( fkColumnName.equals( "people_id" ) || fkColumnName.equals( "policy_id" ) ) ; String fkName = rs.getString( "FK_NAME" ); assertTrue( fkName.equals( "people") || fkName.equals( "policy" ) ); String pkName = rs.getString( "PK_NAME" ); } assertTrue ( j== 2 ); rs = dbmd.getExportedKeys( null, "", "people" ); // this is hacky, but it will serve the purpose assertTrue ( rs.next() ); assertTrue( rs.getString( "PKTABLE_NAME" ).equals( "people" ) ); assertTrue( rs.getString( "PKCOLUMN_NAME" ).equals( "id" ) ); assertTrue( rs.getString( "FKTABLE_NAME" ).equals( "users" ) ); assertTrue( rs.getString( "FKCOLUMN_NAME" ).equals( "people_id" ) ); assertTrue( rs.getString( "FK_NAME" ).equals( "people" ) ); JDBC2Tests.dropTable( con1, "users" ); JDBC2Tests.dropTable( con1, "people" ); JDBC2Tests.dropTable( con1, "policy" ); } catch (SQLException ex) { fail(ex.getMessage()); } }
49504 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49504/520695701ca6ef6ad5e5a984a98f89b3ede31e3c/DatabaseMetaDataTest.java/buggy/src/interfaces/jdbc/org/postgresql/test/jdbc2/DatabaseMetaDataTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1842, 28285, 1435, 225, 288, 202, 202, 698, 202, 202, 95, 1082, 225, 4050, 356, 21, 273, 16364, 22, 14650, 18, 3190, 2290, 5621, 1082, 225, 16364, 22, 14650, 18, 2640, 1388, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1842, 28285, 1435, 225, 288, 202, 202, 698, 202, 202, 95, 1082, 225, 4050, 356, 21, 273, 16364, 22, 14650, 18, 3190, 2290, 5621, 1082, 225, 16364, 22, 14650, 18, 2640, 1388, ...
{
{
public void statement() throws RecognitionException { try { // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:336:17: ( compoundStatement | declaration SEMI | expression SEMI | modifiers classDefinition | IDENT COLON statement | 'if' LPAREN expression RPAREN statement ( 'else' statement )? | 'for' LPAREN forInit SEMI forCond SEMI forIter RPAREN statement | 'while' LPAREN expression RPAREN statement | 'do' statement 'while' LPAREN expression RPAREN SEMI | 'break' ( IDENT )? SEMI | 'continue' ( IDENT )? SEMI | 'return' ( expression )? SEMI | 'switch' LPAREN expression RPAREN LCURLY ( casesGroup )* RCURLY | tryBlock | 'throw' expression SEMI | 'synchronized' LPAREN expression RPAREN compoundStatement | SEMI ) int alt41=17; alt41 = dfa41.predict(input); switch (alt41) { case 1 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:336:17: compoundStatement { following.push(FOLLOW_compoundStatement_in_statement1216); compoundStatement(); following.pop(); } break; case 2 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:343:17: declaration SEMI { following.push(FOLLOW_declaration_in_statement1232); declaration(); following.pop(); match(input,SEMI,FOLLOW_SEMI_in_statement1234); } break; case 3 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:348:17: expression SEMI { following.push(FOLLOW_expression_in_statement1246); expression(); following.pop(); match(input,SEMI,FOLLOW_SEMI_in_statement1248); } break; case 4 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:351:17: modifiers classDefinition { following.push(FOLLOW_modifiers_in_statement1256); modifiers(); following.pop(); following.push(FOLLOW_classDefinition_in_statement1258); classDefinition(); following.pop(); } break; case 5 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:354:17: IDENT COLON statement { match(input,IDENT,FOLLOW_IDENT_in_statement1266); match(input,COLON,FOLLOW_COLON_in_statement1268); following.push(FOLLOW_statement_in_statement1271); statement(); following.pop(); } break; case 6 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:357:17: 'if' LPAREN expression RPAREN statement ( 'else' statement )? { match(input,96,FOLLOW_96_in_statement1279); match(input,LPAREN,FOLLOW_LPAREN_in_statement1281); following.push(FOLLOW_expression_in_statement1283); expression(); following.pop(); match(input,RPAREN,FOLLOW_RPAREN_in_statement1285); following.push(FOLLOW_statement_in_statement1287); statement(); following.pop(); // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:358:17: ( 'else' statement )? int alt36=2; int LA36_0 = input.LA(1); if ( LA36_0==97 ) { alt36=1; } else if ( LA36_0==IDENT||(LA36_0>=LCURLY && LA36_0<=RCURLY)||LA36_0==LPAREN||(LA36_0>=PLUS && LA36_0<=MINUS)||(LA36_0>=INC && LA36_0<=NUM_FLOAT)||(LA36_0>=68 && LA36_0<=89)||(LA36_0>=93 && LA36_0<=94)||LA36_0==96||(LA36_0>=98 && LA36_0<=108)||(LA36_0>=112 && LA36_0<=115) ) { alt36=2; } else { NoViableAltException nvae = new NoViableAltException("358:17: ( \'else\' statement )?", 36, 0, input); throw nvae; } switch (alt36) { case 1 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:362:25: 'else' statement { match(input,97,FOLLOW_97_in_statement1308); following.push(FOLLOW_statement_in_statement1310); statement(); following.pop(); } break; } } break; case 7 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:366:17: 'for' LPAREN forInit SEMI forCond SEMI forIter RPAREN statement { match(input,98,FOLLOW_98_in_statement1323); match(input,LPAREN,FOLLOW_LPAREN_in_statement1328); following.push(FOLLOW_forInit_in_statement1334); forInit(); following.pop(); match(input,SEMI,FOLLOW_SEMI_in_statement1336); following.push(FOLLOW_forCond_in_statement1345); forCond(); following.pop(); match(input,SEMI,FOLLOW_SEMI_in_statement1347); following.push(FOLLOW_forIter_in_statement1356); forIter(); following.pop(); match(input,RPAREN,FOLLOW_RPAREN_in_statement1370); following.push(FOLLOW_statement_in_statement1375); statement(); following.pop(); } break; case 8 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:375:17: 'while' LPAREN expression RPAREN statement { match(input,99,FOLLOW_99_in_statement1404); match(input,LPAREN,FOLLOW_LPAREN_in_statement1406); following.push(FOLLOW_expression_in_statement1408); expression(); following.pop(); match(input,RPAREN,FOLLOW_RPAREN_in_statement1410); following.push(FOLLOW_statement_in_statement1412); statement(); following.pop(); } break; case 9 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:378:17: 'do' statement 'while' LPAREN expression RPAREN SEMI { match(input,100,FOLLOW_100_in_statement1420); following.push(FOLLOW_statement_in_statement1422); statement(); following.pop(); match(input,99,FOLLOW_99_in_statement1424); match(input,LPAREN,FOLLOW_LPAREN_in_statement1426); following.push(FOLLOW_expression_in_statement1428); expression(); following.pop(); match(input,RPAREN,FOLLOW_RPAREN_in_statement1430); match(input,SEMI,FOLLOW_SEMI_in_statement1432); } break; case 10 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:381:17: 'break' ( IDENT )? SEMI { match(input,101,FOLLOW_101_in_statement1440); // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:381:25: ( IDENT )? int alt37=2; int LA37_0 = input.LA(1); if ( LA37_0==IDENT ) { alt37=1; } else if ( LA37_0==SEMI ) { alt37=2; } else { NoViableAltException nvae = new NoViableAltException("381:25: ( IDENT )?", 37, 0, input); throw nvae; } switch (alt37) { case 1 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:381:26: IDENT { match(input,IDENT,FOLLOW_IDENT_in_statement1443); } break; } match(input,SEMI,FOLLOW_SEMI_in_statement1447); } break; case 11 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:384:17: 'continue' ( IDENT )? SEMI { match(input,102,FOLLOW_102_in_statement1455); // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:384:28: ( IDENT )? int alt38=2; int LA38_0 = input.LA(1); if ( LA38_0==IDENT ) { alt38=1; } else if ( LA38_0==SEMI ) { alt38=2; } else { NoViableAltException nvae = new NoViableAltException("384:28: ( IDENT )?", 38, 0, input); throw nvae; } switch (alt38) { case 1 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:384:29: IDENT { match(input,IDENT,FOLLOW_IDENT_in_statement1458); } break; } match(input,SEMI,FOLLOW_SEMI_in_statement1462); } break; case 12 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:387:17: 'return' ( expression )? SEMI { match(input,103,FOLLOW_103_in_statement1470); // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:387:26: ( expression )? int alt39=2; int LA39_0 = input.LA(1); if ( LA39_0==IDENT||LA39_0==LPAREN||(LA39_0>=PLUS && LA39_0<=MINUS)||(LA39_0>=INC && LA39_0<=NUM_FLOAT)||(LA39_0>=68 && LA39_0<=76)||(LA39_0>=93 && LA39_0<=94)||(LA39_0>=112 && LA39_0<=115) ) { alt39=1; } else if ( LA39_0==SEMI ) { alt39=2; } else { NoViableAltException nvae = new NoViableAltException("387:26: ( expression )?", 39, 0, input); throw nvae; } switch (alt39) { case 1 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:387:27: expression { following.push(FOLLOW_expression_in_statement1473); expression(); following.pop(); } break; } match(input,SEMI,FOLLOW_SEMI_in_statement1477); } break; case 13 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:390:17: 'switch' LPAREN expression RPAREN LCURLY ( casesGroup )* RCURLY { match(input,104,FOLLOW_104_in_statement1485); match(input,LPAREN,FOLLOW_LPAREN_in_statement1487); following.push(FOLLOW_expression_in_statement1489); expression(); following.pop(); match(input,RPAREN,FOLLOW_RPAREN_in_statement1491); match(input,LCURLY,FOLLOW_LCURLY_in_statement1493); // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:391:25: ( casesGroup )* loop40: do { int alt40=2; int LA40_0 = input.LA(1); if ( (LA40_0>=106 && LA40_0<=107) ) { alt40=1; } switch (alt40) { case 1 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:391:27: casesGroup { following.push(FOLLOW_casesGroup_in_statement1500); casesGroup(); following.pop(); } break; default : break loop40; } } while (true); match(input,RCURLY,FOLLOW_RCURLY_in_statement1507); } break; case 14 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:395:17: tryBlock { following.push(FOLLOW_tryBlock_in_statement1515); tryBlock(); following.pop(); } break; case 15 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:398:17: 'throw' expression SEMI { match(input,105,FOLLOW_105_in_statement1523); following.push(FOLLOW_expression_in_statement1525); expression(); following.pop(); match(input,SEMI,FOLLOW_SEMI_in_statement1527); } break; case 16 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:401:17: 'synchronized' LPAREN expression RPAREN compoundStatement { match(input,86,FOLLOW_86_in_statement1535); match(input,LPAREN,FOLLOW_LPAREN_in_statement1537); following.push(FOLLOW_expression_in_statement1539); expression(); following.pop(); match(input,RPAREN,FOLLOW_RPAREN_in_statement1541); following.push(FOLLOW_compoundStatement_in_statement1543); compoundStatement(); following.pop(); } break; case 17 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/semantics/java/parser/java.g:407:17: SEMI { match(input,SEMI,FOLLOW_SEMI_in_statement1556); } break; } } catch (RecognitionException re) { reportError(re); recover(input,re); } finally { } }
6736 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6736/7e425814ce563fcc662b266adb2a4dc8e1a95d19/JavaParser.java/clean/drools-compiler/src/main/java/org/drools/semantics/java/parser/JavaParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 3021, 1435, 1216, 9539, 288, 1850, 775, 288, 6647, 368, 342, 6588, 19, 70, 947, 19, 12922, 19, 14915, 19, 10649, 8464, 7482, 19, 12215, 17, 9576, 19, 4816, 19, 5254, 19, 6290...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 3021, 1435, 1216, 9539, 288, 1850, 775, 288, 6647, 368, 342, 6588, 19, 70, 947, 19, 12922, 19, 14915, 19, 10649, 8464, 7482, 19, 12215, 17, 9576, 19, 4816, 19, 5254, 19, 6290...
typeId = typeId(false);
typeId = typeId(true, false);
protected IASTExpression unaryExpression() throws EndOfFileException, BacktrackException { IToken la = LA(1); int startingOffset = la.getOffset(); switch (LT(1)) { case IToken.tSTAR: return unaryOperatorCastExpression(IASTUnaryExpression.op_star);//IASTExpression.Kind.UNARY_STAR_CASTEXPRESSION); case IToken.tAMPER: return unaryOperatorCastExpression(IASTUnaryExpression.op_amper);//IASTExpression.Kind.UNARY_AMPSND_CASTEXPRESSION); case IToken.tPLUS: return unaryOperatorCastExpression(IASTUnaryExpression.op_plus);//IASTExpression.Kind.UNARY_PLUS_CASTEXPRESSION); case IToken.tMINUS: return unaryOperatorCastExpression(IASTUnaryExpression.op_minus);//IASTExpression.Kind.UNARY_MINUS_CASTEXPRESSION); case IToken.tNOT: return unaryOperatorCastExpression(IASTUnaryExpression.op_not);//IASTExpression.Kind.UNARY_NOT_CASTEXPRESSION); case IToken.tCOMPL: return unaryOperatorCastExpression(IASTUnaryExpression.op_tilde);//IASTExpression.Kind.UNARY_TILDE_CASTEXPRESSION); case IToken.tINCR: return unaryOperatorCastExpression(IASTUnaryExpression.op_prefixIncr);//IASTExpression.Kind.UNARY_INCREMENT); case IToken.tDECR: return unaryOperatorCastExpression(IASTUnaryExpression.op_prefixDecr);//IASTExpression.Kind.UNARY_DECREMENT); case IToken.t_sizeof: consume(IToken.t_sizeof); IToken mark = LA(1); IASTTypeId typeId = null; int lastOffset = 0; IASTExpression unaryExpression = null; if (LT(1) == IToken.tLPAREN) { try { consume(IToken.tLPAREN); typeId = typeId(false); lastOffset = consume(IToken.tRPAREN).getEndOffset(); } catch (BacktrackException bt) { backup(mark); unaryExpression = unaryExpression(); lastOffset = calculateEndOffset(unaryExpression); } } else { unaryExpression = unaryExpression(); lastOffset = calculateEndOffset(unaryExpression); } if (typeId == null && unaryExpression != null) return buildUnaryExpression(IASTUnaryExpression.op_sizeof, unaryExpression, startingOffset, lastOffset); return buildTypeIdExpression(IASTTypeIdExpression.op_sizeof, typeId, startingOffset, lastOffset); case IToken.t_new: return newExpression(); case IToken.t_delete: return deleteExpression(); case IToken.tCOLONCOLON: switch (LT(2)) { case IToken.t_new: return newExpression(); case IToken.t_delete: return deleteExpression(); default: return postfixExpression(); } default: if (LT(1) == IGCCToken.t_typeof && supportTypeOfUnaries) { IASTExpression unary = unaryTypeofExpression(); if (unary != null) return unary; } if (LT(1) == IGCCToken.t___alignof__ && supportAlignOfUnaries) { IASTExpression align = unaryAlignofExpression(); if (align != null) return align; } return postfixExpression(); } }
54911 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54911/66c2e911bf7827e6a48d6cc7b5a30d02a947ac62/GNUCPPSourceParser.java/buggy/core/org.eclipse.cdt.core/parser/org/eclipse/cdt/internal/core/dom/parser/cpp/GNUCPPSourceParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 4750, 467, 9053, 2300, 19017, 2300, 1435, 1216, 4403, 951, 812, 503, 16, 540, 4297, 4101, 503, 288, 1377, 467, 1345, 7125, 273, 2928, 12, 21, 1769, 1377, 509, 5023, 2335, 273, 7125, 18, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 4750, 467, 9053, 2300, 19017, 2300, 1435, 1216, 4403, 951, 812, 503, 16, 540, 4297, 4101, 503, 288, 1377, 467, 1345, 7125, 273, 2928, 12, 21, 1769, 1377, 509, 5023, 2335, 273, 7125, 18, ...
switch ( eDerivedStructuralFeatureID( eFeature ) )
switch ( featureID )
public Object eGet( EStructuralFeature eFeature, boolean resolve ) { switch ( eDerivedStructuralFeatureID( eFeature ) ) { case DataPackage.DATA_SET__VALUES : return getValues( ); } return eDynamicGet( eFeature, resolve ); }
5230 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5230/036e8c78765730b146e5854b9d6c397a296fed86/DataSetImpl.java/buggy/chart/org.eclipse.birt.chart.engine/src/org/eclipse/birt/chart/model/data/impl/DataSetImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1033, 15952, 12, 512, 14372, 4595, 425, 4595, 16, 1250, 2245, 262, 202, 95, 202, 202, 9610, 261, 425, 21007, 14372, 4595, 734, 12, 425, 4595, 262, 262, 202, 202, 95, 1082, 202...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1033, 15952, 12, 512, 14372, 4595, 425, 4595, 16, 1250, 2245, 262, 202, 95, 202, 202, 9610, 261, 425, 21007, 14372, 4595, 734, 12, 425, 4595, 262, 262, 202, 202, 95, 1082, 202...
boolean synPredMatched268 = false;
boolean synPredMatched1412 = false;
public final void mMODULE_NAME(boolean _createToken) throws RecognitionException, CharStreamException, TokenStreamException { int _ttype; Token _token=null; int _begin=text.length(); _ttype = MODULE_NAME; int _saveIndex; boolean synPredMatched262 = false; if (((LA(1)=='A') && (LA(2)=='R') && (LA(3)=='R'))) { int _m262 = mark(); synPredMatched262 = true; inputState.guessing++; try { { match("ARRAY"); } } catch (RecognitionException pe) { synPredMatched262 = false; } rewind(_m262); inputState.guessing--; } if ( synPredMatched262 ) { match("ARRAY"); if ( inputState.guessing==0 ) { _ttype = ARRAY_REF; } } else { boolean synPredMatched264 = false; if (((LA(1)=='S') && (LA(2)=='C') && (LA(3)=='A'))) { int _m264 = mark(); synPredMatched264 = true; inputState.guessing++; try { { match("SCALAR"); } } catch (RecognitionException pe) { synPredMatched264 = false; } rewind(_m264); inputState.guessing--; } if ( synPredMatched264 ) { match("SCALAR"); if ( inputState.guessing==0 ) { _ttype = SCALAR_REF; } } else { boolean synPredMatched266 = false; if (((LA(1)=='H') && (LA(2)=='A') && (LA(3)=='S'))) { int _m266 = mark(); synPredMatched266 = true; inputState.guessing++; try { { match("HASH"); } } catch (RecognitionException pe) { synPredMatched266 = false; } rewind(_m266); inputState.guessing--; } if ( synPredMatched266 ) { match("HASH"); if ( inputState.guessing==0 ) { _ttype = HASH_REF; } } else { boolean synPredMatched268 = false; if (((LA(1)=='C') && (LA(2)=='O') && (LA(3)=='D'))) { int _m268 = mark(); synPredMatched268 = true; inputState.guessing++; try { { match("CODE"); } } catch (RecognitionException pe) { synPredMatched268 = false; } rewind(_m268); inputState.guessing--; } if ( synPredMatched268 ) { match("CODE"); if ( inputState.guessing==0 ) { _ttype = CODE_REF; } } else { boolean synPredMatched270 = false; if (((LA(1)=='R') && (LA(2)=='E') && (LA(3)=='F'))) { int _m270 = mark(); synPredMatched270 = true; inputState.guessing++; try { { match("REF"); } } catch (RecognitionException pe) { synPredMatched270 = false; } rewind(_m270); inputState.guessing--; } if ( synPredMatched270 ) { match("REF"); if ( inputState.guessing==0 ) { _ttype = REF; } } else { boolean synPredMatched272 = false; if (((LA(1)=='F') && (LA(2)=='i') && (LA(3)=='l'))) { int _m272 = mark(); synPredMatched272 = true; inputState.guessing++; try { { match("FileHandle"); } } catch (RecognitionException pe) { synPredMatched272 = false; } rewind(_m272); inputState.guessing--; } if ( synPredMatched272 ) { match("FileHandle"); if ( inputState.guessing==0 ) { _ttype = FILE_HANDLE; } } else { boolean synPredMatched274 = false; if (((LA(1)=='f') && (LA(2)=='i') && (LA(3)=='l'))) { int _m274 = mark(); synPredMatched274 = true; inputState.guessing++; try { { match("fileno("); } } catch (RecognitionException pe) { synPredMatched274 = false; } rewind(_m274); inputState.guessing--; } if ( synPredMatched274 ) { { match("fileno("); } { int _cnt277=0; _loop277: do { if (((LA(1) >= '0' && LA(1) <= '9'))) { matchRange('0','9'); } else { if ( _cnt277>=1 ) { break _loop277; } else {throw new NoViableAltForCharException((char)LA(1), getFilename(), getLine(), getColumn());} } _cnt277++; } while (true); } match(')'); if ( inputState.guessing==0 ) { _ttype = FILE_NO; } } else if ((_tokenSet_0.member(LA(1))) && (true) && (true)) { mPURE_NAME(false); if ( inputState.guessing==0 ) { _ttype = PURE_NAME; } } else { throw new NoViableAltForCharException((char)LA(1), getFilename(), getLine(), getColumn()); } }}}}}} if ( _createToken && _token==null && _ttype!=Token.SKIP ) { _token = makeToken(_ttype); _token.setText(new String(text.getBuffer(), _begin, text.length()-_begin)); } _returnToken = _token; }
48756 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/48756/65f2e2fb853a3460fe003d22b8dc91c2cf3a1472/PerlBaseLexer.java/buggy/org.epic.debug/src/org/epic/debug/varparser/PerlBaseLexer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 312, 12194, 67, 1985, 12, 6494, 389, 2640, 1345, 13, 1216, 9539, 16, 3703, 1228, 503, 16, 3155, 1228, 503, 288, 202, 202, 474, 389, 88, 723, 31, 3155, 389, 2316, 3...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 312, 12194, 67, 1985, 12, 6494, 389, 2640, 1345, 13, 1216, 9539, 16, 3703, 1228, 503, 16, 3155, 1228, 503, 288, 202, 202, 474, 389, 88, 723, 31, 3155, 389, 2316, 3...
new Label( group, SWT.NONE ).setText( Messages.getString( "FormatStringPreferencePage.previewLabel.label" ) );
new Label( group, SWT.NONE ).setText( LABEL_PREVIEW_LABEL );
private Composite getCustomPage( Composite parent ) { if ( customPage == null ) { customPage = new Composite( parent, SWT.NULL ); customPage.setLayout( new GridLayout( 1, false ) ); Group group = new Group( customPage, SWT.NONE ); group.setText( Messages.getString( "FormatStringPreferencePage.customSetting.groupLabel" ) ); //$NON-NLS-1$ GridData data = new GridData( GridData.FILL_HORIZONTAL ); group.setLayoutData( data ); group.setLayout( new GridLayout( 2, false ) ); Label label = new Label( group, SWT.NONE ); label.setText( Messages.getString( "FormatStringPreferencePage.exampleFormats.label" ) ); //$NON-NLS-1$ data = new GridData( ); data.horizontalSpan = 2; label.setLayoutData( data ); label = new Label( group, SWT.NONE ); label.setText( Messages.getString( "FormatStringPreferencePage.exampleFormats.label2" ) ); //$NON-NLS-1$ data = new GridData( ); data.horizontalSpan = 2; label.setLayoutData( data ); createTable( group ); Composite container = new Composite( customPage, SWT.NONE ); data = new GridData( GridData.FILL_HORIZONTAL ); container.setLayoutData( data ); container.setLayout( new GridLayout( 2, false ) ); new Label( container, SWT.NULL ).setText( Messages.getString( "FormatStringPreferencePage.formatCode.label" ) ); //$NON-NLS-1$ formatCode = new Text( container, SWT.SINGLE | SWT.BORDER ); formatCode.setLayoutData( new GridData( GridData.FILL_HORIZONTAL ) ); formatCode.addModifyListener( new ModifyListener( ) { public void modifyText( ModifyEvent e ) { if ( hasLoaded ) { updatePreview( ); } } } ); group = new Group( customPage, SWT.NONE ); group.setText( Messages.getString( "FormatStringPreferencePage.customPreview.groupLabel" ) ); //$NON-NLS-1$ data = new GridData( GridData.FILL_HORIZONTAL ); group.setLayoutData( data ); group.setLayout( new GridLayout( 2, false ) ); new Label( group, SWT.NONE ).setText( Messages.getString( "FormatStringPreferencePage.previewText.label" ) ); //$NON-NLS-1$ previewTextBox = new Text( group, SWT.SINGLE | SWT.BORDER ); previewTextBox.setText( DEFAULT_PREVIEW_TEXT ); previewTextBox.setLayoutData( new GridData( GridData.FILL_HORIZONTAL ) ); previewTextBox.addModifyListener( new ModifyListener( ) { public void modifyText( ModifyEvent e ) { if ( hasLoaded ) { setPreviewText( previewTextBox.getText( ) ); } } } ); new Label( group, SWT.NONE ).setText( Messages.getString( "FormatStringPreferencePage.previewLabel.label" ) ); //$NON-NLS-1$ cPreviewLabel = new Label( group, SWT.NONE ); cPreviewLabel.setText( Messages.getString( "FormatStringPreferencePage.previewLabel.text" ) ); //$NON-NLS-1$ cPreviewLabel.setLayoutData( new GridData( GridData.FILL_HORIZONTAL ) ); Composite helpBar = new Composite( customPage, SWT.NONE ); data = new GridData( GridData.FILL_HORIZONTAL ); helpBar.setLayoutData( data ); helpBar.setLayout( new GridLayout( 2, false ) ); new Label( helpBar, SWT.NONE ).setText( Messages.getString( "FormatStringPreferencePage.helpLabel.label" ) ); //$NON-NLS-1$ Button help = new Button( helpBar, SWT.PUSH ); help.setText( Messages.getString( "FormatStringPreferencePage.helpButton.label" ) ); //$NON-NLS-1$ help.setLayoutData( new GridData( GridData.HORIZONTAL_ALIGN_END | GridData.GRAB_HORIZONTAL ) ); } return customPage; }
15160 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/15160/ed52f1732ec1c1eef0fd79e44d2e45f78973153a/FormatStringPage.java/buggy/UI/org.eclipse.birt.report.designer.ui/src/org/eclipse/birt/report/designer/internal/ui/dialogs/FormatStringPage.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 14728, 12736, 1964, 12, 14728, 982, 262, 202, 95, 202, 202, 430, 261, 1679, 1964, 422, 446, 262, 202, 202, 95, 1082, 202, 3662, 1964, 273, 394, 14728, 12, 982, 16, 348, 8588,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 14728, 12736, 1964, 12, 14728, 982, 262, 202, 95, 202, 202, 430, 261, 1679, 1964, 422, 446, 262, 202, 202, 95, 1082, 202, 3662, 1964, 273, 394, 14728, 12, 982, 16, 348, 8588,...
Object buf = impl.getOption(SocketOptions.SO_RCVBUF);
Object buf = getImpl().getOption(SocketOptions.SO_RCVBUF);
public int getReceiveBufferSize() throws SocketException { if (impl == null) throw new SocketException("Not connected"); Object buf = impl.getOption(SocketOptions.SO_RCVBUF); if (buf instanceof Integer) return (((Integer)buf).intValue()); else throw new SocketException("Internal Error: Unexpected type"); }
1056 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1056/426834aeca94b6762986d5f7b6cd54b12b69b2b8/Socket.java/buggy/core/src/classpath/java/java/net/Socket.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 509, 336, 11323, 15384, 1435, 1216, 8758, 503, 288, 202, 202, 430, 261, 11299, 422, 446, 13, 1082, 202, 12849, 394, 8758, 503, 2932, 1248, 5840, 8863, 202, 202, 921, 1681, 273, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 509, 336, 11323, 15384, 1435, 1216, 8758, 503, 288, 202, 202, 430, 261, 11299, 422, 446, 13, 1082, 202, 12849, 394, 8758, 503, 2932, 1248, 5840, 8863, 202, 202, 921, 1681, 273, ...
Driver.debug("supportsPositionedUpdate false");
if (Driver.logDebug) Driver.debug("supportsPositionedUpdate false");
public boolean supportsPositionedUpdate() throws SQLException { Driver.debug("supportsPositionedUpdate false"); return false; // For now... }
47293 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47293/b465f5307f9f5506beb1edbcc0fb56eed7c29c12/DatabaseMetaData.java/clean/src/interfaces/jdbc/org/postgresql/jdbc2/DatabaseMetaData.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1250, 6146, 2555, 329, 1891, 1435, 1216, 6483, 202, 95, 202, 202, 4668, 18, 4148, 2932, 28064, 2555, 329, 1891, 629, 8863, 202, 202, 2463, 629, 31, 1082, 202, 759, 2457, 2037, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1250, 6146, 2555, 329, 1891, 1435, 1216, 6483, 202, 95, 202, 202, 4668, 18, 4148, 2932, 28064, 2555, 329, 1891, 629, 8863, 202, 202, 2463, 629, 31, 1082, 202, 759, 2457, 2037, ...
secondEMA = new double[firstEMANbElement.value]; retCode = INT_EMA(0, firstEMANbElement.value - 1, firstEMA, optInTimePeriod, k, secondEMABegIdx, secondEMANbElement, secondEMA); if ((retCode != TA_RetCode.TA_SUCCESS) || (secondEMANbElement.value == 0)) {
if( startIdx < 0 ) return TA_RetCode. TA_OUT_OF_RANGE_START_INDEX; if( (endIdx < 0) || (endIdx < startIdx)) return TA_RetCode. TA_OUT_OF_RANGE_END_INDEX; if( (int)optInTimePeriod == ( Integer.MIN_VALUE ) ) optInTimePeriod = 30; else if( ((int)optInTimePeriod < 2) || ((int)optInTimePeriod > 100000) ) return TA_RetCode. TA_BAD_PARAM; outNbElement.value = 0 ; outBegIdx.value = 0 ;
public TA_RetCode DEMA(int startIdx, int endIdx, double inReal[], int optInTimePeriod, MInteger outBegIdx, MInteger outNbElement, double outReal[]) { double[] firstEMA; double[] secondEMA; double k; MInteger firstEMABegIdx = new MInteger(); MInteger firstEMANbElement = new MInteger(); MInteger secondEMABegIdx = new MInteger(); MInteger secondEMANbElement = new MInteger(); int tempInt, outIdx, firstEMAIdx, lookbackTotal, lookbackEMA; TA_RetCode retCode; if (startIdx < 0) return TA_RetCode.TA_OUT_OF_RANGE_START_INDEX; if ((endIdx < 0) || (endIdx < startIdx)) return TA_RetCode.TA_OUT_OF_RANGE_END_INDEX; if ((int) optInTimePeriod == (Integer.MIN_VALUE )) optInTimePeriod = 30; else if (((int) optInTimePeriod < 2) || ((int) optInTimePeriod > 100000)) return TA_RetCode.TA_BAD_PARAM; outNbElement.value = 0; outBegIdx.value = 0; lookbackEMA = EMA_Lookback(optInTimePeriod); lookbackTotal = lookbackEMA * 2; if (startIdx < lookbackTotal) startIdx = lookbackTotal; if (startIdx > endIdx) return TA_RetCode.TA_SUCCESS; if (inReal == outReal) firstEMA = outReal; else { tempInt = lookbackTotal + (endIdx - startIdx) + 1; firstEMA = new double[tempInt]; } k = ((double) 2.0 / ((double) (optInTimePeriod + 1))); retCode = INT_EMA(startIdx - lookbackEMA, endIdx, inReal, optInTimePeriod, k, firstEMABegIdx, firstEMANbElement, firstEMA); if ((retCode != TA_RetCode.TA_SUCCESS) || (firstEMANbElement.value == 0)) { ; return retCode; } secondEMA = new double[firstEMANbElement.value]; retCode = INT_EMA(0, firstEMANbElement.value - 1, firstEMA, optInTimePeriod, k, secondEMABegIdx, secondEMANbElement, secondEMA); if ((retCode != TA_RetCode.TA_SUCCESS) || (secondEMANbElement.value == 0)) { ; ; return retCode; } firstEMAIdx = secondEMABegIdx.value; outIdx = 0; while (outIdx < secondEMANbElement.value) { outReal[outIdx] = (2.0 * firstEMA[firstEMAIdx++]) - secondEMA[outIdx]; outIdx++; } ; ; outBegIdx.value = firstEMABegIdx.value + secondEMABegIdx.value; outNbElement.value = outIdx; return TA_RetCode.TA_SUCCESS; }
51465 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51465/cf65b93eedaca922be2993fe424b023f73c7562d/Core.java/buggy/trunk/ta-lib/java/src/TA/Lib/Core.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 399, 37, 67, 7055, 1085, 2030, 5535, 12, 474, 27108, 16, 509, 679, 4223, 16, 1645, 316, 6955, 63, 6487, 1082, 202, 474, 2153, 382, 26540, 16, 490, 4522, 596, 24059, 4223, 16, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 399, 37, 67, 7055, 1085, 2030, 5535, 12, 474, 27108, 16, 509, 679, 4223, 16, 1645, 316, 6955, 63, 6487, 1082, 202, 474, 2153, 382, 26540, 16, 490, 4522, 596, 24059, 4223, 16, ...
for (Node child = firstChild; child != null; child = child.getNextSibling()) { ((NodeImpl) child).setOwnerDocument(doc);
for (ChildNode child = firstChild; child != null; child = child.nextSibling) { child.setOwnerDocument(doc);
void setOwnerDocument(DocumentImpl doc) { if (needsSyncChildren()) { synchronizeChildren(); } for (Node child = firstChild; child != null; child = child.getNextSibling()) { ((NodeImpl) child).setOwnerDocument(doc); } ownerDocument = doc; }
1831 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1831/6e6a701cb6df587efecaea26f28b7fcf71e50f5c/ParentNode.java/buggy/src/org/apache/xerces/dom/ParentNode.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 31309, 2519, 12, 2519, 2828, 997, 13, 288, 3639, 309, 261, 20600, 4047, 4212, 10756, 288, 5411, 16978, 4212, 5621, 3639, 289, 202, 1884, 261, 907, 1151, 273, 15070, 31, 202, 377, 115...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 31309, 2519, 12, 2519, 2828, 997, 13, 288, 3639, 309, 261, 20600, 4047, 4212, 10756, 288, 5411, 16978, 4212, 5621, 3639, 289, 202, 1884, 261, 907, 1151, 273, 15070, 31, 202, 377, 115...
for (Node node : target.nodes()) {
for (Node node : target) {
private PropertyList resolveReferences(PropertyList target, int depth) throws CdlException { if (depth > Constants.RESOLUTION_DEPTH_LIMIT) { throw new CdlResolutionException(ReferencePath.ERROR_RECURSIVE_RESOLUTION + target.getDescription()); } ResolveEnum state = target.getResolveState(); if (state == ResolveEnum.ResolvedComplete || state == ResolveEnum.ResolvedLazyLinksRemaining) { return target; } boolean shouldResolve = target.isValueReference(); PropertyList result = target; if (shouldResolve) { //its a reference, process it result = resolveReferenceNode(target); } else { if (state == ResolveEnum.ResolvedIncomplete) { //there is something under here that needs resolving //resolve child references for (Node node : target.nodes()) { if (node instanceof PropertyList) { //cast it PropertyList template = (PropertyList) node; PropertyList newTemplate = resolveReferences(template, 0); if (template != newTemplate) { target.replaceChild(template, newTemplate); //then resolve it again, to get the children picked up } } } } } return result; }
4987 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4987/9dd7cac3fcf8b6a445f0f8c0368db293acfc3fef/EarlyReferenceProcessor.java/buggy/core/extras/cdl/src/org/smartfrog/sfcore/languages/cdl/references/EarlyReferenceProcessor.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 4276, 682, 2245, 8221, 12, 1396, 682, 1018, 16, 509, 3598, 13, 1216, 385, 5761, 503, 288, 3639, 309, 261, 5979, 405, 5245, 18, 17978, 13269, 67, 27479, 67, 8283, 13, 288, 5411, 60...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 4276, 682, 2245, 8221, 12, 1396, 682, 1018, 16, 509, 3598, 13, 1216, 385, 5761, 503, 288, 3639, 309, 261, 5979, 405, 5245, 18, 17978, 13269, 67, 27479, 67, 8283, 13, 288, 5411, 60...
String projectName = model.getStringProperty(IJavaUtilityJarImportDataModelProperties.PROJECT_NAME);
String projectName = model.getStringProperty(IJ2EEComponentImportDataModelProperties.PROJECT_NAME);
public IStatus execute(IProgressMonitor monitor, IAdaptable info) throws ExecutionException { IDataModel utilityCreationDataModel = DataModelFactory.createDataModel(new UtilityProjectCreationDataModelProvider()); String projectName = model.getStringProperty(IJavaUtilityJarImportDataModelProperties.PROJECT_NAME); utilityCreationDataModel.setStringProperty(IFacetProjectCreationDataModelProperties.FACET_PROJECT_NAME, projectName); utilityCreationDataModel.setProperty(IFacetProjectCreationDataModelProperties.FACET_RUNTIME, RuntimeManager.getRuntime(model.getStringProperty(IJavaComponentCreationDataModelProperties.RUNTIME_TARGET_ID))); FacetDataModelMap map = (FacetDataModelMap)utilityCreationDataModel.getProperty(IFacetProjectCreationDataModelProperties.FACET_DM_MAP); map.getFacetDataModel(J2EEProjectUtilities.UTILITY).setBooleanProperty(IJ2EEModuleFacetInstallDataModelProperties.ADD_TO_EAR, false); utilityCreationDataModel.getDefaultOperation().execute(monitor, info); IProject javaProject = ProjectUtilities.getProject(projectName); IVirtualComponent component = ComponentCore.createComponent(javaProject); Archive jarFile = (Archive) model.getProperty(IJavaUtilityJarImportDataModelProperties.FILE); J2EEJavaComponentSaveStrategyImpl strat = new J2EEJavaComponentSaveStrategyImpl(component); strat.setProgressMonitor(new SubProgressMonitor(monitor, 1)); try { jarFile.save(strat); // To fix the defect that throws dup classpath exception. // Because JemProjectUtilities.appendJavaClassPath() does not check dups, we have to // check it here. // check if JRE_CONTAINER is in the classpath. if not add it IJavaProject javaProj = JemProjectUtilities.getJavaProject(javaProject); IClasspathEntry[] classpath = javaProj.getRawClasspath(); String jrePathName = "org.eclipse.jdt.launching.JRE_CONTAINER"; //$NON-NLS-1$ boolean exists = false; for (int i = 0; i < classpath.length; i++) { if (classpath[i].getEntryKind() != IClasspathEntry.CPE_CONTAINER) continue; IPath path = classpath[i].getPath(); if (path.segmentCount() > 0) { String name = path.segment(0).toString(); if (jrePathName.equals(name)) { exists = true; break; } } } if (!exists) { /** * Warning clean-up 12/05/2005 */ //IClasspathEntry newEntry = JavaCore.newContainerEntry(new Path(jrePathName)); JemProjectUtilities.appendJavaClassPath(javaProject, JavaCore.newContainerEntry(new Path("org.eclipse.jdt.launching.JRE_CONTAINER"))); //$NON-NLS-1$) JemProjectUtilities.forceClasspathReload(javaProject); } } catch (SaveFailureException e) { Logger.getLogger().logError(e); } catch (JavaModelException je) { Logger.getLogger().logError(je); } return OK_STATUS; }
8196 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8196/85c5c4f0b67b034b72057057eedab61d8e70ec4c/J2EEUtilityJarImportOperationNew.java/buggy/plugins/org.eclipse.jst.j2ee/earproject/org/eclipse/jst/j2ee/application/internal/operations/J2EEUtilityJarImportOperationNew.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 467, 1482, 1836, 12, 45, 5491, 7187, 6438, 16, 467, 13716, 429, 1123, 13, 1216, 20205, 288, 202, 202, 734, 396, 1488, 12788, 9906, 26349, 273, 1910, 1488, 1733, 18, 2640, 26349,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 467, 1482, 1836, 12, 45, 5491, 7187, 6438, 16, 467, 13716, 429, 1123, 13, 1216, 20205, 288, 202, 202, 734, 396, 1488, 12788, 9906, 26349, 273, 1910, 1488, 1733, 18, 2640, 26349,...
outlinks = OutlinkExtractor.getOutlinks("", nutchConf);
outlinks = OutlinkExtractor.getOutlinks("", conf);
public void testGetNoOutlinks() { Outlink[] outlinks = null; outlinks = OutlinkExtractor.getOutlinks(null, nutchConf); assertNotNull(outlinks); assertEquals(0, outlinks.length); outlinks = OutlinkExtractor.getOutlinks("", nutchConf); assertNotNull(outlinks); assertEquals(0, outlinks.length); }
57484 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57484/25437bc825d50715dcc9a289a1b4c8fbbc6aced1/TestOutlinkExtractor.java/buggy/src/test/org/apache/nutch/parse/TestOutlinkExtractor.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1842, 967, 2279, 1182, 7135, 1435, 288, 565, 2976, 1232, 8526, 225, 596, 7135, 273, 446, 31, 7734, 596, 7135, 273, 2976, 1232, 10958, 18, 588, 1182, 7135, 12, 2011, 16, 290, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1842, 967, 2279, 1182, 7135, 1435, 288, 565, 2976, 1232, 8526, 225, 596, 7135, 273, 446, 31, 7734, 596, 7135, 273, 2976, 1232, 10958, 18, 588, 1182, 7135, 12, 2011, 16, 290, ...
if (names[i].getNodeLocations().length > 0) { start = names[i].getNodeLocations()[0].getNodeOffset(); end = names[i].getNodeLocations()[0].getNodeOffset() + names[i].getNodeLocations()[0].getNodeLength();
if (nodes[i].getNodeLocations().length > 0) { start = nodes[i].getNodeLocations()[0].getNodeOffset(); end = nodes[i].getNodeLocations()[0].getNodeOffset() + nodes[i].getNodeLocations()[0].getNodeLength();
public IStatus run(IProgressMonitor monitor) throws OperationCanceledException { final CSearchResult textResult= (CSearchResult) getSearchResult(); IProgressMonitor mainSearchPM= new SubProgressMonitor(monitor, 1000); NewSearchResultCollector collector = new NewSearchResultCollector(textResult, mainSearchPM); collector.aboutToStart(); for (int i=0; i<names.length; i++) { try { String fileName = null; IFile file = null; IPath path = null; int start = 0; int end = 0; if ( names[i] != null ) { IASTNodeLocation [] location = names[i].getNodeLocations(); if( location.length > 0 && location[0] instanceof IASTFileLocation ) fileName = ((IASTFileLocation)location[0]).getFileName(); // TODO Devin this is in two places now, put into one, and fix up the location[0] for things like macros else fileName = BLANK_STRING; path = new Path(fileName); file = ResourcesPlugin.getWorkspace().getRoot().getFileForLocation(path); if (names[i].getNodeLocations().length > 0) { // fix for 84223 start = names[i].getNodeLocations()[0].getNodeOffset(); end = names[i].getNodeLocations()[0].getNodeOffset() + names[i].getNodeLocations()[0].getNodeLength(); collector.acceptMatch( createMatch(file, start, end, names[i], path ) ); } } } catch (CoreException ce) {} } mainSearchPM.done(); collector.done(); return new Status(IStatus.OK, CTestPlugin.getPluginId(), 0, BLANK_STRING, null); //$NON-NLS-1$ }
54911 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54911/bd9022596d8c2c42847d16dd9a2aa3a13b88a96d/DOMQuery.java/clean/core/org.eclipse.cdt.ui.tests/src/org/eclipse/cdt/ui/tests/DOMAST/DOMQuery.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 467, 1482, 1086, 12, 45, 5491, 7187, 6438, 13, 1082, 202, 15069, 4189, 23163, 503, 288, 9506, 202, 6385, 385, 24916, 977, 1253, 33, 261, 39, 24916, 13, 15627, 1253, 5621, 9506, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 467, 1482, 1086, 12, 45, 5491, 7187, 6438, 13, 1082, 202, 15069, 4189, 23163, 503, 288, 9506, 202, 6385, 385, 24916, 977, 1253, 33, 261, 39, 24916, 13, 15627, 1253, 5621, 9506, ...
assertNotNull( "Cannot find plugin-configuration: \'" + pluginConfigResource + "\' in context-classloader\'s classpath.", resource );
assertTrue( "Cannot find plugin-configuration: \'" + pluginConfigResource + "\' in context-classloader\'s classpath.", pluginConfigFile.exists() );
private void testDependencyMapping( String pluginConfig, List requiredDependencies ) throws Exception { ClassLoader cloader = Thread.currentThread().getContextClassLoader(); String pluginConfigResource = "basicAbstractAssemblyMojoFeaturesTest/" + pluginConfig; URL resource = cloader.getResource( pluginConfigResource ); assertNotNull( "Cannot find plugin-configuration: \'" + pluginConfigResource + "\' in context-classloader\'s classpath.", resource ); // TODO: Need to replace this with test-only mojos... DirectoryMojo mojo = (DirectoryMojo) lookupMojo( "directory", resource.getPath() ); FileLoggingArchiverManagerStub archiverManager = (FileLoggingArchiverManagerStub) getVariableValueFromObject( mojo, "archiverManager" ); archiverManager.clearArchiver(); mojo.execute(); FileLoggingArchiverStub archiver = (FileLoggingArchiverStub) archiverManager.getArchiver( null ); Set addedFiles = archiver.getAddedFiles(); System.out.println( "The following files were added to the test assembly:\n" + addedFiles.toString().replace(',', '\n' ) ); for ( Iterator it = requiredDependencies.iterator(); it.hasNext(); ) { String targetPath = (String) it.next(); assertTrue( "Required dependency path missing: \'" + targetPath + "\'", addedFiles.contains( targetPath ) ); } }
51807 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51807/9bbf4a5e4ef6893d3bcab1dd542c87f5327b02dc/BasicAbstractAssemblyMojoFeaturesTest.java/clean/maven-assembly-plugin/src/test/java/org/apache/maven/plugin/assembly/BasicAbstractAssemblyMojoFeaturesTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1842, 7787, 3233, 12, 514, 1909, 809, 16, 987, 1931, 8053, 262, 1216, 1185, 565, 288, 3639, 9403, 276, 6714, 273, 4884, 18, 2972, 3830, 7675, 29120, 7805, 5621, 7734, 514, 1909...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1842, 7787, 3233, 12, 514, 1909, 809, 16, 987, 1931, 8053, 262, 1216, 1185, 565, 288, 3639, 9403, 276, 6714, 273, 4884, 18, 2972, 3830, 7675, 29120, 7805, 5621, 7734, 514, 1909...
public org.quickfix.field.Pool getPool() throws FieldNotFound { org.quickfix.field.Pool value = new org.quickfix.field.Pool();
public quickfix.field.Pool getPool() throws FieldNotFound { quickfix.field.Pool value = new quickfix.field.Pool();
public org.quickfix.field.Pool getPool() throws FieldNotFound { org.quickfix.field.Pool value = new org.quickfix.field.Pool(); getField(value); return value; }
8803 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8803/fecc27f98261270772ff182a1d4dfd94b5daa73d/ExecutionReport.java/buggy/src/java/src/quickfix/fix44/ExecutionReport.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2358, 18, 19525, 904, 18, 1518, 18, 2864, 28575, 1435, 1216, 2286, 2768, 225, 288, 2358, 18, 19525, 904, 18, 1518, 18, 2864, 460, 273, 394, 2358, 18, 19525, 904, 18, 1518, 18, 286...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2358, 18, 19525, 904, 18, 1518, 18, 2864, 28575, 1435, 1216, 2286, 2768, 225, 288, 2358, 18, 19525, 904, 18, 1518, 18, 2864, 460, 273, 394, 2358, 18, 19525, 904, 18, 1518, 18, 286...
public RubyNumeric op_div(RubyNumeric other) {
public IRubyObject op_div(IRubyObject other) {
public RubyNumeric op_div(RubyNumeric other) { if (other instanceof RubyFloat) { return RubyFloat.newFloat(getRuntime(), getDoubleValue()).op_div(other); } else if (other instanceof RubyBignum) { return RubyBignum.newBignum(getRuntime(), getLongValue()).op_div(other); } // Java / and % are not the same as ruby long x = getLongValue(); long y = other.getLongValue(); long div = x / y; long mod = x % y; if (mod < 0 && y > 0 || mod > 0 && y < 0) { div -= 1; } return getRuntime().newFixnum(div); }
45753 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45753/803c66ee682936beecc8a43fe2cfc90fe5645b22/RubyFixnum.java/buggy/src/org/jruby/RubyFixnum.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 15908, 10340, 921, 1061, 67, 2892, 12, 7937, 10340, 921, 1308, 13, 288, 3639, 309, 261, 3011, 1276, 19817, 4723, 13, 288, 5411, 327, 19817, 4723, 18, 2704, 4723, 12, 588, 5576, 9334...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 15908, 10340, 921, 1061, 67, 2892, 12, 7937, 10340, 921, 1308, 13, 288, 3639, 309, 261, 3011, 1276, 19817, 4723, 13, 288, 5411, 327, 19817, 4723, 18, 2704, 4723, 12, 588, 5576, 9334...
MutableGraphModel mgm = (MutableGraphModel) gm;
public void dragHandle(int mX, int mY, int anX, int anY, Handle hand) { if (hand.index < 10) { setPaintButtons(false); super.dragHandle(mX, mY, anX, anY, hand); return; } int cx = _content.getX(), cy = _content.getY(); int cw = _content.getWidth(), ch = _content.getHeight(); int newX = cx, newY = cy, newW = cw, newH = ch; Dimension minSize = _content.getMinimumSize(); int minWidth = minSize.width, minHeight = minSize.height; Object edgeType = null; Object nodeType = Model.getMetaTypes().getActionState(); Editor ce = Globals.curEditor(); GraphModel gm = ce.getGraphModel(); if (!(gm instanceof MutableGraphModel)) { return; } MutableGraphModel mgm = (MutableGraphModel) gm; int bx = mX, by = mY; boolean reverse = false; switch (hand.index) { case 12: //add incoming edgeType = Model.getMetaTypes().getTransition(); by = cy + ch / 2; bx = cx + cw; break; case 13: // add outgoing edgeType = Model.getMetaTypes().getTransition(); reverse = true; by = cy + ch / 2; bx = cx; break; case 10: // add incoming on top edgeType = Model.getMetaTypes().getTransition(); reverse = true; by = cy; bx = cx + cw / 2; break; case 11: // add outgoing below edgeType = Model.getMetaTypes().getTransition(); by = cy + ch; bx = cx + cw / 2; break; default: LOG.warn("invalid handle number"); break; } if (edgeType != null && nodeType != null) { ModeCreateEdgeAndNode m = new ModeCreateEdgeAndNode(ce, edgeType, nodeType, false); m.setup((FigNode) _content, _content.getOwner(), bx, by, reverse); ce.pushMode(m); } }
7166 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7166/4b064ac5d1687efd437474aa3de8842f78d90882/SelectionActionState.java/clean/src_new/org/argouml/uml/diagram/activity/ui/SelectionActionState.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 8823, 3259, 12, 474, 312, 60, 16, 509, 312, 61, 16, 509, 392, 60, 16, 509, 392, 61, 16, 5004, 948, 13, 288, 202, 430, 261, 2349, 18, 1615, 411, 1728, 13, 288, 202, 565, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 8823, 3259, 12, 474, 312, 60, 16, 509, 312, 61, 16, 509, 392, 60, 16, 509, 392, 61, 16, 5004, 948, 13, 288, 202, 430, 261, 2349, 18, 1615, 411, 1728, 13, 288, 202, 565, ...
assertLex(Parser.PARENCLOSE, lexer);
assertLex(Parser.BRACECLOSE, lexer);
public void testCommentsWithQuotesInAssignment() throws Exception { String in = "{ a x = y /* don't do stuff*/; }"; Lexer lexer = new JFlexLexer(new StringReader(in)); assertLex(Parser.PARENOPEN, lexer); assertLex(Parser.IDENTIFIER, "a", lexer); assertLex(Parser.IDENTIFIER, "x", lexer); assertLex(Parser.ASSIGNMENT, lexer); assertLex(Parser.PARENCLOSE, lexer); assertLex(0, lexer); in = "{ a z = \n" + "// thing's thing \n" + "0; }"; lexer = new JFlexLexer(new StringReader(in)); assertLex(Parser.PARENOPEN, lexer); assertLex(Parser.IDENTIFIER, "a", lexer); assertLex(Parser.IDENTIFIER, "z", lexer); assertLex(Parser.ASSIGNMENT, lexer); assertLex(Parser.PARENCLOSE, lexer); assertLex(0, lexer); }
2045 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2045/fd346fe372b0364733fc6120d6524638208a5181/LexerTest.java/clean/qdox/src/test/com/thoughtworks/qdox/parser/LexerTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 9051, 1190, 14292, 382, 7729, 1435, 1216, 1185, 288, 202, 202, 780, 316, 273, 4144, 279, 619, 273, 677, 1748, 2727, 1404, 741, 10769, 5549, 31, 289, 14432, 202, 202, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 9051, 1190, 14292, 382, 7729, 1435, 1216, 1185, 288, 202, 202, 780, 316, 273, 4144, 279, 619, 273, 677, 1748, 2727, 1404, 741, 10769, 5549, 31, 289, 14432, 202, 202, ...
throw org.postgresql.Driver.notImplemented();
return DatabaseMetaData.sqlStateSQL99;
public int getSQLStateType() throws SQLException { throw org.postgresql.Driver.notImplemented(); }
45534 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45534/509a9cd3f922c38c19d35e81bb1427d663ba4aba/AbstractJdbc3DatabaseMetaData.java/clean/src/interfaces/jdbc/org/postgresql/jdbc3/AbstractJdbc3DatabaseMetaData.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 509, 21708, 1119, 559, 1435, 1216, 6483, 202, 95, 202, 202, 12849, 2358, 18, 2767, 24330, 18, 4668, 18, 902, 8644, 5621, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 509, 21708, 1119, 559, 1435, 1216, 6483, 202, 95, 202, 202, 12849, 2358, 18, 2767, 24330, 18, 4668, 18, 902, 8644, 5621, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, ...
else {
} else {
private Object getNewTarget(Object target) { Project p = ProjectManager.getManager().getCurrentProject(); Object newTarget = null; target = target instanceof Fig ? ((Fig) target).getOwner() : target; if (ModelFacade.isABase(target)) { newTarget = ModelFacade.getModelElementContainer(target); } else if (ModelFacade.isADiagram(target)) { Diagram firstDiagram = (Diagram) p.getDiagrams().get(0); if (target != firstDiagram) newTarget = firstDiagram; else { if (p.getDiagrams().size() > 1) { newTarget = p.getDiagrams().get(1); } else newTarget = p.getRoot(); } } else { newTarget = p.getRoot(); } return newTarget; }
7166 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7166/1866ce2aba8057ad992b7d3853a02863d492ab25/ActionRemoveFromModel.java/clean/src_new/org/argouml/uml/ui/ActionRemoveFromModel.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1033, 12654, 2326, 12, 921, 1018, 13, 288, 3639, 5420, 293, 273, 5420, 1318, 18, 588, 1318, 7675, 588, 3935, 4109, 5621, 3639, 1033, 394, 2326, 273, 446, 31, 3639, 1018, 273, 1018, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1033, 12654, 2326, 12, 921, 1018, 13, 288, 3639, 5420, 293, 273, 5420, 1318, 18, 588, 1318, 7675, 588, 3935, 4109, 5621, 3639, 1033, 394, 2326, 273, 446, 31, 3639, 1018, 273, 1018, ...
public Mode pop() {
public FigModifyingMode pop() {
public Mode pop() { if (_modes.isEmpty()) return null; Mode res = top(); if (res.canExit()) { _modes.removeElement(res); fireModeChanged(); } return res; }
1732 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1732/0390f5a5503029a41560e0164c432a8e88792d37/ModeManager.java/buggy/src/org/tigris/gef/base/ModeManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 478, 360, 11047, 19154, 1843, 1435, 288, 565, 309, 261, 67, 19282, 18, 291, 1921, 10756, 327, 446, 31, 565, 8126, 400, 273, 1760, 5621, 565, 309, 261, 455, 18, 4169, 6767, 10756, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 478, 360, 11047, 19154, 1843, 1435, 288, 565, 309, 261, 67, 19282, 18, 291, 1921, 10756, 327, 446, 31, 565, 8126, 400, 273, 1760, 5621, 565, 309, 261, 455, 18, 4169, 6767, 10756, ...